Nocodazole 0.02μM R00 exp23 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Nocodazole 0.02μM R00 exp23 ======
==== Mechanism of Action ====
Inhibits microtubule polymerization and mitotic spindle formation, induces spindle assembly checkpoint (SAC)
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Microtubule Poison
  * **<color #00a2e8>Class / Subclass 2:</color>** Organelle Function / Cytoskeletal Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nocodazole%%
    * **<color #00a2e8>Synonyms:</color>** Oncodazole; R17934
    * **<color #00a2e8>CAS #:</color>** 31430-18-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/4122|4122]]
    * **<color #00a2e8>IUPAC:</color>** %%methyl N-[6-(thiophene-2-carbonyl)-1H-benzimidazol-2-yl]carbamate%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19)
    * **<color #00a2e8>INCHI Key:</color>** KYRVNWMVYQXFEU-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 301.32
    * **<color #00a2e8>Canonical SMILES:</color>** COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=CS3
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C14H11N3O3S
{{:chemogenomics:structures:chem-0013.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** M1404
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C14H11N3O3S 302.05939; found 302.05966
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Nocodazole
    * **<color #00a2e8>Min:</color>** -9.8754; **<color #00a2e8>Max:</color>** 86.3481
{{:chemogenomics:dose_response:dr_270.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.0313    |
| IC30  |0.0403    |
| IC40  |0.0496    |
| IC50  |0.0601    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 20nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.7
    * **<color #00a2e8>Numbers of reads</color>**: 11011223


