Dihydrosphingosine 8μM R08 exp476 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Dihydrosphingosine 8μM R08 exp476 ======
==== Mechanism of Action ====
Inhibits cytosolic phospholipase A2α (cPLA2α) activity
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Sphinganine%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 764-22-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/91486|91486]]
    * **<color #00a2e8>IUPAC:</color>** %%(2S,3R)-2-aminooctadecane-1,3-diol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/t17-,18+/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** OTKJDMGTUTTYMP-ZWKOTPCHSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 301.5
    * **<color #00a2e8>Canonical SMILES:</color>** CCCCCCCCCCCCCCCC(C(CO)N)O
    * **<color #00a2e8>Isomeric SMILES:</color>** CCCCCCCCCCCCCCC[C@H]([C@H](CO)N)O
    * **<color #00a2e8>Molecular Formula:</color>** C18H39NO2
{{:chemogenomics:structures:chem-0285.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** D449400
    * **<color #00a2e8>Lot #:</color>** 2-UTS-154-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C18H39NO2 302.30536; found 302.30628
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Dihydrosphingosine
    * **<color #00a2e8>Min:</color>** -10.6873; **<color #00a2e8>Max:</color>** 99.7582
{{:chemogenomics:dose_response:dr_610.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |8.3490    |
| IC20  |9.1120    |
| IC30  |9.6580    |
| IC40  |10.1300    |
| IC50  |10.5800    |
| IC60  |11.0600    |
| IC70  |11.5900    |
| IC80  |12.2900    |
| IC90  |13.4100    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 8µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 18647851


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Dihydrosphingosine_8uM_Round-8_exp476.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Dihydrosphingosine 8μM R08 exp476'>
{{:chemogenomics:cranks_plots:exp476.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SGPL1|SGPL1]]|-5.02|<0.01|
|[[:human_genes:P:PDXK|PDXK]]|-4.45|<0.01|
|[[:human_genes:C:CCDC101|CCDC101]]|-2.64|0.05|
|[[:human_genes:N:NAA10|NAA10]]|-2.51|0.28|
|[[:human_genes:R:RAB11A|RAB11A]]|-2.38|0.28|
|[[:human_genes:P:PACS1|PACS1]]|-2.29|0.42|
|[[:human_genes:R:R3HCC1|R3HCC1]]|-2.27|0.42|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.24|0.41|
|[[:human_genes:C:CCDC67|CCDC67]]|-2.22|0.28|
|[[:human_genes:N:NPTN|NPTN]]|-2.22|0.28|
|[[:human_genes:S:SNF8|SNF8]]|-2.18|0.42|
|[[:human_genes:A:ARL1|ARL1]]|-2.14|0.38|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.13|0.83|
|[[:human_genes:P:PPP1CA|PPP1CA]]|-2.09|0.41|
|[[:human_genes:A:AVIL|AVIL]]|-2.08|0.44|
|[[:human_genes:S:SNRPD3|SNRPD3]]|-2.08|0.86|
|[[:human_genes:K:KCTD2|KCTD2]]|-2.06|0.42|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.04|0.61|
|[[:human_genes:F:FAM207A|FAM207A]]|-2.02|0.42|
|[[:human_genes:K:KIF2A|KIF2A]]|-2.01|0.42|
|[[:human_genes:C:C7orf65|C7orf65]]|-1.99|0.43|
|[[:human_genes:S:SARS|SARS]]|-1.98|0.87|
|[[:human_genes:D:DOPEY1|DOPEY1]]|-1.98|0.43|
|[[:human_genes:A:ABCA13|ABCA13]]|-1.95|0.56|
|[[:human_genes:R:RTCB|RTCB]]|-1.94|0.75|
|[[:human_genes:A:ACSL4|ACSL4]]|-1.94|0.56|
|[[:human_genes:E:ENO1|ENO1]]|-1.93|0.75|
|[[:human_genes:K:KLHL32|KLHL32]]|-1.93|0.50|
|[[:human_genes:D:DHX36|DHX36]]|-1.91|0.61|
|[[:human_genes:F:FOXF2|FOXF2]]|-1.90|0.62|
|[[:human_genes:T:TKTL1|TKTL1]]|1.97|0.54|
|[[:human_genes:P:PABPC4|PABPC4]]|1.98|0.54|
|[[:human_genes:R:RPS19|RPS19]]|1.98|0.76|
|[[:human_genes:N:NUDT11|NUDT11]]|2.00|0.54|
|[[:human_genes:N:NUP88|NUP88]]|2.01|0.55|
|[[:human_genes:N:NLRP2|NLRP2]]|2.02|0.59|
|[[:human_genes:Z:ZC3H3|ZC3H3]]|2.03|0.54|
|[[:human_genes:S:SP8|SP8]]|2.04|0.54|
|[[:human_genes:C:C11orf63|C11orf63]]|2.06|0.43|
|[[:human_genes:K:KIAA0947|KIAA0947]]|2.06|0.54|
|[[:human_genes:S:S100A2|S100A2]]|2.07|0.43|
|[[:human_genes:Y:YIPF4|YIPF4]]|2.11|0.43|
|[[:human_genes:Z:ZBED2|ZBED2]]|2.13|0.67|
|[[:human_genes:A:ANKRD40|ANKRD40]]|2.13|0.57|
|[[:human_genes:F:FZD6|FZD6]]|2.15|0.39|
|[[:human_genes:O:OR4D11|OR4D11]]|2.16|0.39|
|[[:human_genes:D:DDX46|DDX46]]|2.17|0.77|
|[[:human_genes:P:POLE2|POLE2]]|2.17|0.67|
|[[:human_genes:U:UTP11L|UTP11L]]|2.20|0.39|
|[[:human_genes:D:DYNC1H1|DYNC1H1]]|2.21|0.75|
|[[:human_genes:E:EIF6|EIF6]]|2.23|0.66|
|[[:human_genes:W:WDR66|WDR66]]|2.26|0.59|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.29|0.39|
|[[:human_genes:C:CDC45|CDC45]]|2.34|0.59|
|[[:human_genes:R:RNPC3|RNPC3]]|2.35|0.39|
|[[:human_genes:P:PSMC4|PSMC4]]|2.45|0.39|
|[[:human_genes:P:PNO1|PNO1]]|2.76|0.43|
|[[:human_genes:F:FIP1L1|FIP1L1]]|2.78|0.11|
|[[:human_genes:P:PCDHB11|PCDHB11]]|2.89|0.04|
|[[:human_genes:R:RPA1|RPA1]]|3.17|0.54|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp139|Nicotinamide Riboside 100μM R03 exp139]]|0.057|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Dihydrosphingosine 8μM R08 exp476  vs  Nicotinamide Riboside 100μM R03 exp139">
{{:chemogenomics:comparison_plots:exp139_vs_exp476.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|RNA processing|6.65|FIP1L1,RNPC3,EXOSC3,EIF6,UTP11,DDX46,ZC3H3,RPS19,PABPC4,DDX41|
</modal>