IWR1 50μM R08 exp495 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== IWR1 50μM R08 exp495 ======
==== Mechanism of Action ====
Stabilizes axin complex, inhibits Wnt/β-catenin signaling, also inhibits tankyrase
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Other Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%IWR-1-endo%%
    * **<color #00a2e8>Synonyms:</color>** endo-IWR 1; IWR-1-endo
    * **<color #00a2e8>CAS #:</color>** 1127442-82-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/44483163|44483163]]
    * **<color #00a2e8>IUPAC:</color>** %%4-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-quinolin-8-ylbenzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C25H19N3O3/c29-23(27-19-5-1-3-14-4-2-12-26-22(14)19)15-8-10-18(11-9-15)28-24(30)20-16-6-7-17(13-16)21(20)25(28)31/h1-12,16-17,20-21H,13H2,(H,27,29)/t16-,17+,20-,21+
    * **<color #00a2e8>INCHI Key:</color>** ZGSXEXBYLJIOGF-ALFLXDJESA-N
    * **<color #00a2e8>Molecular Weight:</color>** 409.4
    * **<color #00a2e8>Canonical SMILES:</color>** C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC6=C5N=CC=C6
    * **<color #00a2e8>Isomeric SMILES:</color>** C1[C@@H]2C=C[C@H]1[C@@H]3[C@H]2C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC6=C5N=CC=C6
    * **<color #00a2e8>Molecular Formula:</color>** KLTFYLKTLENAQAQQTTLSLAIF
{{:chemogenomics:structures:chem-0303.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-12238
    * **<color #00a2e8>Lot #:</color>** 12245
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C25H19N3O3 410.14992; found 410.15127
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** IWR1
    * **<color #00a2e8>Min:</color>** -6.6055; **<color #00a2e8>Max:</color>** 35.5116
{{:chemogenomics:dose_response:dr_550.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 50µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.4
    * **<color #00a2e8>Numbers of reads</color>**: 16401227


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|5/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/IWR1_50uM_Round-8_exp495.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='IWR1 50μM R08 exp495'>
{{:chemogenomics:cranks_plots:exp495.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC7A5|SLC7A5]]|-3.27|<0.01|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.91|0.02|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.88|0.02|
|[[:human_genes:P:PRKAA1|PRKAA1]]|-2.78|0.02|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.76|0.45|
|[[:human_genes:S:SPTLC2|SPTLC2]]|-2.64|0.03|
|[[:human_genes:G:GRIA1|GRIA1]]|-2.28|0.21|
|[[:human_genes:O:OR56A4|OR56A4]]|-2.27|0.21|
|[[:human_genes:P:POLR2J2|POLR2J2]]|-2.26|0.75|
|[[:human_genes:V:VPS25|VPS25]]|-2.25|0.67|
|[[:human_genes:S:SCAP|SCAP]]|-2.24|0.22|
|[[:human_genes:A:ATP2A2|ATP2A2]]|-2.22|0.79|
|[[:human_genes:C:CKMT1B|CKMT1B]]|-2.16|0.31|
|[[:human_genes:C:CALML4|CALML4]]|-2.16|0.45|
|[[:human_genes:P:PLA2G4E|PLA2G4E]]|-2.14|0.31|
|[[:human_genes:D:DARS2|DARS2]]|-2.13|0.64|
|[[:human_genes:P:PCMT1|PCMT1]]|-2.10|0.33|
|[[:human_genes:D:DDHD2|DDHD2]]|-2.08|0.33|
|[[:human_genes:R:RC3H1|RC3H1]]|-2.07|0.33|
|[[:human_genes:N:NIM1|NIM1]]|-2.07|0.33|
|[[:human_genes:R:RNASE9|RNASE9]]|-2.06|0.33|
|[[:human_genes:F:FNTB|FNTB]]|-2.04|0.45|
|[[:human_genes:P:PITPNB|PITPNB]]|-2.04|0.35|
|[[:human_genes:S:SNX18|SNX18]]|-2.01|0.37|
|[[:human_genes:A:ALG5|ALG5]]|-2.01|0.37|
|[[:human_genes:T:TAC4|TAC4]]|-2.00|0.45|
|[[:human_genes:L:LSM1|LSM1]]|-1.96|0.45|
|[[:human_genes:G:GLCE|GLCE]]|-1.95|0.45|
|[[:human_genes:Y:YTHDC2|YTHDC2]]|-1.95|0.53|
|[[:human_genes:T:TCP11X2|TCP11X2]]|-1.94|0.45|
|[[:human_genes:M:MZT2A|MZT2A]]|1.99|0.33|
|[[:human_genes:E:ELP6|ELP6]]|1.99|0.33|
|[[:human_genes:C:CD19|CD19]]|1.99|0.39|
|[[:human_genes:N:NEK5|NEK5]]|1.99|0.39|
|[[:human_genes:B:BCOR|BCOR]]|2.01|0.33|
|[[:human_genes:S:SPI1|SPI1]]|2.02|0.38|
|[[:human_genes:T:TBCC|TBCC]]|2.02|0.79|
|[[:human_genes:F:F12|F12]]|2.04|0.33|
|[[:human_genes:A:ASIC2|ASIC2]]|2.06|0.33|
|[[:human_genes:T:TDRD3|TDRD3]]|2.08|0.33|
|[[:human_genes:A:ARID4B|ARID4B]]|2.08|0.34|
|[[:human_genes:D:DNAH17|DNAH17]]|2.12|0.33|
|[[:human_genes:M:MIEN1|MIEN1]]|2.13|0.31|
|[[:human_genes:K:KIAA1210|KIAA1210]]|2.14|0.31|
|[[:human_genes:P:PABPC1|PABPC1]]|2.14|0.33|
|[[:human_genes:K:KSR1|KSR1]]|2.16|0.33|
|[[:human_genes:D:DLEC1|DLEC1]]|2.18|0.33|
|[[:human_genes:N:NDUFA13|NDUFA13]]|2.19|0.36|
|[[:human_genes:R:RFC2|RFC2]]|2.22|0.73|
|[[:human_genes:C:CTR9|CTR9]]|2.22|0.33|
|[[:human_genes:M:MEIS3|MEIS3]]|2.24|0.24|
|[[:human_genes:N:NR2C2AP|NR2C2AP]]|2.32|0.27|
|[[:human_genes:S:SSX2IP|SSX2IP]]|2.33|0.21|
|[[:human_genes:G:GLRX3|GLRX3]]|2.38|0.24|
|[[:human_genes:T:TBRG4|TBRG4]]|2.47|0.21|
|[[:human_genes:A:ANKRD40|ANKRD40]]|2.52|0.24|
|[[:human_genes:T:TPX2|TPX2]]|2.56|0.21|
|[[:human_genes:R:RPL11|RPL11]]|2.62|0.33|
|[[:human_genes:C:CADPS|CADPS]]|2.69|0.21|
|[[:human_genes:G:GLTSCR2|GLTSCR2]]|2.77|0.21|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.054|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="IWR1 50μM R08 exp495  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp149_vs_exp495.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>