GSK-J5 1.5μM R08 exp484 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== GSK-J5 1.5μM R08 exp484 ======
==== Mechanism of Action ====
Inactive isomer of GSKJ4
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Ethyl 3-[[2-pyridin-3-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoate;hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1797983-32-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/126456082|126456082]]
    * **<color #00a2e8>IUPAC:</color>** %%ethyl 3-[[2-pyridin-3-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoate;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C24H27N5O2.ClH/c1-2-31-23(30)9-13-26-21-16-22(28-24(27-21)20-8-5-12-25-17-20)29-14-10-18-6-3-4-7-19(18)11-15-29;/h3-8,12,16-17H,2,9-11,13-15H2,1H3,(H,26,27,28);1H
    * **<color #00a2e8>INCHI Key:</color>** QQHQMHJAOKADED-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 454
    * **<color #00a2e8>Canonical SMILES:</color>** CCOC(=O)CCNC1=CC(=NC(=N1)C2=CN=CC=C2)N3CCC4=CC=CC=C4CC3.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** GAVFNLTSAD HLYVNVSELS LVNFEESQTF FGLYKL
{{:chemogenomics:structures:chem-0293.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Structural Genomics Consortium
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+Na)+ Calcd for C24H27N5O2 440.2057; found 440.20665
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** GSKJ5
    * **<color #00a2e8>Min:</color>** -21.2198; **<color #00a2e8>Max:</color>** 8.1455
{{:chemogenomics:dose_response:dr_540.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 1.5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 17373854


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/GSK-J5_1.5uM_Round-8_exp484.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='GSK-J5 1.5μM R08 exp484'>
{{:chemogenomics:cranks_plots:exp484.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.71|0.10|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.67|0.17|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.55|0.17|
|[[:human_genes:W:WDR59|WDR59]]|-2.44|0.17|
|[[:human_genes:S:STAT3|STAT3]]|-2.42|0.17|
|[[:human_genes:S:SNAPC5|SNAPC5]]|-2.17|0.58|
|[[:human_genes:L:LDHA|LDHA]]|-2.17|0.43|
|[[:human_genes:L:LRRC16A|LRRC16A]]|-2.16|0.73|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.10|0.83|
|[[:human_genes:K:KDSR|KDSR]]|-2.10|0.52|
|[[:human_genes:L:LIFR|LIFR]]|-2.09|0.52|
|[[:human_genes:Z:ZCCHC8|ZCCHC8]]|-2.08|0.60|
|[[:human_genes:R:RAPGEF2|RAPGEF2]]|-2.03|0.58|
|[[:human_genes:A:ATIC|ATIC]]|-1.98|0.60|
|[[:human_genes:P:PCYT2|PCYT2]]|-1.97|0.60|
|[[:human_genes:D:DLG5|DLG5]]|-1.97|0.60|
|[[:human_genes:S:SPATA9|SPATA9]]|-1.95|0.77|
|[[:human_genes:U:UBA3|UBA3]]|-1.95|0.83|
|[[:human_genes:P:PDIA4|PDIA4]]|-1.89|0.73|
|[[:human_genes:P:PEX3|PEX3]]|-1.88|0.73|
|[[:human_genes:T:TMEM189-UBE2V1|TMEM189-UBE2V1]]|-1.87|0.73|
|[[:human_genes:C:CHAF1B|CHAF1B]]|-1.87|0.73|
|[[:human_genes:M:MYO1A|MYO1A]]|-1.85|0.77|
|[[:human_genes:T:TMEM8A|TMEM8A]]|-1.83|0.83|
|[[:human_genes:P:PTCHD3|PTCHD3]]|-1.81|0.83|
|[[:human_genes:D:DERL1|DERL1]]|-1.81|0.83|
|[[:human_genes:A:ACSL4|ACSL4]]|-1.81|0.83|
|[[:human_genes:V:VN1R4|VN1R4]]|-1.80|0.83|
|[[:human_genes:A:ATP5SL|ATP5SL]]|-1.79|0.83|
|[[:human_genes:H:HCFC1|HCFC1]]|-1.78|0.83|
|[[:human_genes:R:RUFY4|RUFY4]]|1.87|0.70|
|[[:human_genes:D:DUSP5|DUSP5]]|1.88|0.69|
|[[:human_genes:C:C1QTNF9B|C1QTNF9B]]|1.88|0.69|
|[[:human_genes:S:SAMD4B|SAMD4B]]|1.89|0.70|
|[[:human_genes:A:ANKRD11|ANKRD11]]|1.90|0.69|
|[[:human_genes:R:RAPSN|RAPSN]]|1.92|0.70|
|[[:human_genes:T:TIE1|TIE1]]|1.93|0.70|
|[[:human_genes:W:WDR74|WDR74]]|1.96|0.70|
|[[:human_genes:D:DCTN1|DCTN1]]|1.98|0.61|
|[[:human_genes:C:CYP4B1|CYP4B1]]|1.98|0.61|
|[[:human_genes:T:TXNDC11|TXNDC11]]|1.99|0.70|
|[[:human_genes:G:GPRIN2|GPRIN2]]|2.00|0.61|
|[[:human_genes:A:ANKRD13C|ANKRD13C]]|2.00|0.70|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.00|0.61|
|[[:human_genes:P:PLXNB3|PLXNB3]]|2.00|0.69|
|[[:human_genes:S:SMC2|SMC2]]|2.01|0.70|
|[[:human_genes:S:SLC3A2|SLC3A2]]|2.02|0.69|
|[[:human_genes:C:CPQ|CPQ]]|2.03|0.61|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.03|0.69|
|[[:human_genes:G:GFI1|GFI1]]|2.05|0.61|
|[[:human_genes:N:NEUROD1|NEUROD1]]|2.06|0.61|
|[[:human_genes:C:COPB1|COPB1]]|2.11|0.70|
|[[:human_genes:C:CENPBD1|CENPBD1]]|2.21|0.44|
|[[:human_genes:F:FZD8|FZD8]]|2.23|0.44|
|[[:human_genes:B:BCOR|BCOR]]|2.23|0.44|
|[[:human_genes:A:ANKLE2|ANKLE2]]|2.23|0.61|
|[[:human_genes:A:ACRC|ACRC]]|2.24|0.44|
|[[:human_genes:Z:ZNF335|ZNF335]]|2.43|0.70|
|[[:human_genes:T:TYMS|TYMS]]|2.62|0.52|
|[[:human_genes:E:EIF3B|EIF3B]]|3.03|0.44|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>