Salubrinal 20μM R07 exp399 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Salubrinal 20μM R07 exp399 ======
==== Mechanism of Action ====
Inhibits eIF2‘± phosphatase, indirectly inhibits eIF2‘±
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Translation Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Salubrinal%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 405060-95-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5717801|5717801]]
    * **<color #00a2e8>IUPAC:</color>** %%(E)-3-phenyl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]prop-2-enamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C21H17Cl3N4OS/c22-21(23,24)19(27-17(29)12-11-14-6-2-1-3-7-14)28-20(30)26-16-10-4-8-15-9-5-13-25-18(15)16/h1-13,19H,(H,27,29)(H2,26,28,30)/b12-11+
    * **<color #00a2e8>INCHI Key:</color>** LCOIAYJMPKXARU-VAWYXSNFSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 479.8
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC=C(C=C1)C=CC(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC2=CC=CC3=C2N=CC=C3
    * **<color #00a2e8>Isomeric SMILES:</color>** C1=CC=C(C=C1)/C=C/C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC2=CC=CC3=C2N=CC=C3
    * **<color #00a2e8>Molecular Formula:</color>** C21H17Cl3N4OS
{{:chemogenomics:structures:chem-0237.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** S100550
    * **<color #00a2e8>Lot #:</color>** 6-SXG-126-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C21H17Cl3N4OS 479.02614; found 479.02862
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Salubrinal
    * **<color #00a2e8>Min:</color>** -20.2185; **<color #00a2e8>Max:</color>** 15.7327
{{:chemogenomics:dose_response:dr_400.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.7
    * **<color #00a2e8>Numbers of reads</color>**: 22757578


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Salubrinal_20uM_Round-7_exp399.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Salubrinal 20μM R07 exp399'>
{{:chemogenomics:cranks_plots:exp399.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:P:PARL|PARL]]|-3.01|0.02|
|[[:human_genes:A:ADCK3|ADCK3]]|-2.86|0.02|
|[[:human_genes:P:PDSS1|PDSS1]]|-2.46|0.14|
|[[:human_genes:A:ASB3|ASB3]]|-2.45|0.15|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.42|0.14|
|[[:human_genes:C:CEPT1|CEPT1]]|-2.40|0.14|
|[[:human_genes:U:USE1|USE1]]|-2.33|0.15|
|[[:human_genes:T:TAF5L|TAF5L]]|-2.30|0.23|
|[[:human_genes:P:PEX7|PEX7]]|-2.30|0.15|
|[[:human_genes:A:ATP6V1D|ATP6V1D]]|-2.23|0.26|
|[[:human_genes:O:OPA3|OPA3]]|-2.18|0.23|
|[[:human_genes:C:CRCP|CRCP]]|-2.16|0.32|
|[[:human_genes:T:TCF4|TCF4]]|-2.16|0.23|
|[[:human_genes:L:LOC147646|LOC147646]]|-2.16|0.23|
|[[:human_genes:P:PCSK7|PCSK7]]|-2.13|0.23|
|[[:human_genes:B:BCL11A|BCL11A]]|-2.13|0.23|
|[[:human_genes:A:ALG5|ALG5]]|-2.07|0.27|
|[[:human_genes:P:PPP2R2A|PPP2R2A]]|-2.07|0.27|
|[[:human_genes:T:TRAF2|TRAF2]]|-2.04|0.32|
|[[:human_genes:A:ARFRP1|ARFRP1]]|-2.04|0.32|
|[[:human_genes:T:TSC1|TSC1]]|-2.03|0.32|
|[[:human_genes:C:C13orf45|C13orf45]]|-2.03|0.32|
|[[:human_genes:L:LMOD1|LMOD1]]|-2.02|0.47|
|[[:human_genes:E:EXOC6B|EXOC6B]]|-2.02|0.32|
|[[:human_genes:C:CXXC11|CXXC11]]|-2.01|0.32|
|[[:human_genes:Z:ZDHHC5|ZDHHC5]]|-1.99|0.36|
|[[:human_genes:K:KHDRBS1|KHDRBS1]]|-1.98|0.32|
|[[:human_genes:C:CSNK2A1|CSNK2A1]]|-1.98|0.36|
|[[:human_genes:O:OR4K17|OR4K17]]|-1.98|0.32|
|[[:human_genes:C:CHD8|CHD8]]|-1.97|0.36|
|[[:human_genes:C:CRNKL1|CRNKL1]]|1.96|0.57|
|[[:human_genes:C:CHRNB1|CHRNB1]]|1.97|0.51|
|[[:human_genes:D:DPH3|DPH3]]|1.98|0.48|
|[[:human_genes:A:ATP6V0A2|ATP6V0A2]]|2.00|0.48|
|[[:human_genes:Z:ZXDB|ZXDB]]|2.00|0.48|
|[[:human_genes:B:BRMS1|BRMS1]]|2.01|0.54|
|[[:human_genes:G:GRHL1|GRHL1]]|2.01|0.48|
|[[:human_genes:Z:ZCWPW1|ZCWPW1]]|2.01|0.48|
|[[:human_genes:P:PPM1G|PPM1G]]|2.02|0.48|
|[[:human_genes:W:WDR4|WDR4]]|2.03|0.41|
|[[:human_genes:U:UVRAG|UVRAG]]|2.04|0.41|
|[[:human_genes:C:CDK8|CDK8]]|2.06|0.48|
|[[:human_genes:C:CEP95|CEP95]]|2.07|0.37|
|[[:human_genes:S:SHMT2|SHMT2]]|2.09|0.48|
|[[:human_genes:R:RBM39|RBM39]]|2.10|0.62|
|[[:human_genes:E:ESD|ESD]]|2.17|0.28|
|[[:human_genes:K:KMT2D|KMT2D]]|2.23|0.27|
|[[:human_genes:Z:ZNF217|ZNF217]]|2.23|0.34|
|[[:human_genes:P:PMVK|PMVK]]|2.24|0.27|
|[[:human_genes:C:CKAP5|CKAP5]]|2.24|0.54|
|[[:human_genes:F:FAM98B|FAM98B]]|2.27|0.27|
|[[:human_genes:L:LUC7L|LUC7L]]|2.27|0.29|
|[[:human_genes:M:MORN2|MORN2]]|2.27|0.54|
|[[:human_genes:O:OR51D1|OR51D1]]|2.27|0.27|
|[[:human_genes:C:CXorf64|CXorf64]]|2.30|0.28|
|[[:human_genes:G:GDNF|GDNF]]|2.31|0.27|
|[[:human_genes:H:HSPE1|HSPE1]]|2.34|0.57|
|[[:human_genes:M:METTL1|METTL1]]|2.50|0.27|
|[[:human_genes:R:RBM26|RBM26]]|2.68|0.17|
|[[:human_genes:S:SGTA|SGTA]]|2.79|0.06|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp227|Cryptotanshinone 12μM R05 exp227]]|0.053|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp269|Bisphenol A 100μM R06 exp269]]|0.051|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="Cryptotanshinone 12μM R05 exp227  vs  Salubrinal 20μM R07 exp399">
{{:chemogenomics:comparison_plots:exp227_vs_exp399.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Bisphenol A 100μM R06 exp269  vs  Salubrinal 20μM R07 exp399">
{{:chemogenomics:comparison_plots:exp269_vs_exp399.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>