SB202190 10μM R03 exp148 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== SB202190 10μM R03 exp148 ======
==== Mechanism of Action ====
Inhibits p38‘± (MAPK14)and p38‘_ (MAPK11) kinase, ATP competitive
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Kinase Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%4-(4-Fluorophenyl)-2-(4-hydroxyphenyl)-5-(4-pyridyl)imidazole%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 152121-30-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5169|5169]]
    * **<color #00a2e8>IUPAC:</color>** %%4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]phenol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H14FN3O/c21-16-5-1-13(2-6-16)18-19(14-9-11-22-12-10-14)24-20(23-18)15-3-7-17(25)8-4-15/h1-12,25H,(H,23,24)
    * **<color #00a2e8>INCHI Key:</color>** QHKYPYXTTXKZST-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 331.3
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CC=C1C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F)O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H14FN3O
{{:chemogenomics:structures:chem-0099.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S1077
    * **<color #00a2e8>Lot #:</color>** 01
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C20H14FN3O 332.11937; found 332.11933
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** SB202190
    * **<color #00a2e8>Min:</color>** 4.3648; **<color #00a2e8>Max:</color>** 53.7816
{{:chemogenomics:dose_response:dr_119.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |2.7330    |
| IC30  |7.9975    |
| IC40  |19.2844    |
| IC50  |43.2506    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.9
    * **<color #00a2e8>Numbers of reads</color>**: 10145836


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/SB202190_10uM_Round-3_exp148.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='SB202190 10μM R03 exp148'>
{{:chemogenomics:cranks_plots:exp148.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC5A3|SLC5A3]]|-3.94|<0.01|
|[[:human_genes:K:KDSR|KDSR]]|-3.66|<0.01|
|[[:human_genes:Q:QARS|QARS]]|-2.85|0.32|
|[[:human_genes:G:GPR107|GPR107]]|-2.54|0.10|
|[[:human_genes:E:ETV3|ETV3]]|-2.47|0.18|
|[[:human_genes:H:HMBS|HMBS]]|-2.38|0.18|
|[[:human_genes:R:RGP1|RGP1]]|-2.36|0.27|
|[[:human_genes:K:KCNK13|KCNK13]]|-2.33|0.18|
|[[:human_genes:E:EXTL1|EXTL1]]|-2.30|0.49|
|[[:human_genes:A:ALAD|ALAD]]|-2.30|0.21|
|[[:human_genes:S:SUCLA2|SUCLA2]]|-2.26|0.18|
|[[:human_genes:C:CNTNAP5|CNTNAP5]]|-2.26|0.18|
|[[:human_genes:R:RABGGTB|RABGGTB]]|-2.25|0.25|
|[[:human_genes:T:TMEM186|TMEM186]]|-2.25|0.18|
|[[:human_genes:S:SLC47A1|SLC47A1]]|-2.24|0.18|
|[[:human_genes:M:MOCS3|MOCS3]]|-2.24|0.31|
|[[:human_genes:S:SLC38A1|SLC38A1]]|-2.20|0.20|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.16|0.21|
|[[:human_genes:A:ANKRD36B|ANKRD36B]]|-2.12|0.30|
|[[:human_genes:R:RUNDC1|RUNDC1]]|-2.08|0.27|
|[[:human_genes:A:ATP5H|ATP5H]]|-2.07|0.27|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.06|0.28|
|[[:human_genes:F:FECH|FECH]]|-2.04|0.29|
|[[:human_genes:N:NUDT22|NUDT22]]|-2.02|0.46|
|[[:human_genes:W:WDR20|WDR20]]|-2.02|0.30|
|[[:human_genes:S:SAFB|SAFB]]|-2.01|0.35|
|[[:human_genes:Z:ZDHHC23|ZDHHC23]]|-2.01|0.30|
|[[:human_genes:C:CCDC47|CCDC47]]|-2.01|0.30|
|[[:human_genes:C:C6orf118|C6orf118]]|-2.00|0.54|
|[[:human_genes:P:PABPC1L|PABPC1L]]|-2.00|0.46|
|[[:human_genes:P:PFN2|PFN2]]|1.92|0.56|
|[[:human_genes:Z:ZNF791|ZNF791]]|1.92|0.56|
|[[:human_genes:N:NUP133|NUP133]]|1.92|0.56|
|[[:human_genes:A:ASH1L|ASH1L]]|1.93|0.56|
|[[:human_genes:T:TIMM44|TIMM44]]|1.94|0.63|
|[[:human_genes:C:CLEC1B|CLEC1B]]|1.95|0.56|
|[[:human_genes:R:RGL3|RGL3]]|1.96|0.56|
|[[:human_genes:A:ATRX|ATRX]]|1.97|0.56|
|[[:human_genes:G:GLTSCR2|GLTSCR2]]|1.99|0.64|
|[[:human_genes:T:TCERG1|TCERG1]]|2.00|0.60|
|[[:human_genes:P:PES1|PES1]]|2.01|0.63|
|[[:human_genes:T:TRIM49B|TRIM49B]]|2.02|0.56|
|[[:human_genes:A:ANKRD55|ANKRD55]]|2.03|0.56|
|[[:human_genes:P:PSMB7|PSMB7]]|2.03|0.56|
|[[:human_genes:C:CNOT4|CNOT4]]|2.03|0.50|
|[[:human_genes:A:ARRDC3|ARRDC3]]|2.05|0.56|
|[[:human_genes:M:MIA2|MIA2]]|2.09|0.50|
|[[:human_genes:W:WNT5A|WNT5A]]|2.11|0.50|
|[[:human_genes:I:IPPK|IPPK]]|2.13|0.50|
|[[:human_genes:E:ERG|ERG]]|2.14|0.50|
|[[:human_genes:G:GGA3|GGA3]]|2.16|0.50|
|[[:human_genes:T:TMEM232|TMEM232]]|2.21|0.50|
|[[:human_genes:A:APBA1|APBA1]]|2.27|0.50|
|[[:human_genes:F:FDPS|FDPS]]|2.29|0.50|
|[[:human_genes:M:MMP15|MMP15]]|2.29|0.45|
|[[:human_genes:S:SUGT1|SUGT1]]|2.29|0.56|
|[[:human_genes:I:IDE|IDE]]|2.34|0.50|
|[[:human_genes:N:NOP16|NOP16]]|2.39|0.74|
|[[:human_genes:R:RPS23|RPS23]]|2.44|0.28|
|[[:human_genes:M:MAPK1|MAPK1]]|2.49|0.28|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.054|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="SB202190 10μM R03 exp148  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp148_vs_exp149.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|protein geranylgeranyltransferase activity|318.83|RABGGTB,PGGT1B|
|protein geranylgeranylation|255.06|RABGGTB,PGGT1B|
|protoporphyrinogen IX metabolic process|191.30|HMBS,ALAD,FECH|
|porphyrin-containing compound biosynthetic process|91.09|HMBS,ALAD,SUCLA2,FECH|
|tetrapyrrole biosynthetic process|91.09|HMBS,ALAD,SUCLA2,FECH|
|heme biosynthetic process|76.52|HMBS,ALAD,FECH|
|porphyrin-containing compound metabolic process|55.45|HMBS,ALAD,SUCLA2,FECH|
|tetrapyrrole metabolic process|47.23|HMBS,ALAD,SUCLA2,FECH|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>