Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471 ======
==== Mechanism of Action ====
Major membrane lipid, precursor for the biosynthesis of steroid hormones, bile acids, and vitamin D
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Cholesterol%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 57-88-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5997|5997]]
    * **<color #00a2e8>IUPAC:</color>** %%(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** HVYWMOMLDIMFJA-DPAQBDIFSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 386.7
    * **<color #00a2e8>Canonical SMILES:</color>** CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
    * **<color #00a2e8>Molecular Formula:</color>** C27H46O
{{:chemogenomics:structures:chem-0280.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Combi-Blocks
    * **<color #00a2e8>Catalog #:</color>** QE-3931
    * **<color #00a2e8>Lot #:</color>** B15201
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HPLC-ELS:</color>** Tr 2.69 min.
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Cholesterol
    * **<color #00a2e8>Min:</color>** 11.1840; **<color #00a2e8>Max:</color>** 96.6964
{{:chemogenomics:dose_response:dr_517.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.0001    |
| IC30  |0.0002    |
| IC40  |0.0004    |
| IC50  |0.0007    |
| IC60  |0.0011    |
| IC70  |0.0018    |
| IC80  |0.0036    |
| IC90  |0.0096    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 3-100nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 15819582


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Cholesterol_0.003-0.006day2-0.1day6uM_Round-8_exp471.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471'>
{{:chemogenomics:cranks_plots:exp471.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:T:TRIM44|TRIM44]]|-2.37|0.74|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.32|0.82|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.19|0.74|
|[[:human_genes:A:ASB3|ASB3]]|-2.17|0.74|
|[[:human_genes:Z:ZMYM2|ZMYM2]]|-2.16|0.74|
|[[:human_genes:A:ATP2A2|ATP2A2]]|-2.11|0.93|
|[[:human_genes:M:MVK|MVK]]|-2.06|0.75|
|[[:human_genes:D:DDX20|DDX20]]|-2.06|0.74|
|[[:human_genes:M:MBTPS1|MBTPS1]]|-2.04|0.75|
|[[:human_genes:S:SLC24A1|SLC24A1]]|-2.02|0.74|
|[[:human_genes:A:ARHGEF10|ARHGEF10]]|-2.02|0.74|
|[[:human_genes:C:C8orf22|C8orf22]]|-2.02|0.74|
|[[:human_genes:T:TRMT61A|TRMT61A]]|-2.01|0.75|
|[[:human_genes:P:PIK3R4|PIK3R4]]|-2.01|0.74|
|[[:human_genes:T:TMEM194B|TMEM194B]]|-1.99|0.74|
|[[:human_genes:W:WFDC12|WFDC12]]|-1.99|0.74|
|[[:human_genes:O:ODC1|ODC1]]|-1.98|0.74|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-1.96|0.74|
|[[:human_genes:K:KIAA1429|KIAA1429]]|-1.94|0.82|
|[[:human_genes:S:SERPINB13|SERPINB13]]|-1.93|0.74|
|[[:human_genes:R:RNF225|RNF225]]|-1.93|0.74|
|[[:human_genes:N:NAA20|NAA20]]|-1.90|0.74|
|[[:human_genes:C:COG2|COG2]]|-1.86|0.82|
|[[:human_genes:T:TIGD7|TIGD7]]|-1.86|0.75|
|[[:human_genes:B:BUB3|BUB3]]|-1.84|0.84|
|[[:human_genes:C:C10orf120|C10orf120]]|-1.83|0.75|
|[[:human_genes:H:HIF1AN|HIF1AN]]|-1.83|0.75|
|[[:human_genes:T:TTC4|TTC4]]|-1.83|0.75|
|[[:human_genes:T:TRIP12|TRIP12]]|-1.82|0.75|
|[[:human_genes:C:CD300LG|CD300LG]]|-1.81|0.75|
|[[:human_genes:N:NEK8|NEK8]]|1.81|0.81|
|[[:human_genes:N:NOP2|NOP2]]|1.81|0.83|
|[[:human_genes:D:DUSP16|DUSP16]]|1.83|0.81|
|[[:human_genes:D:DDX3Y|DDX3Y]]|1.87|0.81|
|[[:human_genes:C:C19orf53|C19orf53]]|1.88|0.81|
|[[:human_genes:C:CT45A3|CT45A3]]|1.89|0.77|
|[[:human_genes:R:RPF1|RPF1]]|1.89|0.77|
|[[:human_genes:M:MS4A4A|MS4A4A]]|1.90|0.77|
|[[:human_genes:N:NPIPA5|NPIPA5]]|1.92|0.83|
|[[:human_genes:D:DAPP1|DAPP1]]|1.96|0.77|
|[[:human_genes:P:PSMB4|PSMB4]]|1.97|0.81|
|[[:human_genes:C:CARD17|CARD17]]|1.98|0.77|
|[[:human_genes:A:ARNTL2|ARNTL2]]|2.01|0.77|
|[[:human_genes:T:TIMM50|TIMM50]]|2.04|0.81|
|[[:human_genes:M:MUL1|MUL1]]|2.05|0.77|
|[[:human_genes:T:TIGD1|TIGD1]]|2.06|0.77|
|[[:human_genes:G:GAGE2A|GAGE2A]]|2.07|0.83|
|[[:human_genes:A:ABHD5|ABHD5]]|2.13|0.77|
|[[:human_genes:V:VCX3A|VCX3A]]|2.14|0.65|
|[[:human_genes:T:TXNRD3|TXNRD3]]|2.14|0.65|
|[[:human_genes:R:RPSA|RPSA]]|2.16|0.83|
|[[:human_genes:R:RIN1|RIN1]]|2.17|0.65|
|[[:human_genes:T:TBC1D8B|TBC1D8B]]|2.18|0.76|
|[[:human_genes:O:OR1L4|OR1L4]]|2.19|0.65|
|[[:human_genes:P:PRR5|PRR5]]|2.23|0.68|
|[[:human_genes:M:MS4A13|MS4A13]]|2.25|0.83|
|[[:human_genes:S:SF3B3|SF3B3]]|2.27|0.81|
|[[:human_genes:H:HTR1B|HTR1B]]|2.31|0.77|
|[[:human_genes:S:STARD3|STARD3]]|2.44|0.65|
|[[:human_genes:E:EIF2S1|EIF2S1]]|2.85|0.81|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp185|L-BMAA 500 to 750μM on day4 R04 exp185]]|0.065|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471  vs  L-BMAA 500 to 750μM on day4 R04 exp185">
{{:chemogenomics:comparison_plots:exp185_vs_exp471.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>