Cycloheximide 0.02μM R00 exp14 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Cycloheximide 0.02μM R00 exp14 ======
==== Mechanism of Action ====
Translation elongation inhibitor, binds 60S ribosomal subunit
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Translation Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Environmental Stresses / Toxin



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Cycloheximide%%
    * **<color #00a2e8>Synonyms:</color>** Naramycin A; Actidione; CHX
    * **<color #00a2e8>CAS #:</color>** 66-81-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/6197|6197]]
    * **<color #00a2e8>IUPAC:</color>** %%4-[(2R)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** YPHMISFOHDHNIV-FSZOTQKASA-N
    * **<color #00a2e8>Molecular Weight:</color>** 281.35
    * **<color #00a2e8>Canonical SMILES:</color>** CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H]1C[C@@H](C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O)C
    * **<color #00a2e8>Molecular Formula:</color>** C15H23NO4
{{:chemogenomics:structures:chem-0008.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** C7698
    * **<color #00a2e8>Lot #:</color>** MKBR7146V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C15H23NO4 282.16998; found 282.17004
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Cycloheximide
    * **<color #00a2e8>Min:</color>** 3.7773; **<color #00a2e8>Max:</color>** 80.9065
{{:chemogenomics:dose_response:dr_261.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.1270    |
| IC30  |0.3675    |
| IC40  |0.8782    |
| IC50  |1.9535    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 20nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.5
    * **<color #00a2e8>Numbers of reads</color>**: 10420892


