BI-2536 0.001μM R01 exp41 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== BI-2536 0.001μM R01 exp41 ======
==== Mechanism of Action ====
Inhibits PLK1 kinase, causes G2/M arrest
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Mitotic Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%BI-2536%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 755038-02-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/11364421|11364421]]
    * **<color #00a2e8>IUPAC:</color>** %%4-[[(7R)-8-cyclopentyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C28H39N7O3/c1-5-22-27(37)34(3)23-17-29-28(32-25(23)35(22)20-8-6-7-9-20)31-21-11-10-18(16-24(21)38-4)26(36)30-19-12-14-33(2)15-13-19/h10-11,16-17,19-20,22H,5-9,12-15H2,1-4H3,(H,30,36)(H,29,31,32)/t22-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** XQVVPGYIWAGRNI-JOCHJYFZSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 521.7
    * **<color #00a2e8>Canonical SMILES:</color>** CCC1C(=O)N(C2=CN=C(N=C2N1C3CCCC3)NC4=C(C=C(C=C4)C(=O)NC5CCN(CC5)C)OC)C
    * **<color #00a2e8>Isomeric SMILES:</color>** CC[C@@H]1C(=O)N(C2=CN=C(N=C2N1C3CCCC3)NC4=C(C=C(C=C4)C(=O)NC5CCN(CC5)C)OC)C
    * **<color #00a2e8>Molecular Formula:</color>** C28H39N7O3
{{:chemogenomics:structures:chem-0022.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-50698
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C28H39N7O3 522.31871; found 522.32029
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** BI2536
    * **<color #00a2e8>Min:</color>** -5.0598; **<color #00a2e8>Max:</color>** 98.9203
{{:chemogenomics:dose_response:dr_74.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.0014    |
| IC30  |0.0041    |
| IC40  |0.0097    |
| IC50  |0.0214    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 01
    * **<color #00a2e8>Dose</color>**: 1nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 12629261


