A-196 10μM R03 exp114 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== A-196 10μM R03 exp114 ======
==== Mechanism of Action ====
Inhibits SUV420H1 and SUV420H2 inhibitor, blocks di/trimethylation of H4K20me
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%6,7-Dichloro-N-cyclopentyl-4-(pyridin-4-yl)phthalazin-1-amine%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1982372-88-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/117072548|117072548]]
    * **<color #00a2e8>IUPAC:</color>** %%6,7-dichloro-N-cyclopentyl-4-pyridin-4-ylphthalazin-1-amine%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C18H16Cl2N4/c19-15-9-13-14(10-16(15)20)18(22-12-3-1-2-4-12)24-23-17(13)11-5-7-21-8-6-11/h5-10,12H,1-4H2,(H,22,24)
    * **<color #00a2e8>INCHI Key:</color>** ABGOSOMRWSYAOB-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 359.2
    * **<color #00a2e8>Canonical SMILES:</color>** C1CCC(C1)NC2=NN=C(C3=CC(=C(C=C32)Cl)Cl)C4=CC=NC=C4
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C18H16Cl2N4
{{:chemogenomics:structures:chem-0070.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Structural Genomics Consortium
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C18H16Cl2N4 359.08248; found 359.08319
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** A-196
    * **<color #00a2e8>Min:</color>** 0.0245; **<color #00a2e8>Max:</color>** 32.4348
{{:chemogenomics:dose_response:dr_62.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |11.6475    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.5
    * **<color #00a2e8>Numbers of reads</color>**: 10046263


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|4/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/A-196_10uM_Round-3_exp114.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='A-196 10μM R03 exp114'>
{{:chemogenomics:cranks_plots:exp114.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC5A3|SLC5A3]]|-3.90|<0.01|
|[[:human_genes:S:SLC7A5|SLC7A5]]|-3.17|<0.01|
|[[:human_genes:A:ALG13|ALG13]]|-2.90|0.03|
|[[:human_genes:F:FLVCR1|FLVCR1]]|-2.84|0.02|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.53|0.22|
|[[:human_genes:K:KCNC3|KCNC3]]|-2.46|0.14|
|[[:human_genes:S:SLC52A2|SLC52A2]]|-2.44|0.11|
|[[:human_genes:E:ENO1|ENO1]]|-2.41|0.21|
|[[:human_genes:F:FAM122A|FAM122A]]|-2.37|0.13|
|[[:human_genes:C:CHKA|CHKA]]|-2.36|0.13|
|[[:human_genes:G:GCLC|GCLC]]|-2.29|0.21|
|[[:human_genes:C:COL21A1|COL21A1]]|-2.28|0.21|
|[[:human_genes:S:SYS1|SYS1]]|-2.27|0.28|
|[[:human_genes:K:KIAA0020|KIAA0020]]|-2.27|0.28|
|[[:human_genes:M:MRPL4|MRPL4]]|-2.24|0.21|
|[[:human_genes:D:DMRTA2|DMRTA2]]|-2.23|0.21|
|[[:human_genes:K:KRTAP10-4|KRTAP10-4]]|-2.22|0.44|
|[[:human_genes:C:C6orf136|C6orf136]]|-2.21|0.21|
|[[:human_genes:E:ERVFRD-1|ERVFRD-1]]|-2.14|0.21|
|[[:human_genes:A:ALAD|ALAD]]|-2.13|0.28|
|[[:human_genes:S:SLC31A2|SLC31A2]]|-2.13|0.21|
|[[:human_genes:S:SNF8|SNF8]]|-2.13|0.28|
|[[:human_genes:P:PTPRN2|PTPRN2]]|-2.11|0.21|
|[[:human_genes:H:HMGCS2|HMGCS2]]|-2.10|0.21|
|[[:human_genes:V:VMO1|VMO1]]|-2.10|0.21|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.06|0.34|
|[[:human_genes:P:PIK3CD|PIK3CD]]|-2.04|0.36|
|[[:human_genes:B:BOLA3|BOLA3]]|-2.00|0.28|
|[[:human_genes:A:ARID4B|ARID4B]]|-1.97|0.44|
|[[:human_genes:P:PCDHB11|PCDHB11]]|-1.97|0.32|
|[[:human_genes:E:EXOSC8|EXOSC8]]|2.00|0.48|
|[[:human_genes:Z:ZDHHC2|ZDHHC2]]|2.04|0.43|
|[[:human_genes:G:GPR19|GPR19]]|2.04|0.43|
|[[:human_genes:F:FLI1|FLI1]]|2.06|0.43|
|[[:human_genes:N:NUP88|NUP88]]|2.07|0.55|
|[[:human_genes:B:BCL2A1|BCL2A1]]|2.08|0.43|
|[[:human_genes:S:SLC8B1|SLC8B1]]|2.09|0.43|
|[[:human_genes:R:RPL18|RPL18]]|2.09|0.76|
|[[:human_genes:S:SART3|SART3]]|2.09|0.60|
|[[:human_genes:D:DIEXF|DIEXF]]|2.09|0.43|
|[[:human_genes:O:OR51E2|OR51E2]]|2.10|0.43|
|[[:human_genes:I:ISCU|ISCU]]|2.11|0.76|
|[[:human_genes:O:OGDH|OGDH]]|2.11|0.51|
|[[:human_genes:F:FAM217A|FAM217A]]|2.12|0.43|
|[[:human_genes:M:MASTL|MASTL]]|2.12|0.60|
|[[:human_genes:B:BRCA1|BRCA1]]|2.14|0.43|
|[[:human_genes:V:VPRBP|VPRBP]]|2.15|0.59|
|[[:human_genes:R:ROBO1|ROBO1]]|2.17|0.43|
|[[:human_genes:C:CRYBB1|CRYBB1]]|2.19|0.43|
|[[:human_genes:N:NUP160|NUP160]]|2.24|0.43|
|[[:human_genes:P:POLD3|POLD3]]|2.27|0.70|
|[[:human_genes:L:LUC7L3|LUC7L3]]|2.28|0.51|
|[[:human_genes:P:PCDHGA9|PCDHGA9]]|2.30|0.42|
|[[:human_genes:U:UTP20|UTP20]]|2.32|0.48|
|[[:human_genes:Z:ZNF852|ZNF852]]|2.41|0.43|
|[[:human_genes:O:OR10H4|OR10H4]]|2.41|0.34|
|[[:human_genes:P:PATZ1|PATZ1]]|2.43|0.43|
|[[:human_genes:C:CFAP45|CFAP45]]|2.51|0.52|
|[[:human_genes:T:TMEM184C|TMEM184C]]|2.67|0.34|
|[[:human_genes:D:DNM2|DNM2]]|2.68|0.59|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.071|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="A-196 10μM R03 exp114  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp114_vs_exp149.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>