SNS-032 25μM R07 exp401 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== SNS-032 25μM R07 exp401 ======
==== Mechanism of Action ====
Inhibits CDK2, CDK7, CDK9
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Cyclin Dependent Kinase Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Sns-032%%
    * **<color #00a2e8>Synonyms:</color>** BMS-387032
    * **<color #00a2e8>CAS #:</color>** 345627-80-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/3025986|3025986]]
    * **<color #00a2e8>IUPAC:</color>** %%N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]piperidine-4-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C17H24N4O2S2/c1-17(2,3)12-8-19-13(23-12)10-24-14-9-20-16(25-14)21-15(22)11-4-6-18-7-5-11/h8-9,11,18H,4-7,10H2,1-3H3,(H,20,21,22)
    * **<color #00a2e8>INCHI Key:</color>** OUSFTKFNBAZUKL-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 380.5
    * **<color #00a2e8>Canonical SMILES:</color>** CC(C)(C)C1=CN=C(O1)CSC2=CN=C(S2)NC(=O)C3CCNCC3
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C17H24N4O2S2
{{:chemogenomics:structures:chem-0239.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Ark Pharm Inc.
    * **<color #00a2e8>Catalog #:</color>** AK113734
    * **<color #00a2e8>Lot #:</color>** WG0165410-180313001
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C17H24N4O2S2 381.14134; found 381.14119
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** SNS-032
    * **<color #00a2e8>Min:</color>** -14.2699; **<color #00a2e8>Max:</color>** 96.2471
{{:chemogenomics:dose_response:dr_449.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |17.2802    |
| IC30  |19.7073    |
| IC40  |22.2581    |
| IC50  |25.1188    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 25µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: -0.1
    * **<color #00a2e8>Numbers of reads</color>**: 19877691


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/SNS-032_25uM_Round-7_exp401.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='SNS-032 25μM R07 exp401'>
{{:chemogenomics:cranks_plots:exp401.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:R:RPL8|RPL8]]|-3.03|0.39|
|[[:human_genes:R:RFC1|RFC1]]|-2.84|0.18|
|[[:human_genes:C:CDT1|CDT1]]|-2.75|0.18|
|[[:human_genes:E:ELOF1|ELOF1]]|-2.65|0.15|
|[[:human_genes:R:RAB1B|RAB1B]]|-2.49|0.18|
|[[:human_genes:L:LRR1|LRR1]]|-2.41|0.34|
|[[:human_genes:S:SKIV2L2|SKIV2L2]]|-2.41|0.56|
|[[:human_genes:T:TOPBP1|TOPBP1]]|-2.38|0.24|
|[[:human_genes:Y:YTHDC1|YTHDC1]]|-2.36|0.42|
|[[:human_genes:A:ATP6V0A2|ATP6V0A2]]|-2.35|0.22|
|[[:human_genes:M:MCTS1|MCTS1]]|-2.35|0.18|
|[[:human_genes:P:PDCL2|PDCL2]]|-2.35|0.22|
|[[:human_genes:R:RPS12|RPS12]]|-2.34|0.18|
|[[:human_genes:C:CDC73|CDC73]]|-2.33|0.39|
|[[:human_genes:C:C22orf29|C22orf29]]|-2.30|0.23|
|[[:human_genes:C:CTAGE9|CTAGE9]]|-2.24|0.22|
|[[:human_genes:T:TPX2|TPX2]]|-2.24|0.24|
|[[:human_genes:N:NEK3|NEK3]]|-2.21|0.22|
|[[:human_genes:A:AURKB|AURKB]]|-2.17|0.57|
|[[:human_genes:P:PSMB4|PSMB4]]|-2.17|0.23|
|[[:human_genes:W:WDR61|WDR61]]|-2.15|0.39|
|[[:human_genes:T:TSPAN12|TSPAN12]]|-2.15|0.23|
|[[:human_genes:B:BCL2L1|BCL2L1]]|-2.15|0.33|
|[[:human_genes:G:GIF|GIF]]|-2.14|0.23|
|[[:human_genes:E:ELMSAN1|ELMSAN1]]|-2.13|0.23|
|[[:human_genes:P:PPM1D|PPM1D]]|-2.12|0.39|
|[[:human_genes:R:RING1|RING1]]|-2.10|0.34|
|[[:human_genes:T:TECPR1|TECPR1]]|-2.09|0.34|
|[[:human_genes:S:SPCS1|SPCS1]]|-2.07|0.39|
|[[:human_genes:A:APOLD1|APOLD1]]|-2.04|0.32|
|[[:human_genes:M:MRPS36|MRPS36]]|1.94|0.64|
|[[:human_genes:T:TRAPPC3|TRAPPC3]]|1.96|0.36|
|[[:human_genes:F:FAF2|FAF2]]|1.97|0.51|
|[[:human_genes:M:MIB1|MIB1]]|2.00|0.35|
|[[:human_genes:G:GGPS1|GGPS1]]|2.02|0.34|
|[[:human_genes:C:CYCS|CYCS]]|2.04|0.34|
|[[:human_genes:C:C1orf56|C1orf56]]|2.04|0.34|
|[[:human_genes:R:RAD1|RAD1]]|2.05|0.34|
|[[:human_genes:D:DDX39A|DDX39A]]|2.07|0.34|
|[[:human_genes:C:CPSF6|CPSF6]]|2.07|0.56|
|[[:human_genes:F:FRG2B|FRG2B]]|2.07|0.34|
|[[:human_genes:P:PRELID1|PRELID1]]|2.09|0.36|
|[[:human_genes:P:PGK1|PGK1]]|2.09|0.36|
|[[:human_genes:C:COX5B|COX5B]]|2.13|0.35|
|[[:human_genes:E:EIF2B3|EIF2B3]]|2.15|0.34|
|[[:human_genes:T:TRIM26|TRIM26]]|2.15|0.32|
|[[:human_genes:P:PHB2|PHB2]]|2.17|0.59|
|[[:human_genes:Q:QARS|QARS]]|2.18|0.59|
|[[:human_genes:F:FCGRT|FCGRT]]|2.19|0.34|
|[[:human_genes:C:CARS|CARS]]|2.22|0.36|
|[[:human_genes:B:BAK1|BAK1]]|2.22|0.25|
|[[:human_genes:T:TXNL4B|TXNL4B]]|2.31|0.17|
|[[:human_genes:A:ALDOA|ALDOA]]|2.33|0.68|
|[[:human_genes:D:DDX6|DDX6]]|2.42|0.32|
|[[:human_genes:A:ATP5A1|ATP5A1]]|2.44|0.11|
|[[:human_genes:R:RPE|RPE]]|2.61|0.11|
|[[:human_genes:T:TMEM52B|TMEM52B]]|2.75|0.11|
|[[:human_genes:M:METAP2|METAP2]]|2.81|0.11|
|[[:human_genes:E:EPRS|EPRS]]|2.95|0.11|
|[[:human_genes:A:ATP13A3|ATP13A3]]|3.28|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>