Beta-Estradiol 0.55μM R07 exp425 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Beta-Estradiol 0.55μM R07 exp425 ======
==== Mechanism of Action ====
Agonist for estrogen receptor (ER), inactive control for 2-Methoxyestradiol
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Transcription Activator
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Hormone Agonist



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Estradiol%%
    * **<color #00a2e8>Synonyms:</color>** β-Estradiol; E2; 17β-Estradiol; 17β-Oestradiol
    * **<color #00a2e8>CAS #:</color>** 50-28-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5757|5757]]
    * **<color #00a2e8>IUPAC:</color>** %%(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** VOXZDWNPVJITMN-ZBRFXRBCSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 272.4
    * **<color #00a2e8>Canonical SMILES:</color>** CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O
    * **<color #00a2e8>Molecular Formula:</color>** C18H24O2
{{:chemogenomics:structures:chem-0255.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** E-2758
    * **<color #00a2e8>Lot #:</color>** 025K1075
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>LCMS:</color>** Tr 1.23 min, m/z 255+ [M+H-H2O]+
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** 12-beta-estradiol
    * **<color #00a2e8>Min:</color>** -11.4539; **<color #00a2e8>Max:</color>** 9.0892
{{:chemogenomics:dose_response:dr_487.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 550nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 25360615


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Beta-Estradiol_0.55uM_Round-7_exp425.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Beta-Estradiol 0.55μM R07 exp425'>
{{:chemogenomics:cranks_plots:exp425.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GTF3C6|GTF3C6]]|-2.51|0.45|
|[[:human_genes:A:ASB3|ASB3]]|-2.50|0.45|
|[[:human_genes:W:WRB|WRB]]|-2.28|0.72|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.12|0.72|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.07|0.83|
|[[:human_genes:L:LOC643802|LOC643802]]|-2.07|0.72|
|[[:human_genes:T:TRMT10A|TRMT10A]]|-2.06|0.72|
|[[:human_genes:M:MMP1|MMP1]]|-2.02|0.72|
|[[:human_genes:E:ELF2|ELF2]]|-2.00|0.72|
|[[:human_genes:R:RIN2|RIN2]]|-2.00|0.72|
|[[:human_genes:M:MST1L|MST1L]]|-1.99|0.72|
|[[:human_genes:N:NTSR2|NTSR2]]|-1.99|0.72|
|[[:human_genes:T:TMED10|TMED10]]|-1.97|0.72|
|[[:human_genes:K:KRTAP10-4|KRTAP10-4]]|-1.97|0.83|
|[[:human_genes:L:LRRC23|LRRC23]]|-1.95|0.81|
|[[:human_genes:T:TP53BP1|TP53BP1]]|-1.94|0.72|
|[[:human_genes:P:PARL|PARL]]|-1.92|0.72|
|[[:human_genes:F:FBXO11|FBXO11]]|-1.91|0.72|
|[[:human_genes:C:CALM2|CALM2]]|-1.90|0.76|
|[[:human_genes:B:BBS9|BBS9]]|-1.89|0.72|
|[[:human_genes:E:EXOC3|EXOC3]]|-1.89|0.72|
|[[:human_genes:K:KRTAP16-1|KRTAP16-1]]|-1.89|0.72|
|[[:human_genes:I:ILKAP|ILKAP]]|-1.88|0.81|
|[[:human_genes:S:SPC24|SPC24]]|-1.88|0.88|
|[[:human_genes:C:CYP4X1|CYP4X1]]|-1.87|0.72|
|[[:human_genes:T:TXNDC11|TXNDC11]]|-1.85|0.81|
|[[:human_genes:N:NKX6-3|NKX6-3]]|-1.85|0.72|
|[[:human_genes:R:RGN|RGN]]|-1.84|0.72|
|[[:human_genes:T:THG1L|THG1L]]|-1.84|0.72|
|[[:human_genes:T:TAF5L|TAF5L]]|-1.84|0.81|
|[[:human_genes:G:GATSL1|GATSL1]]|1.95|0.53|
|[[:human_genes:S:SF3B1|SF3B1]]|1.96|0.52|
|[[:human_genes:F:FGGY|FGGY]]|1.97|0.52|
|[[:human_genes:D:DIEXF|DIEXF]]|1.97|0.61|
|[[:human_genes:A:ARID5A|ARID5A]]|1.97|0.52|
|[[:human_genes:C:CCDC41|CCDC41]]|1.98|0.53|
|[[:human_genes:R:RGS19|RGS19]]|2.01|0.49|
|[[:human_genes:C:CDC25C|CDC25C]]|2.01|0.49|
|[[:human_genes:A:ACCSL|ACCSL]]|2.01|0.52|
|[[:human_genes:A:AASDH|AASDH]]|2.02|0.49|
|[[:human_genes:C:CCKAR|CCKAR]]|2.04|0.49|
|[[:human_genes:S:SEC13|SEC13]]|2.05|0.68|
|[[:human_genes:C:CIC|CIC]]|2.06|0.49|
|[[:human_genes:S:SLC22A6|SLC22A6]]|2.07|0.49|
|[[:human_genes:R:RPS16|RPS16]]|2.07|0.53|
|[[:human_genes:U:UTP20|UTP20]]|2.11|0.53|
|[[:human_genes:P:PCDHB12|PCDHB12]]|2.12|0.49|
|[[:human_genes:E:EIF4EBP3|EIF4EBP3]]|2.12|0.49|
|[[:human_genes:P:POLR2F|POLR2F]]|2.13|0.58|
|[[:human_genes:K:KDM6A|KDM6A]]|2.13|0.49|
|[[:human_genes:K:KIAA2022|KIAA2022]]|2.14|0.49|
|[[:human_genes:C:CPB2|CPB2]]|2.19|0.49|
|[[:human_genes:T:TAB3|TAB3]]|2.24|0.49|
|[[:human_genes:P:POLE|POLE]]|2.32|0.52|
|[[:human_genes:P:PLK4|PLK4]]|2.39|0.53|
|[[:human_genes:T:TRIM52|TRIM52]]|2.40|0.53|
|[[:human_genes:U:USP17L17|USP17L17]]|2.42|0.80|
|[[:human_genes:D:DHX38|DHX38]]|2.45|0.49|
|[[:human_genes:Z:ZNF41|ZNF41]]|2.52|0.34|
|[[:human_genes:M:MGAT4D|MGAT4D]]|2.60|0.73|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>