Brefeldin A 0.02μM R00 exp8 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Brefeldin A 0.02μM R00 exp8 ======
==== Mechanism of Action ====
Inhibits Golgi to ER transport, forms uncompetitive complex with GBF1 and GDP-bound Arf1
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Vesicule Trafficking Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Brefeldin A%%
    * **<color #00a2e8>Synonyms:</color>** BFA; Cyanein; Decumbin
    * **<color #00a2e8>CAS #:</color>** 20350-15-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5287620|5287620]]
    * **<color #00a2e8>IUPAC:</color>** %%(1R,2R,3E,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C16H24O4/c1-11-5-3-2-4-6-12-9-13(17)10-14(12)15(18)7-8-16(19)20-11/h4,6-8,11-15,17-18H,2-3,5,9-10H2,1H3/b6-4+,8-7+/t11-,12+,13-,14+,15+/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** KQNZDYYTLMIZCT-KQPMLPITSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 280.36
    * **<color #00a2e8>Canonical SMILES:</color>** CC1CCCC=CC2CC(CC2C(C=CC(=O)O1)O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H]1CCC/C=C/[C@@H]2C[C@@H](C[C@H]2[C@@H](/C=C/C(=O)O1)O)O
    * **<color #00a2e8>Molecular Formula:</color>** C16H24O4
{{:chemogenomics:structures:chem-0005.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** LC Laboratories
    * **<color #00a2e8>Catalog #:</color>** B-8500
    * **<color #00a2e8>Lot #:</color>** BBF-401
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C16H24O4 281.17474; found 281.17412
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Brefeldin_A
    * **<color #00a2e8>Min:</color>** -14.8343; **<color #00a2e8>Max:</color>** 90.1805
{{:chemogenomics:dose_response:dr_257.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.1694    |
| IC30  |0.1783    |
| IC40  |0.1859    |
| IC50  |0.1931    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 20nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 0.6
    * **<color #00a2e8>Numbers of reads</color>**: 11323380


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|7/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Brefeldin_A_0.02uM_Round-0_exp8.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Brefeldin A 0.02μM R00 exp8'>
{{:chemogenomics:cranks_plots:exp8.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SCFD1|SCFD1]]|-3.33|<0.01|
|[[:human_genes:F:FIS1|FIS1]]|-3.14|<0.01|
|[[:human_genes:E:EIF2AK3|EIF2AK3]]|-3.05|<0.01|
|[[:human_genes:U:USO1|USO1]]|-3.03|<0.01|
|[[:human_genes:U:UGCG|UGCG]]|-2.93|<0.01|
|[[:human_genes:P:PIEZO1|PIEZO1]]|-2.75|0.01|
|[[:human_genes:P:PLVAP|PLVAP]]|-2.75|0.01|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.74|0.07|
|[[:human_genes:R:RPL37A|RPL37A]]|-2.70|0.30|
|[[:human_genes:H:HMHA1|HMHA1]]|-2.69|0.11|
|[[:human_genes:P:PSMA5|PSMA5]]|-2.67|0.11|
|[[:human_genes:P:PPP1R12A|PPP1R12A]]|-2.65|0.07|
|[[:human_genes:B:BCOR|BCOR]]|-2.50|0.07|
