Calcipotriol 5μM R08 exp464 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Calcipotriol 5μM R08 exp464 ======
==== Mechanism of Action ====
Synthetic vitamin D3 analog, binds vitamin D nuclear hormone receptor
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Vitamin
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Nuclear Receptor Ligand



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Calcipotriol%%
    * **<color #00a2e8>Synonyms:</color>** MC 903; Calcipotriene
    * **<color #00a2e8>CAS #:</color>** 112965-21-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5288783|5288783]]
    * **<color #00a2e8>IUPAC:</color>** %%(1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5S)-5-cyclopropyl-5-hydroxypent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7+,21-10-/t17-,22-,23-,24+,25-,26+,27-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** LWQQLNNNIPYSNX-UROSTWAQSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 412.6
    * **<color #00a2e8>Canonical SMILES:</color>** CC(C=CC(C1CC1)O)C2CCC3C2(CCCC3=CC=C4CC(CC(C4=C)O)O)C
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H](/C=C/[C@H](C1CC1)O)[C@H]2CC[C@@H]\\3[C@@]2(CCC/C3=C\\C=C/4\\C[C@H](C[C@@H](C4=C)O)O)C
    * **<color #00a2e8>Molecular Formula:</color>** C27H40O3
{{:chemogenomics:structures:chem-0274.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-10001
    * **<color #00a2e8>Lot #:</color>** 18957
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+Na)+ Calcd for C27H40O3 435.28697; found 435.28817
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Calcipotriol
    * **<color #00a2e8>Min:</color>** -20.7096; **<color #00a2e8>Max:</color>** 79.7081
{{:chemogenomics:dose_response:dr_510.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |37.6200    |
| IC20  |40.2200    |
| IC30  |42.0400    |
| IC40  |43.5900    |
| IC50  |45.0700    |
| IC60  |46.6000    |
| IC70  |48.3200    |
| IC80  |50.5100    |
| IC90  |53.9900    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.3
    * **<color #00a2e8>Numbers of reads</color>**: 14154949


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Calcipotriol_5uM_Round-8_exp464.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Calcipotriol 5μM R08 exp464'>
{{:chemogenomics:cranks_plots:exp464.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:UHRF1|UHRF1]]|-2.39|0.47|
|[[:human_genes:R:RNASEH2B|RNASEH2B]]|-2.37|0.47|
|[[:human_genes:D:DEPDC5|DEPDC5]]|-2.26|0.47|
|[[:human_genes:L:LIG4|LIG4]]|-2.16|0.47|
|[[:human_genes:S:SPATA16|SPATA16]]|-2.11|0.47|
|[[:human_genes:R:REST|REST]]|-2.09|0.47|
|[[:human_genes:D:DNMBP|DNMBP]]|-2.09|0.47|
|[[:human_genes:L:LEUTX|LEUTX]]|-2.09|0.62|
|[[:human_genes:R:RLBP1|RLBP1]]|-2.09|0.47|
|[[:human_genes:C:CEPT1|CEPT1]]|-2.09|0.47|
|[[:human_genes:S:SRP68|SRP68]]|-2.07|0.47|
|[[:human_genes:X:XRCC2|XRCC2]]|-2.04|0.47|
|[[:human_genes:S:SYNC|SYNC]]|-2.04|0.47|
|[[:human_genes:P:POM121|POM121]]|-2.04|0.47|
|[[:human_genes:A:ASB3|ASB3]]|-2.03|0.47|
|[[:human_genes:U:USP48|USP48]]|-2.02|0.47|
|[[:human_genes:D:DERL1|DERL1]]|-2.01|0.47|
|[[:human_genes:S:SNX18|SNX18]]|-2.01|0.47|
|[[:human_genes:I:ITPA|ITPA]]|-1.99|0.47|
|[[:human_genes:D:DCTN6|DCTN6]]|-1.97|0.62|
|[[:human_genes:M:MPI|MPI]]|-1.97|0.47|
|[[:human_genes:M:MCM9|MCM9]]|-1.97|0.47|
|[[:human_genes:A:ATL1|ATL1]]|-1.96|0.47|
|[[:human_genes:P:PCNXL3|PCNXL3]]|-1.95|0.47|
|[[:human_genes:M:MYPN|MYPN]]|-1.93|0.47|
|[[:human_genes:I:INO80C|INO80C]]|-1.92|0.47|
|[[:human_genes:A:ANKRD36B|ANKRD36B]]|-1.91|0.47|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-1.90|0.62|
|[[:human_genes:K:KCNJ14|KCNJ14]]|-1.89|0.47|
|[[:human_genes:U:UBE2N|UBE2N]]|-1.88|0.47|
|[[:human_genes:N:NUP214|NUP214]]|1.86|0.77|
|[[:human_genes:H:HADH|HADH]]|1.87|0.61|
|[[:human_genes:D:DUSP21|DUSP21]]|1.87|0.61|
|[[:human_genes:T:TP53I13|TP53I13]]|1.89|0.63|
|[[:human_genes:A:AASDH|AASDH]]|1.89|0.61|
|[[:human_genes:P:PLEKHG7|PLEKHG7]]|1.90|0.61|
|[[:human_genes:C:CAPRIN2|CAPRIN2]]|1.90|0.61|
|[[:human_genes:A:ARMS2|ARMS2]]|1.90|0.61|
|[[:human_genes:T:TMEM136|TMEM136]]|1.92|0.61|
|[[:human_genes:N:NOL9|NOL9]]|1.96|0.64|
|[[:human_genes:P:PPP1R13L|PPP1R13L]]|1.96|0.61|
|[[:human_genes:E:EMC8|EMC8]]|1.97|0.61|
|[[:human_genes:N:NIPAL2|NIPAL2]]|1.97|0.61|
|[[:human_genes:H:HIST1H2BF|HIST1H2BF]]|1.98|0.63|
|[[:human_genes:D:DAAM1|DAAM1]]|2.00|0.61|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.01|0.77|
|[[:human_genes:S:SEC23IP|SEC23IP]]|2.07|0.61|
|[[:human_genes:C:CEP192|CEP192]]|2.15|0.61|
|[[:human_genes:U:USF2|USF2]]|2.17|0.34|
|[[:human_genes:R:RANGAP1|RANGAP1]]|2.18|0.61|
|[[:human_genes:S:SF3B5|SF3B5]]|2.19|0.61|
|[[:human_genes:U:UTP20|UTP20]]|2.28|0.61|
|[[:human_genes:S:SPNS3|SPNS3]]|2.28|0.24|
|[[:human_genes:H:HRH2|HRH2]]|2.30|0.24|
|[[:human_genes:D:DDX41|DDX41]]|2.37|0.27|
|[[:human_genes:C:CCDC135|CCDC135]]|2.39|0.19|
|[[:human_genes:P:PMM1|PMM1]]|2.49|0.19|
|[[:human_genes:D:DNTTIP2|DNTTIP2]]|2.57|0.19|
|[[:human_genes:P:PAFAH1B1|PAFAH1B1]]|2.58|0.63|
|[[:human_genes:A:ANO5|ANO5]]|2.76|0.08|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>