Nicotinamide 1000μM R03 exp101 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Nicotinamide 1000μM R03 exp101 ======
==== Mechanism of Action ====
NAD biosynthetic precursor, activates SIRT1
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nicotinamide%%
    * **<color #00a2e8>Synonyms:</color>** Niacinamide; Nicotinic acid amide; Vitamin B3
    * **<color #00a2e8>CAS #:</color>** 98-92-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/936|936]]
    * **<color #00a2e8>IUPAC:</color>** %%pyridine-3-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9)
    * **<color #00a2e8>INCHI Key:</color>** DFPAKSUCGFBDDF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 122.12
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CN=C1)C(=O)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C6H6N2O
{{:chemogenomics:structures:chem-0030.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** N3376
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C6H6N2O 123.05529; found 123.05387
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** NICOTINAMIDE-N3376
    * **<color #00a2e8>Min:</color>** -12.6284; **<color #00a2e8>Max:</color>** 19.5781
{{:chemogenomics:dose_response:dr_102.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 1000µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.9
    * **<color #00a2e8>Numbers of reads</color>**: 10766702


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nicotinamide_1000uM_Round-3_exp101.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nicotinamide 1000μM R03 exp101'>
{{:chemogenomics:cranks_plots:exp101.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NFKBIA|NFKBIA]]|-2.67|0.13|
|[[:human_genes:P:PHACTR2|PHACTR2]]|-2.39|0.41|
|[[:human_genes:S:SEMA3F|SEMA3F]]|-2.37|0.41|
|[[:human_genes:G:GNL3|GNL3]]|-2.34|0.66|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.33|0.82|
|[[:human_genes:F:FASTKD5|FASTKD5]]|-2.32|0.74|
|[[:human_genes:C:CTPS1|CTPS1]]|-2.29|0.76|
|[[:human_genes:V:VPS25|VPS25]]|-2.26|0.76|
|[[:human_genes:K:KDSR|KDSR]]|-2.25|0.41|
|[[:human_genes:K:KCNIP1|KCNIP1]]|-2.21|0.48|
|[[:human_genes:G:GATAD2B|GATAD2B]]|-2.17|0.46|
|[[:human_genes:C:CBFB|CBFB]]|-2.16|0.46|
|[[:human_genes:E:ERMARD|ERMARD]]|-2.10|0.48|
|[[:human_genes:N:NRROS|NRROS]]|-2.10|0.48|
|[[:human_genes:G:GCLC|GCLC]]|-2.07|0.65|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.06|0.76|
|[[:human_genes:U:USP17L13|USP17L13]]|-2.05|0.48|
|[[:human_genes:S:SLCO1B7|SLCO1B7]]|-2.05|0.48|
|[[:human_genes:C:CCT5|CCT5]]|-2.00|0.76|
|[[:human_genes:G:GOLGA3|GOLGA3]]|-1.99|0.61|
|[[:human_genes:C:COX15|COX15]]|-1.99|0.76|
|[[:human_genes:S:SIAH2|SIAH2]]|-1.95|0.65|
|[[:human_genes:E:EPHB4|EPHB4]]|-1.93|0.74|
|[[:human_genes:M:MYH3|MYH3]]|-1.93|0.74|
|[[:human_genes:P:PRRX2|PRRX2]]|-1.92|0.66|
|[[:human_genes:A:ALG12|ALG12]]|-1.92|0.74|
|[[:human_genes:M:MDGA1|MDGA1]]|-1.91|0.66|
|[[:human_genes:H:HNRNPCL1|HNRNPCL1]]|-1.89|0.84|
|[[:human_genes:R:RCBTB2|RCBTB2]]|-1.89|0.74|
|[[:human_genes:L:LCE1F|LCE1F]]|-1.88|0.69|
|[[:human_genes:Z:ZCCHC4|ZCCHC4]]|1.94|0.62|
|[[:human_genes:T:TLR6|TLR6]]|1.94|0.62|
|[[:human_genes:G:GGA3|GGA3]]|1.95|0.62|
|[[:human_genes:Z:ZNF428|ZNF428]]|1.95|0.62|
|[[:human_genes:T:TCTE3|TCTE3]]|1.95|0.62|
|[[:human_genes:M:MFAP1|MFAP1]]|1.95|0.62|
|[[:human_genes:W:WNK1|WNK1]]|1.96|0.62|
|[[:human_genes:T:TAS2R50|TAS2R50]]|1.97|0.62|
|[[:human_genes:O:OR5P3|OR5P3]]|1.97|0.62|
|[[:human_genes:M:MRPL46|MRPL46]]|1.97|0.62|
|[[:human_genes:T:TMC7|TMC7]]|1.98|0.62|
|[[:human_genes:Z:ZNF816|ZNF816]]|2.06|0.62|
|[[:human_genes:F:FAM69A|FAM69A]]|2.10|0.62|
|[[:human_genes:R:RPS19|RPS19]]|2.11|0.62|
|[[:human_genes:F:FIBCD1|FIBCD1]]|2.11|0.62|
|[[:human_genes:P:PSMA1|PSMA1]]|2.14|0.62|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.14|0.71|
|[[:human_genes:P:PSMD11|PSMD11]]|2.15|0.62|
|[[:human_genes:P:POLE2|POLE2]]|2.16|0.62|
|[[:human_genes:S:SMU1|SMU1]]|2.19|0.64|
|[[:human_genes:R:RBM39|RBM39]]|2.19|0.73|
|[[:human_genes:F:FGD4|FGD4]]|2.21|0.62|
|[[:human_genes:P:PLK4|PLK4]]|2.23|0.62|
|[[:human_genes:L:LOC643802|LOC643802]]|2.26|0.62|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|2.37|0.62|
|[[:human_genes:R:RFC1|RFC1]]|2.47|0.62|
|[[:human_genes:A:ANKRD40|ANKRD40]]|2.57|0.62|
|[[:human_genes:U:USP17L19|USP17L19]]|2.58|0.62|
|[[:human_genes:S:SHFM1|SHFM1]]|2.59|0.62|
|[[:human_genes:C:CDK12|CDK12]]|2.61|0.62|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp150|SGC0649 7μM R03 exp150]]|0.056|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp457|Bisphenol F 50μM R08 exp457]]|0.059|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp16|DABN 2μM R00 exp16]]|0.057|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp237|NN-Diethyl-meta-toluamide 100μM R05 exp237]]|0.052|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp132|Metformin 40μM R03 exp132]]|0.051|<button type="primary" size="small" modal="5">View</button>|
</modal>


<modal id="1" size="lg" title="Nicotinamide 1000μM R03 exp101  vs  SGC0649 7μM R03 exp150">
{{:chemogenomics:comparison_plots:exp101_vs_exp150.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Bisphenol F 50μM R08 exp457  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp457.png?nolink |}}
</modal>

<modal id="3" size="lg" title="DABN 2μM R00 exp16  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp16.png?nolink |}}
</modal>

<modal id="4" size="lg" title="NN-Diethyl-meta-toluamide 100μM R05 exp237  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp237.png?nolink |}}
</modal>

<modal id="5" size="lg" title="Metformin 40μM R03 exp132  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp132.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>