BN82002 4μM R07 exp340 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== BN82002 4μM R07 exp340 ======
==== Mechanism of Action ====
Inhibits CDC25 phosphatases, active against CDC25A/B/C isoforms
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Phosphatase inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Phosphatase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Phenol, 4-(dimethylamino)-2-methoxy-6-((methyl(2-(4-nitrophenyl)ethyl)amino)methyl)-%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 396073-89-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/9798923|9798923]]
    * **<color #00a2e8>IUPAC:</color>** %%4-(dimethylamino)-2-methoxy-6-[[methyl-[2-(4-nitrophenyl)ethyl]amino]methyl]phenol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C19H25N3O4/c1-20(2)17-11-15(19(23)18(12-17)26-4)13-21(3)10-9-14-5-7-16(8-6-14)22(24)25/h5-8,11-12,23H,9-10,13H2,1-4H3
    * **<color #00a2e8>INCHI Key:</color>** GOKYHQGRIIXMNE-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 359.4
    * **<color #00a2e8>Canonical SMILES:</color>** CN(C)C1=CC(=C(C(=C1)OC)O)CN(C)CCC2=CC=C(C=C2)[N+](=O)[O-]
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C19H25N3O4
{{:chemogenomics:structures:chem-0198.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Millipore
    * **<color #00a2e8>Catalog #:</color>** 217691
    * **<color #00a2e8>Lot #:</color>** 3028829
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C19H25N3O4 360.19178; found 360.19186
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** BN82002
    * **<color #00a2e8>Min:</color>** -4.0820; **<color #00a2e8>Max:</color>** 99.8216
{{:chemogenomics:dose_response:dr_420.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |3.0294    |
| IC30  |3.6817    |
| IC40  |4.3505    |
| IC50  |5.0901    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 4µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 22454921


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|5/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/BN82002_4uM_Round-7_exp340.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='BN82002 4μM R07 exp340'>
{{:chemogenomics:cranks_plots:exp340.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GCLM|GCLM]]|-4.27|<0.01|
|[[:human_genes:S:SLC7A11|SLC7A11]]|-3.30|<0.01|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-3.20|<0.01|
|[[:human_genes:S:SOD1|SOD1]]|-2.88|0.02|
|[[:human_genes:G:GCLC|GCLC]]|-2.83|0.01|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.51|0.28|
|[[:human_genes:A:ACBD3|ACBD3]]|-2.24|0.28|
|[[:human_genes:D:DCAF15|DCAF15]]|-2.23|0.48|
|[[:human_genes:F:FAM194B|FAM194B]]|-2.06|0.57|
|[[:human_genes:S:SFMBT2|SFMBT2]]|-2.06|0.57|
|[[:human_genes:P:PNRC2|PNRC2]]|-2.04|0.57|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-2.02|0.57|
|[[:human_genes:R:RTCB|RTCB]]|-2.01|0.57|
|[[:human_genes:T:TMC2|TMC2]]|-2.00|0.57|
|[[:human_genes:Z:ZRANB2|ZRANB2]]|-1.95|0.57|
|[[:human_genes:Q:QSOX1|QSOX1]]|-1.94|0.57|
|[[:human_genes:M:MTMR12|MTMR12]]|-1.94|0.57|
|[[:human_genes:P:PRRG4|PRRG4]]|-1.92|0.57|
|[[:human_genes:C:CBFB|CBFB]]|-1.92|0.57|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-1.91|0.57|
|[[:human_genes:P:PFDN2|PFDN2]]|-1.90|0.71|
|[[:human_genes:C:C19orf70|C19orf70]]|-1.88|0.57|
|[[:human_genes:N:NPRL2|NPRL2]]|-1.88|0.57|
|[[:human_genes:T:TRAF5|TRAF5]]|-1.88|0.57|
|[[:human_genes:E:EMP2|EMP2]]|-1.87|0.57|
|[[:human_genes:E:ERCC4|ERCC4]]|-1.86|0.58|
|[[:human_genes:L:LIG4|LIG4]]|-1.85|0.71|
|[[:human_genes:P:PRKCG|PRKCG]]|-1.83|0.71|
|[[:human_genes:P:PPP6C|PPP6C]]|-1.83|0.71|
|[[:human_genes:W:WDR47|WDR47]]|-1.82|0.70|
|[[:human_genes:D:DEFB115|DEFB115]]|1.86|0.78|
|[[:human_genes:D:DPPA2|DPPA2]]|1.86|0.78|
|[[:human_genes:C:CNTNAP2|CNTNAP2]]|1.88|0.78|
|[[:human_genes:B:BAGE4|BAGE4]]|1.89|0.79|
|[[:human_genes:B:BAGE5|BAGE5]]|1.89|0.79|
|[[:human_genes:B:BAGE2|BAGE2]]|1.89|0.79|
|[[:human_genes:B:BAGE3|BAGE3]]|1.89|0.79|
|[[:human_genes:B:BAGE|BAGE]]|1.89|0.79|
|[[:human_genes:K:KPNB1|KPNB1]]|1.92|0.79|
|[[:human_genes:C:COL21A1|COL21A1]]|1.93|0.78|
|[[:human_genes:C:CCNA2|CCNA2]]|1.94|0.78|
|[[:human_genes:N:NSUN5|NSUN5]]|1.95|0.78|
|[[:human_genes:C:CASZ1|CASZ1]]|1.96|0.78|
|[[:human_genes:G:GCM1|GCM1]]|1.96|0.76|
|[[:human_genes:I:ISCU|ISCU]]|1.97|0.79|
|[[:human_genes:C:CLK3|CLK3]]|2.01|0.69|
|[[:human_genes:P:PSMA7|PSMA7]]|2.03|0.79|
|[[:human_genes:M:MMRN1|MMRN1]]|2.06|0.65|
|[[:human_genes:P:PSMD2|PSMD2]]|2.08|0.76|
|[[:human_genes:M:MIR205HG|MIR205HG]]|2.14|0.79|
|[[:human_genes:T:TTK|TTK]]|2.15|0.69|
|[[:human_genes:M:METTL21A|METTL21A]]|2.16|0.48|
|[[:human_genes:D:DUSP7|DUSP7]]|2.22|0.42|
|[[:human_genes:G:GAP43|GAP43]]|2.23|0.59|
|[[:human_genes:C:CEP78|CEP78]]|2.26|0.42|
|[[:human_genes:H:HSPA12B|HSPA12B]]|2.35|0.42|
|[[:human_genes:L:LRRC30|LRRC30]]|2.38|0.42|
|[[:human_genes:M:MIER3|MIER3]]|2.42|0.42|
|[[:human_genes:P:POLR2J|POLR2J]]|2.62|0.78|
|[[:human_genes:L:LIG1|LIG1]]|2.80|0.79|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp239|PFI-2 4μM R05 exp239]]|0.056|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp185|L-BMAA 500 to 750μM on day4 R04 exp185]]|0.051|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="BN82002 4μM R07 exp340  vs  PFI-2 4μM R05 exp239">
{{:chemogenomics:comparison_plots:exp239_vs_exp340.png?nolink |}}
</modal>

<modal id="2" size="lg" title="BN82002 4μM R07 exp340  vs  L-BMAA 500 to 750μM on day4 R04 exp185">
{{:chemogenomics:comparison_plots:exp185_vs_exp340.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|GATOR1 complex|614.04|NPRL3,NPRL2|
|glutathione metabolic process|47.23|GCLM,SLC7A11,SOD1,GCLC|
|negative regulation of neuron apoptotic process|19.68|GCLM,SOD1,GCLC,LIG4,PRKCG|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>