Arsenic trioxide 60μM R08 exp449 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Arsenic trioxide 60μM R08 exp449 ======
==== Mechanism of Action ====
Induces degradation of aberrant PML-RAR‘± fusion protein in acute promyelocytic leukemia
  * **<color #00a2e8>Class / Subclass 1:</color>** Environmental Stresses / Heavy Metal
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Apoptosis Inducer



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%2,4,6,8,9,10-Hexaoxa-1,3,5,7-tetraarsatricyclo[3.3.1.13,7]decane%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1327-53-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/518605|518605]]
    * **<color #00a2e8>IUPAC:</color>** %%2,4,6,8,9,10-hexaoxa-1,3,5,7-tetrarsatricyclo[3.3.1.13,7]decane%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/As4O6/c5-1-6-3-8-2(5)9-4(7-1)10-3
    * **<color #00a2e8>INCHI Key:</color>** KTTMEOWBIWLMSE-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 395.68
    * **<color #00a2e8>Canonical SMILES:</color>** O1[As]2O[As]3O[As]1O[As](O2)O3
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** As4O6
{{:chemogenomics:structures:chem-0260.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** A774130
    * **<color #00a2e8>Lot #:</color>** 14-CGS-186-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>XRPD:</color>** Expected As2O3; found As2O3
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Arsenic_Oxide
    * **<color #00a2e8>Min:</color>** 14.1313; **<color #00a2e8>Max:</color>** 99.7631
{{:chemogenomics:dose_response:dr_599.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |30.7900    |
| IC20  |46.5800    |
| IC30  |61.3300    |
| IC40  |76.8500    |
| IC50  |94.5200    |
| IC60  |116.3000    |
| IC70  |145.7000    |
| IC80  |191.8000    |
| IC90  |290.2000    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 60µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.5
    * **<color #00a2e8>Numbers of reads</color>**: 16171461


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/8|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Arsenic_trioxide_60uM_Round-8_exp449.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Arsenic trioxide 60μM R08 exp449'>
{{:chemogenomics:cranks_plots:exp449.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GCLM|GCLM]]|-3.74|<0.01|
|[[:human_genes:A:ABCC1|ABCC1]]|-3.29|<0.01|
|[[:human_genes:B:BAZ1A|BAZ1A]]|-2.56|0.06|
|[[:human_genes:D:DDI2|DDI2]]|-2.55|0.06|
|[[:human_genes:G:GTF3C1|GTF3C1]]|-2.55|0.23|
|[[:human_genes:R:RAPH1|RAPH1]]|-2.54|0.06|
|[[:human_genes:K:KPNB1|KPNB1]]|-2.49|0.38|
|[[:human_genes:G:GSS|GSS]]|-2.39|0.12|
|[[:human_genes:V:VPS51|VPS51]]|-2.35|0.23|
|[[:human_genes:C:CENPT|CENPT]]|-2.32|0.26|
|[[:human_genes:N:NGLY1|NGLY1]]|-2.31|0.15|
|[[:human_genes:K:KIF18A|KIF18A]]|-2.31|0.15|
|[[:human_genes:V:VBP1|VBP1]]|-2.28|0.16|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.26|0.22|
|[[:human_genes:M:MAN2A1|MAN2A1]]|-2.23|0.19|
|[[:human_genes:E:EP400|EP400]]|-2.21|0.33|
