YM155 0.0002μM R01 exp61 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== YM155 0.0002μM R01 exp61 ======
==== Mechanism of Action ====
Inhibits expression of survivin, amongst other ascribed mechanisms
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Transcription Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Apoptosis Activator



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Sepantronium bromide%%
    * **<color #00a2e8>Synonyms:</color>** Sepantronium bromide
    * **<color #00a2e8>CAS #:</color>** 781661-94-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/11178236|11178236]]
    * **<color #00a2e8>IUPAC:</color>** %%1-(2-methoxyethyl)-2-methyl-3-(pyrazin-2-ylmethyl)benzo[f]benzimidazol-3-ium-4,9-dione;bromide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H19N4O3.BrH/c1-13-23(9-10-27-2)17-18(24(13)12-14-11-21-7-8-22-14)20(26)16-6-4-3-5-15(16)19(17)25;/h3-8,11H,9-10,12H2,1-2H3;1H/q+1;/p-1
    * **<color #00a2e8>INCHI Key:</color>** QBIYUDDJPRGKNJ-UHFFFAOYSA-M
    * **<color #00a2e8>Molecular Weight:</color>** 443.3
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=[N+](C2=C(N1CCOC)C(=O)C3=CC=CC=C3C2=O)CC4=NC=CN=C4.[Br-]
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H19BrN4O3
{{:chemogenomics:structures:chem-0041.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S1130
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M)+ Calcd for C20 H19 N4 O3 363.14572; found 363.14685
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** YM155
    * **<color #00a2e8>Min:</color>** 98.8935; **<color #00a2e8>Max:</color>** 99.2535
{{:chemogenomics:dose_response:dr_163.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 01
    * **<color #00a2e8>Dose</color>**: 0.2nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 12549892


