BRD2 inhibitor II 20μM R07 exp341 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== BRD2 inhibitor II 20μM R07 exp341 ======
==== Mechanism of Action ====
Inhibits BRD2, blocks recognition of acetylated H4K12
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%1-[2-(1H-Benzimidazol-2-ylsulfanyl)ethyl]-3-methyl-1,3-dihydro-2H-benzimidazole-2-thione%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 433249-32-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/672548|672548]]
    * **<color #00a2e8>IUPAC:</color>** %%1-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-3-methylbenzimidazole-2-thione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C17H16N4S2/c1-20-14-8-4-5-9-15(14)21(17(20)22)10-11-23-16-18-12-6-2-3-7-13(12)19-16/h2-9H,10-11H2,1H3,(H,18,19)
    * **<color #00a2e8>INCHI Key:</color>** KDPSGIFCBZTBEZ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 340.5
    * **<color #00a2e8>Canonical SMILES:</color>** CN1C2=CC=CC=C2N(C1=S)CCSC3=NC4=CC=CC=C4N3
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C17H16N4S2
{{:chemogenomics:structures:chem-0199.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Calbiochem
    * **<color #00a2e8>Catalog #:</color>** 203830
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C17H16N4S2 341.08891; found 341.09007
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** BRD2_inhibitor_II
    * **<color #00a2e8>Min:</color>** -10.0210; **<color #00a2e8>Max:</color>** 25.0673
{{:chemogenomics:dose_response:dr_421.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.7
    * **<color #00a2e8>Numbers of reads</color>**: 18711037


