Dimethyloxaloylglycine 100μM R05 exp229 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Dimethyloxaloylglycine 100μM R05 exp229 ======
==== Mechanism of Action ====
Prolylhydroxylase inhibitor, induces HIF-1α accumulation
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Other inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Dimethyloxalylglycine%%
    * **<color #00a2e8>Synonyms:</color>** Dimethyloxallyl Glycine
    * **<color #00a2e8>CAS #:</color>** 89464-63-1
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/560326|560326]]
    * **<color #00a2e8>IUPAC:</color>** %%methyl 2-[(2-methoxy-2-oxoethyl)amino]-2-oxoacetate%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C6H9NO5/c1-11-4(8)3-7-5(9)6(10)12-2/h3H2,1-2H3,(H,7,9)
    * **<color #00a2e8>INCHI Key:</color>** BNJOZDZCRHCODO-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 175.14
    * **<color #00a2e8>Canonical SMILES:</color>** COC(=O)CNC(=O)C(=O)OC
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C6H9NO5
{{:chemogenomics:structures:chem-0134.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** D476325
    * **<color #00a2e8>Lot #:</color>** 5-RUS-16-1
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C6H9NO5 176.05535; found 176.05545
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** DMOG
    * **<color #00a2e8>Min:</color>** -17.0009; **<color #00a2e8>Max:</color>** 8.0792
{{:chemogenomics:dose_response:dr_209.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 05
    * **<color #00a2e8>Dose</color>**: 100µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.8
    * **<color #00a2e8>Numbers of reads</color>**: 15365092


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|15/17|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Dimethyloxaloylglycine_100uM_Round-5_exp229.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Dimethyloxaloylglycine 100μM R05 exp229'>
{{:chemogenomics:cranks_plots:exp229.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:A:ABCC4|ABCC4]]|-4.25|<0.01|
|[[:human_genes:Z:ZBTB10|ZBTB10]]|-3.58|<0.01|
|[[:human_genes:E:EGLN1|EGLN1]]|-3.32|<0.01|
|[[:human_genes:E:EIF3H|EIF3H]]|-3.14|<0.01|
|[[:human_genes:D:DERL2|DERL2]]|-3.12|<0.01|
|[[:human_genes:L:LYL1|LYL1]]|-2.97|<0.01|
|[[:human_genes:G:GCLC|GCLC]]|-2.91|0.01|
|[[:human_genes:R:RBM15|RBM15]]|-2.90|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-2.79|<0.01|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.72|0.19|
|[[:human_genes:S:SCAF8|SCAF8]]|-2.69|0.01|
|[[:human_genes:G:GCLM|GCLM]]|-2.46|0.04|
|[[:human_genes:R:RNMT|RNMT]]|-2.45|0.04|
|[[:human_genes:I:IREB2|IREB2]]|-2.45|0.04|
|[[:human_genes:C:CDKN2B|CDKN2B]]|-2.42|0.04|
|[[:human_genes:A:ALG9|ALG9]]|-2.41|0.04|
|[[:human_genes:S:SPTY2D1|SPTY2D1]]|-2.31|0.07|
|[[:human_genes:S:STT3A|STT3A]]|-2.28|0.21|
|[[:human_genes:U:USP17L19|USP17L19]]|-2.27|0.42|
|[[:human_genes:Z:ZMYM2|ZMYM2]]|-2.26|0.09|
|[[:human_genes:M:MC2R|MC2R]]|-2.26|0.09|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.25|0.30|
|[[:human_genes:C:CCDC101|CCDC101]]|-2.21|0.19|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.18|0.13|
|[[:human_genes:V:VPS25|VPS25]]|-2.16|0.47|
|[[:human_genes:M:MOCS3|MOCS3]]|-2.14|0.21|
|[[:human_genes:D:DNAJB11|DNAJB11]]|-2.13|0.16|
|[[:human_genes:N:NPTN|NPTN]]|-2.12|0.17|
|[[:human_genes:M:MAP2K5|MAP2K5]]|-2.10|0.18|
|[[:human_genes:S:SHOC2|SHOC2]]|-2.08|0.24|
|[[:human_genes:U:UCHL5|UCHL5]]|2.25|0.07|
|[[:human_genes:Z:ZC3HAV1|ZC3HAV1]]|2.28|0.06|
|[[:human_genes:T:TFDP1|TFDP1]]|2.28|0.16|
|[[:human_genes:R:RBM38|RBM38]]|2.30|0.05|
|[[:human_genes:U:UCN3|UCN3]]|2.31|0.05|
|[[:human_genes:R:RING1|RING1]]|2.31|0.09|
|[[:human_genes:M:MEMO1|MEMO1]]|2.32|0.05|
|[[:human_genes:N:NFRKB|NFRKB]]|2.33|0.05|
|[[:human_genes:P:PCGF1|PCGF1]]|2.35|0.05|
|[[:human_genes:A:ACLY|ACLY]]|2.39|0.07|
|[[:human_genes:S:SPC24|SPC24]]|2.44|0.47|
|[[:human_genes:G:GTF2A1|GTF2A1]]|2.46|0.05|
|[[:human_genes:M:MAEA|MAEA]]|2.48|0.02|
|[[:human_genes:T:TSC1|TSC1]]|2.49|0.02|
|[[:human_genes:N:NDUFS2|NDUFS2]]|2.52|0.07|
|[[:human_genes:H:HMG20A|HMG20A]]|2.55|0.02|
|[[:human_genes:M:ME2|ME2]]|2.61|0.02|
|[[:human_genes:P:PHF14|PHF14]]|2.70|<0.01|
|[[:human_genes:C:CLPP|CLPP]]|2.90|<0.01|
|[[:human_genes:O:OTUB1|OTUB1]]|2.99|<0.01|
|[[:human_genes:T:TMEM30A|TMEM30A]]|3.15|<0.01|
|[[:human_genes:Y:YPEL5|YPEL5]]|3.16|<0.01|
|[[:human_genes:U:UBE2H|UBE2H]]|3.23|<0.01|
|[[:human_genes:S:SCAP|SCAP]]|3.29|<0.01|
|[[:human_genes:F:FBXL5|FBXL5]]|3.50|<0.01|
|[[:human_genes:S:SNX27|SNX27]]|3.55|<0.01|
|[[:human_genes:A:ARNT|ARNT]]|6.65|<0.01|
|[[:human_genes:H:HIF1A|HIF1A]]|6.72|<0.01|
|[[:human_genes:S:SLC16A7|SLC16A7]]|6.82|<0.01|
|[[:human_genes:N:NIT2|NIT2]]|7.77|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp30|Rapamycin 10μM R00 exp30]]|0.064|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp429|Rapamycin 0.001μM R08 exp429]]|0.06|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp216|Erlotinib 10μM R05 exp216]]|0.053|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="Dimethyloxaloylglycine 100μM R05 exp229  vs  Rapamycin 10μM R00 exp30">
{{:chemogenomics:comparison_plots:exp229_vs_exp30.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Dimethyloxaloylglycine 100μM R05 exp229  vs  Rapamycin 0.001μM R08 exp429">
{{:chemogenomics:comparison_plots:exp229_vs_exp429.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Dimethyloxaloylglycine 100μM R05 exp229  vs  Erlotinib 10μM R05 exp216">
{{:chemogenomics:comparison_plots:exp216_vs_exp229.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>