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/YM155_0.0002uM_Round-1_exp61.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='YM155 0.0002μM R01 exp61'>
{{:chemogenomics:cranks_plots:exp61.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NSMCE1|NSMCE1]]|-2.96|0.30|
|[[:human_genes:Z:ZNF737|ZNF737]]|-2.89|0.48|
|[[:human_genes:M:MRPS5|MRPS5]]|-2.64|0.34|
|[[:human_genes:S:SART3|SART3]]|-2.62|0.42|
|[[:human_genes:Y:YRDC|YRDC]]|-2.59|0.74|
|[[:human_genes:C:CTPS1|CTPS1]]|-2.58|0.42|
|[[:human_genes:A:ARMCX3|ARMCX3]]|-2.55|0.42|
|[[:human_genes:E:ERCC2|ERCC2]]|-2.53|0.42|
|[[:human_genes:O:OR13C3|OR13C3]]|-2.43|0.30|
|[[:human_genes:O:OR51S1|OR51S1]]|-2.42|0.48|
|[[:human_genes:N:NRDE2|NRDE2]]|-2.35|0.78|
|[[:human_genes:D:DERA|DERA]]|-2.30|0.48|
|[[:human_genes:V:VEZT|VEZT]]|-2.28|0.42|
|[[:human_genes:C:CEP57|CEP57]]|-2.26|0.48|
|[[:human_genes:C:C14orf178|C14orf178]]|-2.26|0.48|
|[[:human_genes:K:KIAA0391|KIAA0391]]|-2.25|0.59|
|[[:human_genes:V:VPS25|VPS25]]|-2.23|0.77|
|[[:human_genes:A:ATRX|ATRX]]|-2.22|0.78|
|[[:human_genes:L:LEF1|LEF1]]|-2.22|0.42|
|[[:human_genes:S:SLC7A9|SLC7A9]]|-2.20|0.42|
|[[:human_genes:E:ENY2|ENY2]]|-2.19|0.70|
|[[:human_genes:U:UBA3|UBA3]]|-2.17|0.78|
|[[:human_genes:C:C8orf86|C8orf86]]|-2.11|0.59|
|[[:human_genes:R:RBX1|RBX1]]|-2.10|0.78|
|[[:human_genes:F:FNBP1L|FNBP1L]]|-2.08|0.78|
|[[:human_genes:P:PTDSS1|PTDSS1]]|-2.07|0.42|
|[[:human_genes:C:CUL2|CUL2]]|-2.05|0.77|
|[[:human_genes:D:DDX55|DDX55]]|-2.05|0.70|
|[[:human_genes:R:RASA1|RASA1]]|-2.05|0.78|
|[[:human_genes:Z:ZNF600|ZNF600]]|-2.04|0.53|
|[[:human_genes:V:VKORC1L1|VKORC1L1]]|2.13|0.48|
|[[:human_genes:P:PSMD1|PSMD1]]|2.14|0.68|
|[[:human_genes:E:EIF5B|EIF5B]]|2.14|0.68|
|[[:human_genes:Z:ZBTB49|ZBTB49]]|2.15|0.48|
|[[:human_genes:S:SPAG5|SPAG5]]|2.16|0.50|
|[[:human_genes:P:POP1|POP1]]|2.19|0.49|
|[[:human_genes:N:N4BP2|N4BP2]]|2.20|0.62|
|[[:human_genes:C:COL19A1|COL19A1]]|2.20|0.49|
|[[:human_genes:A:ABCB8|ABCB8]]|2.20|0.62|
|[[:human_genes:Z:ZNF345|ZNF345]]|2.23|0.28|
|[[:human_genes:F:FKBP1A|FKBP1A]]|2.24|0.28|
|[[:human_genes:F:FBXL19|FBXL19]]|2.25|0.37|
|[[:human_genes:P:PDGFRA|PDGFRA]]|2.25|0.28|
|[[:human_genes:Z:ZNF114|ZNF114]]|2.25|0.62|
|[[:human_genes:P:PCDH1|PCDH1]]|2.27|0.37|
|[[:human_genes:N:NOP2|NOP2]]|2.27|0.62|
|[[:human_genes:R:RPL32|RPL32]]|2.29|0.68|
|[[:human_genes:R:RPL13|RPL13]]|2.29|0.68|
|[[:human_genes:B:BCL2L12|BCL2L12]]|2.31|0.50|
|[[:human_genes:M:MPHOSPH10|MPHOSPH10]]|2.32|0.68|
|[[:human_genes:F:FAM178A|FAM178A]]|2.34|0.68|
|[[:human_genes:T:TRIM52|TRIM52]]|2.34|0.63|
|[[:human_genes:R:RALGDS|RALGDS]]|2.39|0.62|
|[[:human_genes:R:RUSC1|RUSC1]]|2.41|0.48|
|[[:human_genes:T:TESC|TESC]]|2.44|0.28|
|[[:human_genes:P:PSMD14|PSMD14]]|2.47|0.62|
|[[:human_genes:Z:ZNF569|ZNF569]]|2.49|0.51|
|[[:human_genes:G:GPR33|GPR33]]|2.68|0.28|
|[[:human_genes:H:HK1|HK1]]|2.96|0.10|
|[[:human_genes:T:TTK|TTK]]|3.28|0.10|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp41|BI-2536 0.001μM R01 exp41]]|0.066|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp49|NFN1 0.1μM R01 exp49]]|0.063|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp47|Lapatinib 5μM R01 exp47]]|0.057|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="BI-2536 0.001μM R01 exp41  vs  YM155 0.0002μM R01 exp61">
{{:chemogenomics:comparison_plots:exp41_vs_exp61.png?nolink |}}
</modal>

<modal id="2" size="lg" title="NFN1 0.1μM R01 exp49  vs  YM155 0.0002μM R01 exp61">
{{:chemogenomics:comparison_plots:exp49_vs_exp61.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Lapatinib 5μM R01 exp47  vs  YM155 0.0002μM R01 exp61">
{{:chemogenomics:comparison_plots:exp47_vs_exp61.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>