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/BRD2_inhibitor_II_20uM_Round-7_exp341.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='BRD2 inhibitor II 20μM R07 exp341'>
{{:chemogenomics:cranks_plots:exp341.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KDSR|KDSR]]|-3.62|<0.01|
|[[:human_genes:F:FLVCR1|FLVCR1]]|-3.31|<0.01|
|[[:human_genes:D:DKC1|DKC1]]|-2.69|0.47|
|[[:human_genes:C:CEPT1|CEPT1]]|-2.69|0.04|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.61|0.05|
|[[:human_genes:M:MRPS33|MRPS33]]|-2.44|0.15|
|[[:human_genes:S:SCAP|SCAP]]|-2.40|0.13|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.38|0.13|
|[[:human_genes:P:PLEKHA3|PLEKHA3]]|-2.31|0.27|
|[[:human_genes:T:TSPEAR|TSPEAR]]|-2.30|0.15|
|[[:human_genes:R:RTCB|RTCB]]|-2.23|0.35|
|[[:human_genes:N:NAE1|NAE1]]|-2.21|0.35|
|[[:human_genes:Z:ZIC5|ZIC5]]|-2.21|0.35|
|[[:human_genes:T:TBCD|TBCD]]|-2.15|0.39|
|[[:human_genes:G:GYPE|GYPE]]|-2.09|0.56|
|[[:human_genes:S:SSB|SSB]]|-2.07|0.35|
|[[:human_genes:D:DHX30|DHX30]]|-2.05|0.49|
|[[:human_genes:L:LEO1|LEO1]]|-2.03|0.39|
|[[:human_genes:W:WFDC8|WFDC8]]|-2.01|0.40|
|[[:human_genes:A:ATP5J|ATP5J]]|-1.97|0.47|
|[[:human_genes:P:PPIP5K2|PPIP5K2]]|-1.96|0.47|
|[[:human_genes:P:PHYKPL|PHYKPL]]|-1.96|0.47|
|[[:human_genes:C:CEP57|CEP57]]|-1.96|0.47|
|[[:human_genes:E:ESX1|ESX1]]|-1.95|0.47|
|[[:human_genes:Z:ZNF813|ZNF813]]|-1.95|0.47|
|[[:human_genes:F:FOXE3|FOXE3]]|-1.94|0.47|
|[[:human_genes:N:NOC3L|NOC3L]]|-1.93|0.69|
|[[:human_genes:O:OR11H4|OR11H4]]|-1.93|0.47|
|[[:human_genes:Z:ZNF117|ZNF117]]|-1.92|0.49|
|[[:human_genes:E:EHF|EHF]]|-1.91|0.47|
|[[:human_genes:T:THOC2|THOC2]]|1.88|0.66|
|[[:human_genes:D:DBNDD2|DBNDD2]]|1.88|0.66|
|[[:human_genes:D:DTX3|DTX3]]|1.92|0.66|
|[[:human_genes:I:IL18RAP|IL18RAP]]|1.95|0.66|
|[[:human_genes:T:TSR2|TSR2]]|1.97|0.75|
|[[:human_genes:I:INTS5|INTS5]]|1.99|0.66|
|[[:human_genes:P:PSMC5|PSMC5]]|1.99|0.66|
|[[:human_genes:S:SLFN5|SLFN5]]|2.02|0.66|
|[[:human_genes:D:DDX47|DDX47]]|2.02|0.66|
|[[:human_genes:C:CROCC|CROCC]]|2.03|0.66|
|[[:human_genes:C:CKAP5|CKAP5]]|2.04|0.66|
|[[:human_genes:U:USP16|USP16]]|2.06|0.66|
|[[:human_genes:E:EBNA1BP2|EBNA1BP2]]|2.07|0.66|
|[[:human_genes:N:NUP160|NUP160]]|2.08|0.66|
|[[:human_genes:D:DOCK6|DOCK6]]|2.09|0.66|
|[[:human_genes:P:PDS5B|PDS5B]]|2.11|0.62|
|[[:human_genes:M:MCM7|MCM7]]|2.12|0.66|
|[[:human_genes:C:CDC73|CDC73]]|2.13|0.66|
|[[:human_genes:N:NUP205|NUP205]]|2.14|0.66|
|[[:human_genes:M:MDN1|MDN1]]|2.20|0.66|
|[[:human_genes:Z:ZNF101|ZNF101]]|2.22|0.53|
|[[:human_genes:T:TRA2B|TRA2B]]|2.22|0.66|
|[[:human_genes:N:NHSL1|NHSL1]]|2.22|0.62|
|[[:human_genes:S:STIL|STIL]]|2.28|0.62|
|[[:human_genes:S:SOCS3|SOCS3]]|2.40|0.53|
|[[:human_genes:P:PELP1|PELP1]]|2.43|0.66|
|[[:human_genes:P:PLRG1|PLRG1]]|2.47|0.53|
|[[:human_genes:N:NOP16|NOP16]]|2.53|0.66|
|[[:human_genes:H:HOXC13|HOXC13]]|2.54|0.32|
|[[:human_genes:P:POLR2L|POLR2L]]|2.96|0.66|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp375|Lenalidomide 20μM R07 exp375]]|0.076|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp77|Prochlorperazine 5.2μM R02 exp77]]|0.066|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.06|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp348|Cyclosporin-A 3μM R07 exp348]]|0.06|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp155|UNC1999 2μM R03 exp155]]|0.057|<button type="primary" size="small" modal="5">View</button>|
|[[:results:exp538|ZLN024 50μM R08 exp538]]|0.054|<button type="primary" size="small" modal="6">View</button>|
|[[:results:exp47|Lapatinib 5μM R01 exp47]]|0.053|<button type="primary" size="small" modal="7">View</button>|
|[[:results:exp326|CCT251545 20μM R07 exp326]]|0.053|<button type="primary" size="small" modal="8">View</button>|
|[[:results:exp336|Asunaprenir 3μM R07 exp336]]|0.053|<button type="primary" size="small" modal="9">View</button>|
</modal>


<modal id="1" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  Lenalidomide 20μM R07 exp375">
{{:chemogenomics:comparison_plots:exp341_vs_exp375.png?nolink |}}
</modal>

<modal id="2" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  Prochlorperazine 5.2μM R02 exp77">
{{:chemogenomics:comparison_plots:exp341_vs_exp77.png?nolink |}}
</modal>

<modal id="3" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp149_vs_exp341.png?nolink |}}
</modal>

<modal id="4" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  Cyclosporin-A 3μM R07 exp348">
{{:chemogenomics:comparison_plots:exp341_vs_exp348.png?nolink |}}
</modal>

<modal id="5" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  UNC1999 2μM R03 exp155">
{{:chemogenomics:comparison_plots:exp155_vs_exp341.png?nolink |}}
</modal>

<modal id="6" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  ZLN024 50μM R08 exp538">
{{:chemogenomics:comparison_plots:exp341_vs_exp538.png?nolink |}}
</modal>

<modal id="7" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  Lapatinib 5μM R01 exp47">
{{:chemogenomics:comparison_plots:exp341_vs_exp47.png?nolink |}}
</modal>

<modal id="8" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  CCT251545 20μM R07 exp326">
{{:chemogenomics:comparison_plots:exp326_vs_exp341.png?nolink |}}
</modal>

<modal id="9" size="lg" title="Asunaprenir 3μM R07 exp336  vs  BRD2 inhibitor II 20μM R07 exp341">
{{:chemogenomics:comparison_plots:exp336_vs_exp341.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>