Tenofovir 10μM R07 exp405 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Tenofovir 10μM R07 exp405 ======
==== Mechanism of Action ====
Nucleoside reverse transcriptase inhibitor, chain terminator
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antiviral




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Tenofovir%%
    * **<color #00a2e8>Synonyms:</color>** GS 1278; PMPA; TDF
    * **<color #00a2e8>CAS #:</color>** 147127-20-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/464205|464205]]
    * **<color #00a2e8>IUPAC:</color>** %%[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C9H14N5O4P/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/t6-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** SGOIRFVFHAKUTI-ZCFIWIBFSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 287.21
    * **<color #00a2e8>Canonical SMILES:</color>** CC(CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O
    * **<color #00a2e8>Molecular Formula:</color>** C9H14N5O4P
{{:chemogenomics:structures:chem-0243.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** T018500
    * **<color #00a2e8>Lot #:</color>** 1-JMO-90-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M-H)- Calcd for C9H14N5O4P 286.07106; found 286.07163
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Tenofovir
    * **<color #00a2e8>Min:</color>** -6.2246; **<color #00a2e8>Max:</color>** 26.6056
{{:chemogenomics:dose_response:dr_404.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.9
    * **<color #00a2e8>Numbers of reads</color>**: 24468403


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Tenofovir_10uM_Round-7_exp405.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Tenofovir 10μM R07 exp405'>
{{:chemogenomics:cranks_plots:exp405.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SEPHS1|SEPHS1]]|-3.16|<0.01|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.76|0.54|
|[[:human_genes:W:WWC2|WWC2]]|-2.73|0.05|
|[[:human_genes:D:DHPS|DHPS]]|-2.64|0.34|
|[[:human_genes:Q:QRICH1|QRICH1]]|-2.50|0.35|
|[[:human_genes:D:DERL1|DERL1]]|-2.27|0.35|
|[[:human_genes:S:SEC61A2|SEC61A2]]|-2.22|0.35|
|[[:human_genes:I:INTS3|INTS3]]|-2.18|0.54|
|[[:human_genes:A:ALG13|ALG13]]|-2.17|0.37|
|[[:human_genes:Z:ZNF688|ZNF688]]|-2.14|0.54|
|[[:human_genes:V:VN1R2|VN1R2]]|-2.12|0.40|
|[[:human_genes:G:GTF3C2|GTF3C2]]|-2.10|0.54|
|[[:human_genes:C:CST7|CST7]]|-2.09|0.40|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-2.08|0.40|
|[[:human_genes:D:DNAJC13|DNAJC13]]|-2.08|0.40|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|-2.04|0.87|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|-2.03|0.87|
|[[:human_genes:O:OR6N2|OR6N2]]|-1.99|0.54|
|[[:human_genes:H:HIST1H2AK|HIST1H2AK]]|-1.99|0.54|
|[[:human_genes:E:EPRS|EPRS]]|-1.96|0.61|
|[[:human_genes:Z:ZNF444|ZNF444]]|-1.95|0.54|
|[[:human_genes:U:USMG5|USMG5]]|-1.95|0.88|
|[[:human_genes:U:URI1|URI1]]|-1.93|0.54|
|[[:human_genes:S:SPATA22|SPATA22]]|-1.92|0.54|
|[[:human_genes:C:CAPG|CAPG]]|-1.92|0.54|
|[[:human_genes:A:ALK|ALK]]|-1.92|0.54|
|[[:human_genes:G:GPNMB|GPNMB]]|-1.91|0.54|
|[[:human_genes:P:PCK2|PCK2]]|-1.91|0.54|
|[[:human_genes:A:ARFRP1|ARFRP1]]|-1.88|0.54|
|[[:human_genes:W:WDR82|WDR82]]|-1.88|0.60|
|[[:human_genes:P:PAF1|PAF1]]|1.88|0.74|
|[[:human_genes:U:USP6|USP6]]|1.90|0.73|
|[[:human_genes:P:PUM1|PUM1]]|1.90|0.73|
|[[:human_genes:M:MGST1|MGST1]]|1.92|0.73|
|[[:human_genes:G:GOLGA1|GOLGA1]]|1.92|0.73|
|[[:human_genes:O:OMG|OMG]]|1.93|0.73|
|[[:human_genes:S:SEL1L|SEL1L]]|1.94|0.74|
|[[:human_genes:S:SART1|SART1]]|1.94|0.78|
|[[:human_genes:P:PTER|PTER]]|1.95|0.73|
|[[:human_genes:S:SIPA1L3|SIPA1L3]]|1.95|0.73|
|[[:human_genes:C:CKAP5|CKAP5]]|1.96|0.74|
|[[:human_genes:L:LACC1|LACC1]]|1.97|0.73|
|[[:human_genes:U:USP17L19|USP17L19]]|2.02|0.75|
|[[:human_genes:M:METTL24|METTL24]]|2.03|0.71|
|[[:human_genes:T:TMEM128|TMEM128]]|2.06|0.73|
|[[:human_genes:C:C18orf8|C18orf8]]|2.09|0.62|
|[[:human_genes:P:PSMD12|PSMD12]]|2.09|0.73|
|[[:human_genes:T:TUBA1B|TUBA1B]]|2.11|0.74|
|[[:human_genes:N:NBPF16|NBPF16]]|2.18|0.73|
|[[:human_genes:N:NLRC4|NLRC4]]|2.18|0.44|
|[[:human_genes:C:CCL8|CCL8]]|2.19|0.44|
|[[:human_genes:P:PSMC3|PSMC3]]|2.24|0.74|
|[[:human_genes:A:APOBEC3D|APOBEC3D]]|2.25|0.44|
|[[:human_genes:C:COPB2|COPB2]]|2.25|0.74|
|[[:human_genes:N:NYAP1|NYAP1]]|2.29|0.71|
|[[:human_genes:K:KDM6A|KDM6A]]|2.45|0.25|
|[[:human_genes:Z:ZC3H18|ZC3H18]]|2.47|0.44|
|[[:human_genes:R:RPSA|RPSA]]|2.61|0.73|
|[[:human_genes:M:MDN1|MDN1]]|2.65|0.71|
|[[:human_genes:N:NUDCD1|NUDCD1]]|3.05|0.02|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp311|2-Methoxyestradiol 0.55 to 0.75μM  on day4 R07 exp311]]|0.056|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="2-Methoxyestradiol 0.55 to 0.75μM  on day4 R07 exp311  vs  Tenofovir 10μM R07 exp405">
{{:chemogenomics:comparison_plots:exp311_vs_exp405.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>