Nicotinamide 2000μM R01 exp50 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Nicotinamide 2000μM R01 exp50 ======
==== Mechanism of Action ====
NAD biosynthetic precursor, activates SIRT1
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nicotinamide%%
    * **<color #00a2e8>Synonyms:</color>** Niacinamide; Nicotinic acid amide; Vitamin B3
    * **<color #00a2e8>CAS #:</color>** 98-92-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/936|936]]
    * **<color #00a2e8>IUPAC:</color>** %%pyridine-3-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9)
    * **<color #00a2e8>INCHI Key:</color>** DFPAKSUCGFBDDF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 122.12
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CN=C1)C(=O)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C6H6N2O
{{:chemogenomics:structures:chem-0030.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** N3376
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C6H6N2O 123.05529; found 123.05387
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** NICOTINAMIDE-N3376
    * **<color #00a2e8>Min:</color>** -12.6284; **<color #00a2e8>Max:</color>** 19.5781
{{:chemogenomics:dose_response:dr_102.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 01
    * **<color #00a2e8>Dose</color>**: 2000µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.6
    * **<color #00a2e8>Numbers of reads</color>**: 17056720


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nicotinamide_2000uM_Round-1_exp50.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nicotinamide 2000μM R01 exp50'>
{{:chemogenomics:cranks_plots:exp50.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KDSR|KDSR]]|-3.04|0.04|
|[[:human_genes:C:CHGB|CHGB]]|-2.68|0.93|
|[[:human_genes:M:MTFR2|MTFR2]]|-2.37|0.89|
|[[:human_genes:C:CDK5RAP2|CDK5RAP2]]|-2.34|0.93|
|[[:human_genes:C:CBFB|CBFB]]|-2.32|0.93|
|[[:human_genes:U:UBA3|UBA3]]|-2.28|0.93|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.27|0.93|
|[[:human_genes:C:COL18A1|COL18A1]]|-2.24|0.93|
|[[:human_genes:P:PAFAH1B2|PAFAH1B2]]|-2.23|0.93|
|[[:human_genes:C:CNGA2|CNGA2]]|-2.22|0.93|
|[[:human_genes:K:KARS|KARS]]|-2.15|0.93|
|[[:human_genes:S:SHOC2|SHOC2]]|-2.15|0.93|
|[[:human_genes:M:MYH10|MYH10]]|-2.13|0.93|
|[[:human_genes:C:CUL2|CUL2]]|-2.08|0.93|
|[[:human_genes:C:CNOT4|CNOT4]]|-2.07|0.93|
|[[:human_genes:U:UBA5|UBA5]]|-2.03|0.93|
|[[:human_genes:C:CCNC|CCNC]]|-2.02|0.93|
|[[:human_genes:C:CUL5|CUL5]]|-1.99|0.93|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-1.99|0.93|
|[[:human_genes:S:SUGT1|SUGT1]]|-1.98|0.93|
|[[:human_genes:A:ALG1L2|ALG1L2]]|-1.97|0.93|
|[[:human_genes:F:FOXK2|FOXK2]]|-1.97|0.93|
|[[:human_genes:C:CHD5|CHD5]]|-1.96|0.93|
|[[:human_genes:C:C14orf169|C14orf169]]|-1.95|0.93|
|[[:human_genes:S:SERPINA10|SERPINA10]]|-1.95|0.93|
|[[:human_genes:G:GAL|GAL]]|-1.94|0.93|
|[[:human_genes:F:FARSB|FARSB]]|-1.94|0.93|
|[[:human_genes:M:MPP7|MPP7]]|-1.93|0.93|
|[[:human_genes:P:PILRA|PILRA]]|-1.93|0.93|
|[[:human_genes:I:IRX6|IRX6]]|-1.90|0.93|
|[[:human_genes:S:SNRPD2|SNRPD2]]|1.98|0.82|
|[[:human_genes:P:PSMD12|PSMD12]]|1.99|0.80|
|[[:human_genes:G:GPHA2|GPHA2]]|1.99|0.76|
|[[:human_genes:C:C14orf93|C14orf93]]|2.00|0.82|
|[[:human_genes:O:ORC6|ORC6]]|2.03|0.82|
|[[:human_genes:K:KLF4|KLF4]]|2.07|0.76|
|[[:human_genes:R:RRP7A|RRP7A]]|2.11|0.76|
|[[:human_genes:C:CSNK1A1|CSNK1A1]]|2.11|0.80|
|[[:human_genes:C:CCDC155|CCDC155]]|2.12|0.76|
|[[:human_genes:P:PDS5B|PDS5B]]|2.13|0.76|
|[[:human_genes:S:SMEK2|SMEK2]]|2.16|0.76|
|[[:human_genes:T:TRIB2|TRIB2]]|2.17|0.76|
|[[:human_genes:H:HABP2|HABP2]]|2.18|0.76|
|[[:human_genes:T:TSPAN9|TSPAN9]]|2.20|0.76|
|[[:human_genes:P:POLR2K|POLR2K]]|2.23|0.80|
|[[:human_genes:G:GNL2|GNL2]]|2.24|0.76|
|[[:human_genes:R:RBM39|RBM39]]|2.25|0.76|
|[[:human_genes:A:ATXN1|ATXN1]]|2.25|0.80|
|[[:human_genes:G:GPR179|GPR179]]|2.26|0.80|
|[[:human_genes:A:ABL2|ABL2]]|2.26|0.76|
|[[:human_genes:C:CXorf21|CXorf21]]|2.28|0.80|
|[[:human_genes:M:MYLK3|MYLK3]]|2.29|0.80|
|[[:human_genes:P:PCYOX1L|PCYOX1L]]|2.32|0.76|
|[[:human_genes:A:ARGLU1|ARGLU1]]|2.37|0.82|
|[[:human_genes:N:NOC3L|NOC3L]]|2.42|0.80|
|[[:human_genes:C:CPEB2|CPEB2]]|2.43|0.77|
|[[:human_genes:E:EIF3A|EIF3A]]|2.47|0.76|
|[[:human_genes:P:PSMA5|PSMA5]]|2.48|0.76|
|[[:human_genes:P:PSMD1|PSMD1]]|2.52|0.76|
|[[:human_genes:G:GOLT1A|GOLT1A]]|2.77|0.23|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>