|[[:human_genes:P:PAN2|PAN2]]|-2.49|0.07|
|[[:human_genes:A:ATP6V0B|ATP6V0B]]|-2.45|0.12|
|[[:human_genes:I:INO80E|INO80E]]|-2.45|0.08|
|[[:human_genes:P:PDE8B|PDE8B]]|-2.42|0.09|
|[[:human_genes:Y:YPEL5|YPEL5]]|-2.41|0.07|
|[[:human_genes:R:RPL36|RPL36]]|-2.40|0.44|
|[[:human_genes:E:ERN1|ERN1]]|-2.36|0.07|
|[[:human_genes:T:TSC2|TSC2]]|-2.36|0.07|
|[[:human_genes:C:COPA|COPA]]|-2.35|0.38|
|[[:human_genes:N:NFYA|NFYA]]|-2.35|0.11|
|[[:human_genes:A:ATL2|ATL2]]|-2.34|0.07|
|[[:human_genes:A:ATP6AP1|ATP6AP1]]|-2.31|0.55|
|[[:human_genes:F:FAM160A1|FAM160A1]]|-2.28|0.12|
|[[:human_genes:X:XAB2|XAB2]]|-2.27|0.42|
|[[:human_genes:P:PMAIP1|PMAIP1]]|-2.26|0.09|
|[[:human_genes:P:PSMD4|PSMD4]]|-2.24|0.14|
|[[:human_genes:S:SART1|SART1]]|-2.23|0.49|
|[[:human_genes:R:RAB40C|RAB40C]]|1.95|0.40|
|[[:human_genes:M:MARS|MARS]]|1.96|0.60|
|[[:human_genes:D:DNAJC3|DNAJC3]]|1.96|0.40|
|[[:human_genes:V:VN1R4|VN1R4]]|1.96|0.40|
|[[:human_genes:C:CYP3A43|CYP3A43]]|1.97|0.40|
|[[:human_genes:B:BIRC3|BIRC3]]|1.98|0.40|
|[[:human_genes:P:PPIP5K1|PPIP5K1]]|1.98|0.40|
|[[:human_genes:C:CRLS1|CRLS1]]|2.00|0.40|
|[[:human_genes:G:GTF2B|GTF2B]]|2.01|0.60|
|[[:human_genes:A:ATM|ATM]]|2.02|0.40|
|[[:human_genes:S:ST20|ST20]]|2.06|0.60|
|[[:human_genes:C:CHPF2|CHPF2]]|2.07|0.54|
|[[:human_genes:N:NEMF|NEMF]]|2.07|0.40|
|[[:human_genes:L:LOC441155|LOC441155]]|2.10|0.39|
|[[:human_genes:Z:ZAK|ZAK]]|2.15|0.36|
|[[:human_genes:H:HNMT|HNMT]]|2.15|0.40|
|[[:human_genes:I:IFI44|IFI44]]|2.16|0.40|
|[[:human_genes:M:MRPS33|MRPS33]]|2.17|0.40|
|[[:human_genes:T:TBCE|TBCE]]|2.17|0.40|
|[[:human_genes:C:COX17|COX17]]|2.22|0.40|
|[[:human_genes:R:RXFP2|RXFP2]]|2.23|0.39|
|[[:human_genes:P:PMM2|PMM2]]|2.29|0.21|
|[[:human_genes:F:FAM72C|FAM72C]]|2.30|0.60|
|[[:human_genes:R:RABGGTB|RABGGTB]]|2.34|0.21|
|[[:human_genes:C:CEPT1|CEPT1]]|2.34|0.21|
|[[:human_genes:G:GMPPB|GMPPB]]|2.35|0.40|
|[[:human_genes:T:TBCA|TBCA]]|2.40|0.22|
|[[:human_genes:O:OR2G3|OR2G3]]|2.57|0.13|
|[[:human_genes:U:UBE2G1|UBE2G1]]|2.62|0.13|
|[[:human_genes:P:PPP2R3C|PPP2R3C]]|2.63|0.21|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp17|DABN 20μM R00 exp17]]|0.056|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp26|Oligomycin-A 20μM R00 exp26]]|0.054|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp7|Bortezomib 0.05μM R00 exp7]]|0.072|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="Brefeldin A 0.02μM R00 exp8  vs  DABN 20μM R00 exp17">
{{:chemogenomics:comparison_plots:exp17_vs_exp8.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Brefeldin A 0.02μM R00 exp8  vs  Oligomycin-A 20μM R00 exp26">
{{:chemogenomics:comparison_plots:exp26_vs_exp8.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Bortezomib 0.05μM R00 exp7  vs  Brefeldin A 0.02μM R00 exp8">
{{:chemogenomics:comparison_plots:exp7_vs_exp8.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>