|[[:human_genes:C:C8orf47|C8orf47]]|-2.21|0.19|
|[[:human_genes:B:BRPF1|BRPF1]]|-2.20|0.19|
|[[:human_genes:F:FAM69A|FAM69A]]|-2.18|0.19|
|[[:human_genes:T:TMEM80|TMEM80]]|-2.16|0.20|
|[[:human_genes:Z:ZNF793|ZNF793]]|-2.12|0.22|
|[[:human_genes:T:TSSC1|TSSC1]]|-2.10|0.23|
|[[:human_genes:K:KALRN|KALRN]]|-2.07|0.33|
|[[:human_genes:N:NPTN|NPTN]]|-2.07|0.23|
|[[:human_genes:W:WNT3A|WNT3A]]|-2.07|0.33|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.07|0.57|
|[[:human_genes:C:CYLD|CYLD]]|-2.01|0.30|
|[[:human_genes:G:GCLC|GCLC]]|-2.00|0.31|
|[[:human_genes:A:AAED1|AAED1]]|-1.99|0.38|
|[[:human_genes:P:PLEKHJ1|PLEKHJ1]]|-1.95|0.33|
|[[:human_genes:C:CD72|CD72]]|2.05|0.24|
|[[:human_genes:P:PMVK|PMVK]]|2.06|0.29|
|[[:human_genes:C:CDC20|CDC20]]|2.07|0.44|
|[[:human_genes:A:ANP32A|ANP32A]]|2.08|0.27|
|[[:human_genes:A:ALG1L|ALG1L]]|2.09|0.21|
|[[:human_genes:C:C8orf59|C8orf59]]|2.10|0.47|
|[[:human_genes:P:PAX2|PAX2]]|2.11|0.21|
|[[:human_genes:F:FOXD4L1|FOXD4L1]]|2.12|0.27|
|[[:human_genes:C:CBLL1|CBLL1]]|2.13|0.27|
|[[:human_genes:R:RPS3|RPS3]]|2.14|0.30|
|[[:human_genes:U:UBA6|UBA6]]|2.14|0.20|
|[[:human_genes:U:UTY|UTY]]|2.18|0.17|
|[[:human_genes:C:CXorf56|CXorf56]]|2.21|0.21|
|[[:human_genes:N:NAA15|NAA15]]|2.21|0.21|
|[[:human_genes:N:NANS|NANS]]|2.25|0.17|
|[[:human_genes:E:EIF4A1|EIF4A1]]|2.26|0.20|
|[[:human_genes:S:SLC25A1|SLC25A1]]|2.33|0.12|
|[[:human_genes:T:TMEM126B|TMEM126B]]|2.37|0.17|
|[[:human_genes:S:SLC19A1|SLC19A1]]|2.49|0.17|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|2.50|0.17|
|[[:human_genes:R:RPL35A|RPL35A]]|2.52|0.53|
|[[:human_genes:A:AK3|AK3]]|2.66|0.02|
|[[:human_genes:C:CNBP|CNBP]]|2.69|0.02|
|[[:human_genes:Y:YLPM1|YLPM1]]|2.71|0.17|
|[[:human_genes:U:UTP14A|UTP14A]]|2.74|0.04|
|[[:human_genes:H:HSPA14|HSPA14]]|3.25|<0.01|
|[[:human_genes:K:KMT2D|KMT2D]]|3.25|<0.01|
|[[:human_genes:F:FAM122A|FAM122A]]|3.42|<0.01|
|[[:human_genes:K:KEAP1|KEAP1]]|4.24|<0.01|
|[[:human_genes:R:RRM2|RRM2]]|4.31|0.04|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp529|Thimerosal 0.85μM R08 exp529]]|0.052|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp30|Rapamycin 10μM R00 exp30]]|0.051|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp307|Rapamycin 2μM plus Cyclosporin-A 3μM R07 exp307]]|0.051|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="Arsenic trioxide 60μM R08 exp449  vs  Thimerosal 0.85μM R08 exp529">
{{:chemogenomics:comparison_plots:exp449_vs_exp529.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Arsenic trioxide 60μM R08 exp449  vs  Rapamycin 10μM R00 exp30">
{{:chemogenomics:comparison_plots:exp30_vs_exp449.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Arsenic trioxide 60μM R08 exp449  vs  Rapamycin 2μM plus Cyclosporin-A 3μM R07 exp307">
{{:chemogenomics:comparison_plots:exp307_vs_exp449.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|nonribosomal peptide biosynthetic process|136.56|GCLM,GSS,GCLC|
|acid-amino acid ligase activity|91.04|GCLM,GSS,GCLC|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>