Tubastatin-A 2.5μM R07 exp417 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Tubastatin-A 2.5μM R07 exp417 ======
==== Mechanism of Action ====
Inhibits HDAC6 selectively
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Tubastatin A%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1252003-15-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/49850262|49850262]]
    * **<color #00a2e8>IUPAC:</color>** %%N-hydroxy-4-[(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]benzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H21N3O2/c1-22-11-10-19-17(13-22)16-4-2-3-5-18(16)23(19)12-14-6-8-15(9-7-14)20(24)21-25/h2-9,25H,10-13H2,1H3,(H,21,24)
    * **<color #00a2e8>INCHI Key:</color>** GOVYBPLHWIEHEJ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 335.4
    * **<color #00a2e8>Canonical SMILES:</color>** CN1CCC2=C(C1)C3=CC=CC=C3N2CC4=CC=C(C=C4)C(=O)NO
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H21N3O2
{{:chemogenomics:structures:chem-0250.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Ark Pharm Inc.
    * **<color #00a2e8>Catalog #:</color>** AK474023
    * **<color #00a2e8>Lot #:</color>** WG0559127-180118001
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C20H21N3O2 336.17065; found 336.17258
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Tubistatin_A
    * **<color #00a2e8>Min:</color>** -5.8434; **<color #00a2e8>Max:</color>** 99.5541
{{:chemogenomics:dose_response:dr_454.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |1.4458    |
| IC30  |1.9030    |
| IC40  |2.4165    |
| IC50  |3.0321    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 2.5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.0
    * **<color #00a2e8>Numbers of reads</color>**: 21923022


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Tubastatin_A_2.5uM_Round-7_exp417.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Tubastatin-A 2.5μM R07 exp417'>
{{:chemogenomics:cranks_plots:exp417.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:USP14|USP14]]|-5.63|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-2.97|<0.01|
|[[:human_genes:P:PSMB8|PSMB8]]|-2.77|0.02|
|[[:human_genes:K:KCNS1|KCNS1]]|-2.59|0.06|
|[[:human_genes:B:BCL2|BCL2]]|-2.53|0.06|
|[[:human_genes:F:FBXW12|FBXW12]]|-2.47|0.07|
|[[:human_genes:W:WDR82|WDR82]]|-2.43|0.20|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|-2.37|0.64|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|-2.37|0.64|
|[[:human_genes:A:ATF7IP|ATF7IP]]|-2.36|0.11|
|[[:human_genes:K:KCTD5|KCTD5]]|-2.36|0.11|
|[[:human_genes:D:DSCR4|DSCR4]]|-2.32|0.12|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.31|0.64|
|[[:human_genes:M:MIER2|MIER2]]|-2.24|0.33|
|[[:human_genes:D:DYTN|DYTN]]|-2.24|0.22|
|[[:human_genes:O:OTUD5|OTUD5]]|-2.22|0.17|
|[[:human_genes:E:ENTPD6|ENTPD6]]|-2.21|0.17|
|[[:human_genes:R:RNMT|RNMT]]|-2.21|0.17|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-2.17|0.18|
|[[:human_genes:L:LZTS3|LZTS3]]|-2.17|0.18|
|[[:human_genes:W:WDR33|WDR33]]|-2.15|0.48|
|[[:human_genes:T:TXNL1|TXNL1]]|-2.13|0.20|
|[[:human_genes:M:MAP3K5|MAP3K5]]|-2.10|0.22|
|[[:human_genes:F:FDFT1|FDFT1]]|-2.09|0.22|
|[[:human_genes:C:CDK6|CDK6]]|-2.03|0.36|
|[[:human_genes:S:SNORD95|SNORD95]]|-2.03|0.36|
|[[:human_genes:A:ARL14EP|ARL14EP]]|-2.01|0.33|
|[[:human_genes:T:TMEM30A|TMEM30A]]|-2.00|0.33|
|[[:human_genes:M:MTA2|MTA2]]|-1.99|0.33|
|[[:human_genes:M:MAPK14|MAPK14]]|-1.98|0.33|
|[[:human_genes:L:LRRC30|LRRC30]]|1.97|0.48|
|[[:human_genes:P:PRR25|PRR25]]|1.97|0.48|
|[[:human_genes:N:NUDCD1|NUDCD1]]|1.99|0.37|
|[[:human_genes:U:UBE2G1|UBE2G1]]|1.99|0.37|
|[[:human_genes:I:ITK|ITK]]|2.00|0.37|
|[[:human_genes:T:TIMM17A|TIMM17A]]|2.01|0.47|
|[[:human_genes:X:XRCC6|XRCC6]]|2.02|0.47|
|[[:human_genes:N:NANS|NANS]]|2.02|0.37|
|[[:human_genes:P:PLEKHB1|PLEKHB1]]|2.04|0.37|
|[[:human_genes:I:ICT1|ICT1]]|2.05|0.37|
|[[:human_genes:M:MSLN|MSLN]]|2.06|0.37|
|[[:human_genes:M:MEIS3|MEIS3]]|2.06|0.41|
|[[:human_genes:G:GTPBP8|GTPBP8]]|2.06|0.37|
|[[:human_genes:N:NFU1|NFU1]]|2.07|0.49|
|[[:human_genes:D:DEFB116|DEFB116]]|2.08|0.37|
|[[:human_genes:O:OR8U8|OR8U8]]|2.09|0.59|
|[[:human_genes:U:USP27X|USP27X]]|2.09|0.73|
|[[:human_genes:V:VDAC1|VDAC1]]|2.10|0.37|
|[[:human_genes:B:BIRC6|BIRC6]]|2.12|0.37|
|[[:human_genes:M:MTERF|MTERF]]|2.13|0.37|
|[[:human_genes:K:KMT2E|KMT2E]]|2.13|0.37|
|[[:human_genes:I:IL4|IL4]]|2.14|0.37|
|[[:human_genes:M:MTRNR2L5|MTRNR2L5]]|2.18|0.37|
|[[:human_genes:P:PDSS1|PDSS1]]|2.18|0.37|
|[[:human_genes:R:RPL7A|RPL7A]]|2.19|0.60|
|[[:human_genes:I:ING5|ING5]]|2.19|0.37|
|[[:human_genes:F:F12|F12]]|2.28|0.37|
|[[:human_genes:G:GLRX5|GLRX5]]|2.36|0.37|
|[[:human_genes:A:ADAMTS18|ADAMTS18]]|2.37|0.37|
|[[:human_genes:C:COX5B|COX5B]]|2.43|0.37|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp342|Calcium Ionophore 0.4μM R07 exp342]]|0.054|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Calcium Ionophore 0.4μM R07 exp342  vs  Tubastatin-A 2.5μM R07 exp417">
{{:chemogenomics:comparison_plots:exp342_vs_exp417.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>