Vitamin-D3 40μM R08 exp536 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Vitamin-D3 40μM R08 exp536 ======
==== Mechanism of Action ====
Steroid hormone, converted to active 1,25-dihydroxycholecalciferol (calcitriol), role in calcium homeostasis
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Vitamin
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Metabolite
  * **<color #00a2e8>Class / Subclass 3:</color>** SIgnal Transduction / Receptor Ligand


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Cholecalciferol%%
    * **<color #00a2e8>Synonyms:</color>** Vitamin D3; Colecalciferol
    * **<color #00a2e8>CAS #:</color>** 67-97-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5280795|5280795]]
    * **<color #00a2e8>IUPAC:</color>** %%(1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** QYSXJUFSXHHAJI-YRZJJWOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 384.6
    * **<color #00a2e8>Canonical SMILES:</color>** CC(C)CCCC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\\2[C@@]1(CCC/C2=C\\C=C/3\\C[C@H](CCC3=C)O)C
    * **<color #00a2e8>Molecular Formula:</color>** SGQVYFGIIA F
{{:chemogenomics:structures:chem-0340.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** V676045
    * **<color #00a2e8>Lot #:</color>** 1-LXM-62-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C27H44O 385.34649; found 385.34677
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Vitamin_D3
    * **<color #00a2e8>Min:</color>** -4.9823; **<color #00a2e8>Max:</color>** 99.7060
{{:chemogenomics:dose_response:dr_632.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |43.1100    |
| IC20  |49.9600    |
| IC30  |55.1000    |
| IC40  |59.7100    |
| IC50  |64.2800    |
| IC60  |69.2000    |
| IC70  |74.9900    |
| IC80  |82.7100    |
| IC90  |95.8400    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 40µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: -0.4
    * **<color #00a2e8>Numbers of reads</color>**: 16653208


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/5|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Vitamin_D3_40uM_Round-8_exp536.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Vitamin-D3 40μM R08 exp536'>
{{:chemogenomics:cranks_plots:exp536.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DDX21|DDX21]]|-2.67|0.48|
|[[:human_genes:C:COPZ1|COPZ1]]|-2.35|0.48|
|[[:human_genes:M:MDM2|MDM2]]|-2.35|0.48|
|[[:human_genes:K:KRTAP4-7|KRTAP4-7]]|-2.31|0.48|
|[[:human_genes:X:XPO1|XPO1]]|-2.29|0.70|
|[[:human_genes:W:WDR3|WDR3]]|-2.27|0.68|
|[[:human_genes:D:DCAF12L2|DCAF12L2]]|-2.24|0.48|
|[[:human_genes:O:OR9I1|OR9I1]]|-2.23|0.48|
|[[:human_genes:P:PNN|PNN]]|-2.21|0.50|
|[[:human_genes:T:TRAIP|TRAIP]]|-2.20|0.70|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.18|0.74|
|[[:human_genes:M:MRPL14|MRPL14]]|-2.13|0.48|
|[[:human_genes:N:NUP155|NUP155]]|-2.11|0.48|
|[[:human_genes:B:BRD8|BRD8]]|-2.11|0.48|
|[[:human_genes:T:THPO|THPO]]|-2.10|0.48|
|[[:human_genes:C:CMTM8|CMTM8]]|-2.09|0.48|
|[[:human_genes:A:ARCN1|ARCN1]]|-2.08|0.50|
|[[:human_genes:G:GPCPD1|GPCPD1]]|-2.08|0.48|
|[[:human_genes:P:PRPF8|PRPF8]]|-2.07|0.70|
|[[:human_genes:Z:ZNF704|ZNF704]]|-2.04|0.68|
|[[:human_genes:D:DLG5|DLG5]]|-2.04|0.48|
|[[:human_genes:G:GOLGA6L3|GOLGA6L3]]|-2.02|0.54|
|[[:human_genes:P:PHPT1|PHPT1]]|-2.01|0.48|
|[[:human_genes:F:FRG2C|FRG2C]]|-2.00|0.48|
|[[:human_genes:P:PAFAH1B2|PAFAH1B2]]|-1.99|0.58|
|[[:human_genes:Y:YIPF2|YIPF2]]|-1.99|0.48|
|[[:human_genes:I:IQCF5|IQCF5]]|-1.98|0.59|
|[[:human_genes:P:PLK1|PLK1]]|-1.97|0.72|
|[[:human_genes:C:CCDC59|CCDC59]]|-1.96|0.50|
|[[:human_genes:P:POLD3|POLD3]]|-1.95|0.79|
|[[:human_genes:S:SCD5|SCD5]]|1.93|0.44|
|[[:human_genes:R:RAB7A|RAB7A]]|1.95|0.43|
|[[:human_genes:S:SLC39A10|SLC39A10]]|1.96|0.43|
|[[:human_genes:D:DERL1|DERL1]]|1.97|0.46|
|[[:human_genes:C:C21orf59|C21orf59]]|1.97|0.53|
|[[:human_genes:G:GPN2|GPN2]]|1.98|0.53|
|[[:human_genes:K:KIAA0391|KIAA0391]]|2.05|0.44|
|[[:human_genes:T:TIMM44|TIMM44]]|2.05|0.57|
|[[:human_genes:Z:ZNF708|ZNF708]]|2.07|0.50|
|[[:human_genes:F:FASTKD5|FASTKD5]]|2.08|0.43|
|[[:human_genes:E:EIF3F|EIF3F]]|2.09|0.43|
|[[:human_genes:T:TPK1|TPK1]]|2.12|0.41|
|[[:human_genes:A:ASB3|ASB3]]|2.12|0.41|
|[[:human_genes:R:RTF1|RTF1]]|2.17|0.35|
|[[:human_genes:O:OR2G2|OR2G2]]|2.25|0.13|
|[[:human_genes:G:GPBP1|GPBP1]]|2.25|0.13|
|[[:human_genes:P:PGGT1B|PGGT1B]]|2.26|0.13|
|[[:human_genes:E:EIF4A1|EIF4A1]]|2.31|0.18|
|[[:human_genes:S:SPATA3|SPATA3]]|2.32|0.12|
|[[:human_genes:G:GMPPB|GMPPB]]|2.34|0.58|
|[[:human_genes:C:C11orf57|C11orf57]]|2.36|0.11|
|[[:human_genes:K:KRT84|KRT84]]|2.39|0.13|
|[[:human_genes:S:SNAPC4|SNAPC4]]|2.48|0.57|
|[[:human_genes:G:GTF3C6|GTF3C6]]|2.52|0.11|
|[[:human_genes:S:STRAP|STRAP]]|2.57|0.05|
|[[:human_genes:E:EPT1|EPT1]]|2.57|0.10|
|[[:human_genes:M:MBTPS2|MBTPS2]]|2.61|0.05|
|[[:human_genes:F:FIS1|FIS1]]|2.64|0.05|
|[[:human_genes:A:ACSL4|ACSL4]]|3.41|<0.01|
|[[:human_genes:P:PFN1|PFN1]]|3.49|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp513|ONC212 0.15μM R08 exp513]]|0.051|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="ONC212 0.15μM R08 exp513  vs  Vitamin-D3 40μM R08 exp536">
{{:chemogenomics:comparison_plots:exp513_vs_exp536.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>