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/2|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Cycloheximide_0.02uM_Round-0_exp14.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Cycloheximide 0.02μM R00 exp14'>
{{:chemogenomics:cranks_plots:exp14.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:C:CEP57|CEP57]]|-2.60|0.31|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-2.42|0.31|
|[[:human_genes:O:ORC3|ORC3]]|-2.36|0.33|
|[[:human_genes:A:ADK|ADK]]|-2.36|0.31|
|[[:human_genes:D:DKC1|DKC1]]|-2.34|0.51|
|[[:human_genes:P:PEX7|PEX7]]|-2.27|0.31|
|[[:human_genes:C:CTC1|CTC1]]|-2.27|0.31|
|[[:human_genes:C:CXorf56|CXorf56]]|-2.27|0.31|
|[[:human_genes:W:WDSUB1|WDSUB1]]|-2.25|0.31|
|[[:human_genes:M:MT3|MT3]]|-2.15|0.31|
|[[:human_genes:L:LMO2|LMO2]]|-2.14|0.31|
|[[:human_genes:L:LRRIQ4|LRRIQ4]]|-2.11|0.31|
|[[:human_genes:A:ACSL4|ACSL4]]|-2.11|0.31|
|[[:human_genes:N:NSFL1C|NSFL1C]]|-2.11|0.31|
|[[:human_genes:P:POC1A|POC1A]]|-2.08|0.46|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.06|0.48|
|[[:human_genes:S:SOX7|SOX7]]|-2.05|0.46|
|[[:human_genes:Z:ZFYVE20|ZFYVE20]]|-2.04|0.48|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-2.04|0.39|
|[[:human_genes:H:H2AFV|H2AFV]]|-2.03|0.39|
|[[:human_genes:C:CUL2|CUL2]]|-2.02|0.47|
|[[:human_genes:O:ODF4|ODF4]]|-1.99|0.48|
|[[:human_genes:O:OR2W1|OR2W1]]|-1.99|0.46|
|[[:human_genes:M:MVD|MVD]]|-1.98|0.48|
|[[:human_genes:A:ASB3|ASB3]]|-1.97|0.46|
|[[:human_genes:C:CHST6|CHST6]]|-1.95|0.46|
|[[:human_genes:C:COX5A|COX5A]]|-1.95|0.48|
|[[:human_genes:H:HOXA7|HOXA7]]|-1.94|0.46|
|[[:human_genes:E:ELFN2|ELFN2]]|-1.93|0.46|
|[[:human_genes:R:RTCB|RTCB]]|-1.93|0.53|
|[[:human_genes:A:ANP32E|ANP32E]]|2.08|0.29|
|[[:human_genes:C:CREB3|CREB3]]|2.08|0.29|
|[[:human_genes:O:OCIAD1|OCIAD1]]|2.13|0.24|
|[[:human_genes:R:RRM2|RRM2]]|2.15|0.58|
|[[:human_genes:C:CKAP5|CKAP5]]|2.17|0.52|
|[[:human_genes:N:NGLY1|NGLY1]]|2.18|0.23|
|[[:human_genes:C:CSE1L|CSE1L]]|2.22|0.33|
|[[:human_genes:R:RPL8|RPL8]]|2.24|0.56|
|[[:human_genes:N:NDC80|NDC80]]|2.24|0.51|
|[[:human_genes:Z:ZNF829|ZNF829]]|2.28|0.24|
|[[:human_genes:Z:ZNF675|ZNF675]]|2.30|0.23|
|[[:human_genes:P:PSMD6|PSMD6]]|2.31|0.29|
|[[:human_genes:T:TMEM184C|TMEM184C]]|2.32|0.23|
|[[:human_genes:A:AKR1C4|AKR1C4]]|2.32|0.14|
|[[:human_genes:N:NFE2L2|NFE2L2]]|2.33|0.14|
|[[:human_genes:R:RBM39|RBM39]]|2.37|0.54|
|[[:human_genes:L:LRRC31|LRRC31]]|2.38|0.14|
|[[:human_genes:Z:ZNF514|ZNF514]]|2.39|0.14|
|[[:human_genes:C:COPB2|COPB2]]|2.42|0.29|
|[[:human_genes:P:PSMA1|PSMA1]]|2.45|0.31|
|[[:human_genes:T:TNPO3|TNPO3]]|2.49|0.44|
|[[:human_genes:P:POLE|POLE]]|2.50|0.44|
|[[:human_genes:E:EXT2|EXT2]]|2.53|0.11|
|[[:human_genes:F:FAM160A1|FAM160A1]]|2.54|0.14|
|[[:human_genes:P:PSMC3|PSMC3]]|2.65|0.29|
|[[:human_genes:A:AQR|AQR]]|2.71|0.23|
|[[:human_genes:K:KIF11|KIF11]]|2.76|0.46|
|[[:human_genes:P:PSMD1|PSMD1]]|2.78|0.29|
|[[:human_genes:R:RRP15|RRP15]]|2.99|0.02|
|[[:human_genes:N:NOL10|NOL10]]|3.10|0.04|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp23|Nocodazole 0.02μM R00 exp23]]|0.08|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp27|Pimelic-diphenylamide-106 0.5μM R00 exp27]]|0.065|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp16|DABN 2μM R00 exp16]]|0.062|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp11|CCCP 1μM R00 exp11]]|0.06|<button type="primary" size="small" modal="4">View</button>|
</modal>


<modal id="1" size="lg" title="Cycloheximide 0.02μM R00 exp14  vs  Nocodazole 0.02μM R00 exp23">
{{:chemogenomics:comparison_plots:exp14_vs_exp23.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Cycloheximide 0.02μM R00 exp14  vs  Pimelic-diphenylamide-106 0.5μM R00 exp27">
{{:chemogenomics:comparison_plots:exp14_vs_exp27.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Cycloheximide 0.02μM R00 exp14  vs  DABN 2μM R00 exp16">
{{:chemogenomics:comparison_plots:exp14_vs_exp16.png?nolink |}}
</modal>

<modal id="4" size="lg" title="CCCP 1μM R00 exp11  vs  Cycloheximide 0.02μM R00 exp14">
{{:chemogenomics:comparison_plots:exp11_vs_exp14.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|proteasome regulatory particle|92.12|PSMD1,PSMC3,PSMD6|
</modal>