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nocodazole_0.02uM_Round-0_exp23.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nocodazole 0.02μM R00 exp23'>
{{:chemogenomics:cranks_plots:exp23.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:C:C1orf131|C1orf131]]|-2.68|0.16|
|[[:human_genes:P:PRMT5|PRMT5]]|-2.59|0.46|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-2.53|0.16|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.53|0.16|
|[[:human_genes:I:ITGB1|ITGB1]]|-2.53|0.16|
|[[:human_genes:N:NUDT5|NUDT5]]|-2.49|0.16|
|[[:human_genes:S:SHOC2|SHOC2]]|-2.38|0.20|
|[[:human_genes:C:CUL2|CUL2]]|-2.35|0.20|
|[[:human_genes:T:TEN1|TEN1]]|-2.33|0.17|
|[[:human_genes:P:PARD3B|PARD3B]]|-2.24|0.20|
|[[:human_genes:Z:ZCCHC4|ZCCHC4]]|-2.23|0.46|
|[[:human_genes:S:SLC45A3|SLC45A3]]|-2.23|0.20|
|[[:human_genes:P:PNMAL2|PNMAL2]]|-2.20|0.34|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.19|0.46|
|[[:human_genes:M:MARK1|MARK1]]|-2.13|0.40|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.11|0.46|
|[[:human_genes:M:MTRNR2L3|MTRNR2L3]]|-2.09|0.59|
|[[:human_genes:K:KDSR|KDSR]]|-2.09|0.34|
|[[:human_genes:D:DNTTIP1|DNTTIP1]]|-2.08|0.34|
|[[:human_genes:T:TPRKB|TPRKB]]|-2.07|0.46|
|[[:human_genes:G:GEMIN5|GEMIN5]]|-2.03|0.40|
|[[:human_genes:A:ATF7IP|ATF7IP]]|-2.01|0.40|
|[[:human_genes:C:CTC1|CTC1]]|-2.00|0.46|
|[[:human_genes:T:TMEM189|TMEM189]]|-1.99|0.46|
|[[:human_genes:D:DDX55|DDX55]]|-1.98|0.46|
|[[:human_genes:A:AGPS|AGPS]]|-1.98|0.46|
|[[:human_genes:S:SHE|SHE]]|-1.98|0.46|
|[[:human_genes:T:TMEM179B|TMEM179B]]|-1.95|0.46|
|[[:human_genes:C:COL21A1|COL21A1]]|-1.94|0.46|
|[[:human_genes:A:ACSL4|ACSL4]]|-1.94|0.46|
|[[:human_genes:T:TLR10|TLR10]]|2.05|0.44|
|[[:human_genes:R:RNF4|RNF4]]|2.06|0.44|
|[[:human_genes:R:RPS9|RPS9]]|2.06|0.49|
|[[:human_genes:U:UBAP1|UBAP1]]|2.10|0.44|
|[[:human_genes:P:PPID|PPID]]|2.12|0.44|
|[[:human_genes:Y:YTHDC1|YTHDC1]]|2.13|0.49|
|[[:human_genes:A:ACOT1|ACOT1]]|2.14|0.37|
|[[:human_genes:C:COPB2|COPB2]]|2.15|0.49|
|[[:human_genes:R:RPL14|RPL14]]|2.16|0.49|
|[[:human_genes:P:PCSK1|PCSK1]]|2.18|0.33|
|[[:human_genes:S:SCAF1|SCAF1]]|2.19|0.64|
|[[:human_genes:A:AAMP|AAMP]]|2.19|0.44|
|[[:human_genes:G:GPR82|GPR82]]|2.21|0.32|
|[[:human_genes:R:RPL27A|RPL27A]]|2.29|0.54|
|[[:human_genes:C:CYP4Z1|CYP4Z1]]|2.30|0.22|
|[[:human_genes:G:GPSM3|GPSM3]]|2.30|0.44|
|[[:human_genes:H:HMHB1|HMHB1]]|2.32|0.49|
|[[:human_genes:R:RPS28|RPS28]]|2.39|0.49|
|[[:human_genes:P:PRPF8|PRPF8]]|2.40|0.49|
|[[:human_genes:S:SLC5A5|SLC5A5]]|2.42|0.16|
|[[:human_genes:P:PIK3R3|PIK3R3]]|2.42|0.16|
|[[:human_genes:N:NSA2|NSA2]]|2.43|0.49|
|[[:human_genes:G:GPR183|GPR183]]|2.45|0.22|
|[[:human_genes:R:RFC1|RFC1]]|2.60|0.49|
|[[:human_genes:K:KDM6A|KDM6A]]|2.64|0.09|
|[[:human_genes:K:KIF11|KIF11]]|2.70|0.49|
|[[:human_genes:R:RPL37|RPL37]]|2.77|0.44|
|[[:human_genes:V:VCP|VCP]]|2.81|0.09|
|[[:human_genes:S:SUPT6H|SUPT6H]]|3.08|0.43|
|[[:human_genes:C:CDT1|CDT1]]|3.18|0.44|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp27|Pimelic-diphenylamide-106 0.5μM R00 exp27]]|0.067|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp37|Wortmannin 0.5μM R00 exp37]]|0.062|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp14|Cycloheximide 0.02μM R00 exp14]]|0.08|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp12|Chloramphenicol 2μM R00 exp12]]|0.07|<button type="primary" size="small" modal="4">View</button>|
</modal>


<modal id="1" size="lg" title="Nocodazole 0.02μM R00 exp23  vs  Pimelic-diphenylamide-106 0.5μM R00 exp27">
{{:chemogenomics:comparison_plots:exp23_vs_exp27.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Nocodazole 0.02μM R00 exp23  vs  Wortmannin 0.5μM R00 exp37">
{{:chemogenomics:comparison_plots:exp23_vs_exp37.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Cycloheximide 0.02μM R00 exp14  vs  Nocodazole 0.02μM R00 exp23">
{{:chemogenomics:comparison_plots:exp14_vs_exp23.png?nolink |}}
</modal>

<modal id="4" size="lg" title="Chloramphenicol 2μM R00 exp12  vs  Nocodazole 0.02μM R00 exp23">
{{:chemogenomics:comparison_plots:exp12_vs_exp23.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|CST complex|637.73|TEN1,CTC1|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|cytosolic ribosome|26.32|RPL37,RPS28,RPL27A,RPL14,RPS9|
|cytoplasmic translation|24.46|RPL37,RPS28,RPL27A,RPL14,RPS9|
|structural constituent of ribosome|18.30|RPL37,RPS28,RPL27A,RPL14,RPS9|
</modal>