Quinacrine 2.5μM R03 exp146 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Quinacrine 2.5μM R03 exp146 ======
==== Mechanism of Action ====
Intercalates into DNA and RNA, interferes with transcription and translation
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antimalarial
  * **<color #00a2e8>Class / Subclass 2:</color>** DNA Damage, Repair and Replication / Intercalating Agent



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Quinacrine dihydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** Mepacrine (dihydrochloride); SN-390 (dihydrochloride)
    * **<color #00a2e8>CAS #:</color>** 69-05-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/6239|6239]]
    * **<color #00a2e8>IUPAC:</color>** %%4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C23H30ClN3O.2ClH/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23;;/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);2*1H
    * **<color #00a2e8>INCHI Key:</color>** UDKVBVICMUEIKS-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 472.9
    * **<color #00a2e8>Canonical SMILES:</color>** CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.Cl.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C23H32Cl3N3O
{{:chemogenomics:structures:chem-0097.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** Q3251
    * **<color #00a2e8>Lot #:</color>** BCBN9703V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C23H30ClN3O 400.21502; found 400.21557
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** QUINACRINE
    * **<color #00a2e8>Min:</color>** 0.8074; **<color #00a2e8>Max:</color>** 98.8966
{{:chemogenomics:dose_response:dr_113.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |1.9289    |
| IC30  |2.3830    |
| IC40  |2.8339    |
| IC50  |3.3224    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 2.5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.4
    * **<color #00a2e8>Numbers of reads</color>**: 12378658


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Quinacrine_2.5uM_Round-3_exp146.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Quinacrine 2.5μM R03 exp146'>
{{:chemogenomics:cranks_plots:exp146.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:T:TCF4|TCF4]]|-2.62|0.23|
|[[:human_genes:T:TPT1|TPT1]]|-2.47|0.23|
|[[:human_genes:T:TCOF1|TCOF1]]|-2.38|0.23|
|[[:human_genes:S:SLC7A6|SLC7A6]]|-2.33|0.23|
|[[:human_genes:V:VAC14|VAC14]]|-2.31|0.23|
|[[:human_genes:C:CDK6|CDK6]]|-2.31|0.23|
|[[:human_genes:K:KAT7|KAT7]]|-2.28|0.23|
|[[:human_genes:D:DPH1|DPH1]]|-2.25|0.23|
|[[:human_genes:F:FIGNL1|FIGNL1]]|-2.21|0.23|
|[[:human_genes:T:THY1|THY1]]|-2.19|0.23|
|[[:human_genes:M:MSI2|MSI2]]|-2.18|0.23|
|[[:human_genes:C:C17orf67|C17orf67]]|-2.16|0.23|
|[[:human_genes:C:CHD5|CHD5]]|-2.14|0.24|
|[[:human_genes:I:ITGA3|ITGA3]]|-2.14|0.35|
|[[:human_genes:J:JAGN1|JAGN1]]|-2.13|0.42|
|[[:human_genes:G:GPR137C|GPR137C]]|-2.11|0.42|
|[[:human_genes:P:POLR1B|POLR1B]]|-2.11|0.58|
|[[:human_genes:K:KIF18A|KIF18A]]|-2.11|0.35|
|[[:human_genes:M:MAPKAPK5|MAPKAPK5]]|-2.07|0.33|
|[[:human_genes:H:HGC6.3|HGC6.3]]|-2.07|0.73|
|[[:human_genes:T:TMEM30A|TMEM30A]]|-2.05|0.33|
|[[:human_genes:S:SKP2|SKP2]]|-2.05|0.33|
|[[:human_genes:G:GPN3|GPN3]]|-2.04|0.33|
|[[:human_genes:S:SPATA5|SPATA5]]|-2.03|0.44|
|[[:human_genes:S:SCNN1A|SCNN1A]]|-2.01|0.35|
|[[:human_genes:M:MAB21L3|MAB21L3]]|-2.00|0.35|
|[[:human_genes:K:KPNA3|KPNA3]]|-1.99|0.42|
|[[:human_genes:M:MINK1|MINK1]]|-1.98|0.42|
|[[:human_genes:A:AQP12A|AQP12A]]|-1.97|0.58|
|[[:human_genes:V:VIPAS39|VIPAS39]]|-1.96|0.42|
|[[:human_genes:O:OR6C1|OR6C1]]|2.00|0.44|
|[[:human_genes:R:RPGR|RPGR]]|2.00|0.44|
|[[:human_genes:N:NPAS2|NPAS2]]|2.01|0.36|
|[[:human_genes:P:PP2D1|PP2D1]]|2.01|0.36|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.01|0.66|
|[[:human_genes:P:PPP2R4|PPP2R4]]|2.02|0.36|
|[[:human_genes:N:NEK1|NEK1]]|2.05|0.41|
|[[:human_genes:C:COPZ1|COPZ1]]|2.05|0.64|
|[[:human_genes:P:PRKAA1|PRKAA1]]|2.06|0.36|
|[[:human_genes:S:SCAF11|SCAF11]]|2.07|0.49|
|[[:human_genes:G:GPR183|GPR183]]|2.11|0.36|
|[[:human_genes:F:FAM72C|FAM72C]]|2.12|0.71|
|[[:human_genes:M:MRPL33|MRPL33]]|2.12|0.64|
|[[:human_genes:P:PLEKHA5|PLEKHA5]]|2.13|0.31|
|[[:human_genes:C:CCT8|CCT8]]|2.15|0.57|
|[[:human_genes:F:FAM172A|FAM172A]]|2.17|0.36|
|[[:human_genes:G:GABARAPL1|GABARAPL1]]|2.18|0.25|
|[[:human_genes:C:COA6|COA6]]|2.19|0.25|
|[[:human_genes:F:FAM98B|FAM98B]]|2.22|0.35|
|[[:human_genes:H:HPRT1|HPRT1]]|2.23|0.37|
|[[:human_genes:E:EIF3E|EIF3E]]|2.28|0.44|
|[[:human_genes:H:HMGB2|HMGB2]]|2.30|0.16|
|[[:human_genes:H:HTATIP2|HTATIP2]]|2.32|0.16|
|[[:human_genes:F:FAM13B|FAM13B]]|2.41|0.14|
|[[:human_genes:C:CXCL10|CXCL10]]|2.43|0.14|
|[[:human_genes:H:HEATR3|HEATR3]]|2.50|0.16|
|[[:human_genes:X:XPO7|XPO7]]|2.51|0.12|
|[[:human_genes:N:NEURL4|NEURL4]]|2.62|0.10|
|[[:human_genes:R:RPL11|RPL11]]|2.69|0.36|
|[[:human_genes:T:TP53|TP53]]|3.37|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>