Lenalidomide 20μM R07 exp375 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Lenalidomide 20μM R07 exp375 ======
==== Mechanism of Action ====
IMiD that targets IKZF1/3 for ubiquitination by CUL4-cereblon complex
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Bivalent Ligand




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Lenalidomide%%
    * **<color #00a2e8>Synonyms:</color>** CC-5013
    * **<color #00a2e8>CAS #:</color>** 191732-72-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/216326|216326]]
    * **<color #00a2e8>IUPAC:</color>** %%3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18)
    * **<color #00a2e8>INCHI Key:</color>** GOTYRUGSSMKFNF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 259.26
    * **<color #00a2e8>Canonical SMILES:</color>** C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C13H13N3O3
{{:chemogenomics:structures:chem-0222.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Tocris Bioscience
    * **<color #00a2e8>Catalog #:</color>** 6305
    * **<color #00a2e8>Lot #:</color>** 1A/208763
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C13H13N3O3 260.10297; found 260.10235
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** rac-Lenalidomide
    * **<color #00a2e8>Min:</color>** -12.7941; **<color #00a2e8>Max:</color>** 12.6820
{{:chemogenomics:dose_response:dr_443.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 23498290


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Lenalidomide_20uM_Round-7_exp375.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Lenalidomide 20μM R07 exp375'>
{{:chemogenomics:cranks_plots:exp375.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NSD1|NSD1]]|-2.89|0.11|
|[[:human_genes:R:RTCB|RTCB]]|-2.57|0.14|
|[[:human_genes:A:ABCG5|ABCG5]]|-2.56|0.13|
|[[:human_genes:Z:ZNF165|ZNF165]]|-2.48|0.13|
|[[:human_genes:K:KCNS2|KCNS2]]|-2.45|0.30|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|-2.43|0.51|
|[[:human_genes:T:TXNL4B|TXNL4B]]|-2.39|0.14|
|[[:human_genes:G:GTF2A2|GTF2A2]]|-2.31|0.48|
|[[:human_genes:H:HS3ST1|HS3ST1]]|-2.24|0.28|
|[[:human_genes:I:IGDCC4|IGDCC4]]|-2.22|0.28|
|[[:human_genes:O:OIP5|OIP5]]|-2.19|0.29|
|[[:human_genes:G:GPR179|GPR179]]|-2.18|0.46|
|[[:human_genes:H:HSPA4|HSPA4]]|-2.15|0.47|
|[[:human_genes:A:ATP13A3|ATP13A3]]|-2.11|0.48|
|[[:human_genes:P:PTCH1|PTCH1]]|-2.08|0.48|
|[[:human_genes:T:TPM3|TPM3]]|-2.06|0.46|
|[[:human_genes:M:MRPS33|MRPS33]]|-2.03|0.48|
|[[:human_genes:V:VEZT|VEZT]]|-2.02|0.47|
|[[:human_genes:T:TMEM41B|TMEM41B]]|-1.98|0.48|
|[[:human_genes:C:C7orf55-LUC7L2|C7orf55-LUC7L2]]|-1.96|0.48|
|[[:human_genes:A:AADACL4|AADACL4]]|-1.96|0.48|
|[[:human_genes:B:BMX|BMX]]|-1.95|0.48|
|[[:human_genes:P:PMM2|PMM2]]|-1.94|0.48|
|[[:human_genes:N:NPRL3|NPRL3]]|-1.94|0.58|
|[[:human_genes:A:ASB3|ASB3]]|-1.93|0.53|
|[[:human_genes:O:OSBPL3|OSBPL3]]|-1.92|0.48|
|[[:human_genes:C:CRCP|CRCP]]|-1.91|0.53|
|[[:human_genes:T:TRIAP1|TRIAP1]]|-1.89|0.55|
|[[:human_genes:S:SYNCRIP|SYNCRIP]]|-1.88|0.60|
|[[:human_genes:A:ANO5|ANO5]]|-1.87|0.48|
|[[:human_genes:C:CNTLN|CNTLN]]|1.94|0.48|
|[[:human_genes:P:PTPN5|PTPN5]]|1.94|0.48|
|[[:human_genes:E:EPHA5|EPHA5]]|1.96|0.48|
|[[:human_genes:P:PDE4D|PDE4D]]|1.96|0.63|
|[[:human_genes:E:EIF6|EIF6]]|1.98|0.73|
|[[:human_genes:N:NPAT|NPAT]]|2.04|0.39|
|[[:human_genes:S:SPAG17|SPAG17]]|2.05|0.39|
|[[:human_genes:E:ETF1|ETF1]]|2.06|0.48|
|[[:human_genes:C:CLCN2|CLCN2]]|2.07|0.39|
|[[:human_genes:T:TSPY8|TSPY8]]|2.07|0.79|
|[[:human_genes:A:ACIN1|ACIN1]]|2.09|0.48|
|[[:human_genes:R:RPS8|RPS8]]|2.11|0.75|
|[[:human_genes:A:ARCN1|ARCN1]]|2.13|0.60|
|[[:human_genes:Z:ZNF93|ZNF93]]|2.15|0.39|
|[[:human_genes:C:C18orf8|C18orf8]]|2.15|0.39|
|[[:human_genes:N:NUDCD1|NUDCD1]]|2.16|0.39|
|[[:human_genes:K:KIAA1211|KIAA1211]]|2.16|0.73|
|[[:human_genes:C:CKAP5|CKAP5]]|2.17|0.73|
|[[:human_genes:S:SREK1|SREK1]]|2.17|0.39|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.19|0.76|
|[[:human_genes:S:STIL|STIL]]|2.20|0.39|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.20|0.39|
|[[:human_genes:G:GPX5|GPX5]]|2.24|0.39|
|[[:human_genes:M:MFSD9|MFSD9]]|2.34|0.39|
|[[:human_genes:P:PLEKHA2|PLEKHA2]]|2.36|0.39|
|[[:human_genes:P:PLRG1|PLRG1]]|2.38|0.39|
|[[:human_genes:T:TUBB4A|TUBB4A]]|2.44|0.39|
|[[:human_genes:C:CROCC|CROCC]]|2.49|0.39|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.61|0.76|
|[[:human_genes:D:DHX38|DHX38]]|2.69|0.39|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp341|BRD2 inhibitor II 20μM R07 exp341]]|0.076|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp336|Asunaprenir 3μM R07 exp336]]|0.053|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="BRD2 inhibitor II 20μM R07 exp341  vs  Lenalidomide 20μM R07 exp375">
{{:chemogenomics:comparison_plots:exp341_vs_exp375.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Asunaprenir 3μM R07 exp336  vs  Lenalidomide 20μM R07 exp375">
{{:chemogenomics:comparison_plots:exp336_vs_exp375.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>