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/BI-2536_0.001uM_Round-1_exp41.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='BI-2536 0.001μM R01 exp41'>
{{:chemogenomics:cranks_plots:exp41.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:UBA3|UBA3]]|-2.86|0.70|
|[[:human_genes:E:ERCC2|ERCC2]]|-2.63|0.56|
|[[:human_genes:G:GPN2|GPN2]]|-2.63|0.34|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-2.61|0.34|
|[[:human_genes:V:VEZT|VEZT]]|-2.53|0.34|
|[[:human_genes:R:RBX1|RBX1]]|-2.45|0.70|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.38|0.86|
|[[:human_genes:L:LOC403312|LOC403312]]|-2.32|0.70|
|[[:human_genes:N:NEUROG1|NEUROG1]]|-2.28|0.34|
|[[:human_genes:Y:YEATS2|YEATS2]]|-2.26|0.70|
|[[:human_genes:N:NSMCE1|NSMCE1]]|-2.23|0.70|
|[[:human_genes:L:L3MBTL4|L3MBTL4]]|-2.21|0.70|
|[[:human_genes:T:TMEM182|TMEM182]]|-2.21|0.70|
|[[:human_genes:S:STT3A|STT3A]]|-2.20|0.86|
|[[:human_genes:F:FARSB|FARSB]]|-2.20|0.75|
|[[:human_genes:C:CDR2|CDR2]]|-2.17|0.70|
|[[:human_genes:G:GPR113|GPR113]]|-2.16|0.70|
|[[:human_genes:O:OR6V1|OR6V1]]|-2.11|0.70|
|[[:human_genes:R:RSPH3|RSPH3]]|-2.10|0.70|
|[[:human_genes:G:GEMIN8|GEMIN8]]|-2.08|0.70|
|[[:human_genes:C:COL18A1|COL18A1]]|-2.06|0.70|
|[[:human_genes:S:SNF8|SNF8]]|-2.05|0.70|
|[[:human_genes:U:UBE2N|UBE2N]]|-2.05|0.75|
|[[:human_genes:C:COX5A|COX5A]]|-2.03|0.70|
|[[:human_genes:M:METTL16|METTL16]]|-2.03|0.89|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.03|0.75|
|[[:human_genes:C:CYTH1|CYTH1]]|-2.02|0.70|
|[[:human_genes:A:ABCF3|ABCF3]]|-1.99|0.75|
|[[:human_genes:C:C11orf74|C11orf74]]|-1.99|0.75|
|[[:human_genes:Z:ZNF683|ZNF683]]|-1.98|0.70|
|[[:human_genes:C:CMKLR1|CMKLR1]]|2.08|0.70|
|[[:human_genes:P:PSMA5|PSMA5]]|2.10|0.70|
|[[:human_genes:P:POLR2J2|POLR2J2]]|2.11|0.72|
|[[:human_genes:A:ANKRD35|ANKRD35]]|2.12|0.70|
|[[:human_genes:S:SREK1|SREK1]]|2.14|0.70|
|[[:human_genes:P:POLR1B|POLR1B]]|2.15|0.81|
|[[:human_genes:M:MKI67IP|MKI67IP]]|2.15|0.70|
|[[:human_genes:P:PMPCA|PMPCA]]|2.16|0.72|
|[[:human_genes:Z:ZNF276|ZNF276]]|2.17|0.70|
|[[:human_genes:H:HSPA5|HSPA5]]|2.18|0.72|
|[[:human_genes:A:ARID1A|ARID1A]]|2.21|0.70|
|[[:human_genes:R:RAB4A|RAB4A]]|2.21|0.70|
|[[:human_genes:A:AVEN|AVEN]]|2.23|0.70|
|[[:human_genes:I:ITFG2|ITFG2]]|2.23|0.70|
|[[:human_genes:R:RPL32|RPL32]]|2.24|0.72|
|[[:human_genes:P:PSMA6|PSMA6]]|2.26|0.70|
|[[:human_genes:O:OXER1|OXER1]]|2.27|0.70|
|[[:human_genes:C:C7orf73|C7orf73]]|2.27|0.70|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|2.27|0.70|
|[[:human_genes:R:RPL7A|RPL7A]]|2.28|0.70|
|[[:human_genes:S:SNRNP200|SNRNP200]]|2.31|0.70|
|[[:human_genes:R:RPS17L|RPS17L]]|2.31|0.70|
|[[:human_genes:E:EMCN|EMCN]]|2.34|0.70|
|[[:human_genes:A:ACO2|ACO2]]|2.37|0.70|
|[[:human_genes:T:TICRR|TICRR]]|2.38|0.70|
|[[:human_genes:R:RUSC1|RUSC1]]|2.39|0.70|
|[[:human_genes:Y:YTHDF1|YTHDF1]]|2.42|0.70|
|[[:human_genes:Z:ZNF266|ZNF266]]|2.48|0.70|
|[[:human_genes:M:MYL10|MYL10]]|2.66|0.70|
|[[:human_genes:N:NUP155|NUP155]]|2.98|0.58|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp58|UM131593 0.1μM R01 exp58]]|0.081|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp49|NFN1 0.1μM R01 exp49]]|0.07|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp61|YM155 0.0002μM R01 exp61]]|0.066|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp47|Lapatinib 5μM R01 exp47]]|0.056|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp54|Taxol 0.002μM R01 exp54]]|0.056|<button type="primary" size="small" modal="5">View</button>|
</modal>


<modal id="1" size="lg" title="BI-2536 0.001μM R01 exp41  vs  UM131593 0.1μM R01 exp58">
{{:chemogenomics:comparison_plots:exp41_vs_exp58.png?nolink |}}
</modal>

<modal id="2" size="lg" title="BI-2536 0.001μM R01 exp41  vs  NFN1 0.1μM R01 exp49">
{{:chemogenomics:comparison_plots:exp41_vs_exp49.png?nolink |}}
</modal>

<modal id="3" size="lg" title="BI-2536 0.001μM R01 exp41  vs  YM155 0.0002μM R01 exp61">
{{:chemogenomics:comparison_plots:exp41_vs_exp61.png?nolink |}}
</modal>

<modal id="4" size="lg" title="BI-2536 0.001μM R01 exp41  vs  Lapatinib 5μM R01 exp47">
{{:chemogenomics:comparison_plots:exp41_vs_exp47.png?nolink |}}
</modal>

<modal id="5" size="lg" title="BI-2536 0.001μM R01 exp41  vs  Taxol 0.002μM R01 exp54">
{{:chemogenomics:comparison_plots:exp41_vs_exp54.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>