Parthenolide 2.5μM R05 exp238 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Parthenolide 2.5μM R05 exp238 ======
==== Mechanism of Action ====
Sesquiterpene lactone with attributed activities in microtubule function, NF-κB activation, HDAC1 inhibition, MDM2 ubiquitination. Parthenolide is a sesquiterpene lactone found in the medicinal herb Feverfew
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Microtubule Poison
  * **<color #00a2e8>Class / Subclass 2:</color>** Uncharacterized Mechanism / Natural Product
  * **<color #00a2e8>Class / Subclass 3:</color>** Signal Transduction / Apoptosis Inducer


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(-)-Parthenolide%%
    * **<color #00a2e8>Synonyms:</color>** (-)-Parthenolide
    * **<color #00a2e8>CAS #:</color>** 20554-84-1
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/7251185|7251185]]
    * **<color #00a2e8>IUPAC:</color>** %%(1S,2R,4R,7E,11S)-4,8-dimethyl-12-methylidene-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C15H20O3/c1-9-5-4-8-15(3)13(18-15)12-11(7-6-9)10(2)14(16)17-12/h5,11-13H,2,4,6-8H2,1,3H3/b9-5+/t11-,12-,13+,15+/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** KTEXNACQROZXEV-PVLRGYAZSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 248.32
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=CCCC2(C(O2)C3C(CC1)C(=C)C(=O)O3)C
    * **<color #00a2e8>Isomeric SMILES:</color>** C/C/1=C\\CC[C@@]2([C@H](O2)[C@@H]3[C@@H](CC1)C(=C)C(=O)O3)C
    * **<color #00a2e8>Molecular Formula:</color>** C15H20O3
{{:chemogenomics:structures:chem-0143.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Tocris Bioscience
    * **<color #00a2e8>Catalog #:</color>** 0610
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C15H20O3 249.14852; found 249.14835
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Parthenolide
    * **<color #00a2e8>Min:</color>** 5.0270; **<color #00a2e8>Max:</color>** 99.5981
{{:chemogenomics:dose_response:dr_271.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |2.2034    |
| IC30  |2.4548    |
| IC40  |2.6822    |
| IC50  |2.9093    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 05
    * **<color #00a2e8>Dose</color>**: 2.5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.3
    * **<color #00a2e8>Numbers of reads</color>**: 25053361


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Parthenolide_2.5uM_Round-5_exp238.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Parthenolide 2.5μM R05 exp238'>
{{:chemogenomics:cranks_plots:exp238.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KIF18A|KIF18A]]|-3.31|<0.01|
|[[:human_genes:T:TUBB|TUBB]]|-2.66|0.10|
|[[:human_genes:E:ENO1|ENO1]]|-2.60|0.07|
|[[:human_genes:S:SREK1|SREK1]]|-2.59|0.07|
|[[:human_genes:R:RPE|RPE]]|-2.57|0.10|
|[[:human_genes:R:ROCK2|ROCK2]]|-2.55|0.10|
|[[:human_genes:E:EPN1|EPN1]]|-2.52|0.07|
|[[:human_genes:A:ATP2B1|ATP2B1]]|-2.52|0.10|
|[[:human_genes:R:RHOA|RHOA]]|-2.51|0.07|
|[[:human_genes:P:PRKAG1|PRKAG1]]|-2.32|0.10|
|[[:human_genes:A:ANKRD17|ANKRD17]]|-2.31|0.10|
|[[:human_genes:U:UBE2D3|UBE2D3]]|-2.31|0.10|
|[[:human_genes:P:PPP6C|PPP6C]]|-2.27|0.19|
|[[:human_genes:M:MTHFD1|MTHFD1]]|-2.23|0.59|
|[[:human_genes:N:NAP1L1|NAP1L1]]|-2.22|0.21|
|[[:human_genes:M:MBTPS2|MBTPS2]]|-2.20|0.17|
|[[:human_genes:M:MRPS33|MRPS33]]|-2.19|0.30|
|[[:human_genes:T:TBCA|TBCA]]|-2.15|0.19|
|[[:human_genes:I:INTS3|INTS3]]|-2.15|0.55|
|[[:human_genes:N:NPRL2|NPRL2]]|-2.14|0.19|
|[[:human_genes:R:RAD1|RAD1]]|-2.13|0.19|
|[[:human_genes:T:TRMT5|TRMT5]]|-2.11|0.27|
|[[:human_genes:P:PAPD5|PAPD5]]|-2.10|0.27|
|[[:human_genes:T:TCF4|TCF4]]|-2.09|0.21|
|[[:human_genes:H:HOXC9|HOXC9]]|-2.08|0.28|
|[[:human_genes:L:LY6G6C|LY6G6C]]|-2.08|0.21|
|[[:human_genes:P:POLK|POLK]]|-2.08|0.21|
|[[:human_genes:S:ST20|ST20]]|-2.07|0.69|
|[[:human_genes:H:HABP4|HABP4]]|-2.05|0.24|
|[[:human_genes:S:SLC34A1|SLC34A1]]|-2.03|0.30|
|[[:human_genes:H:HK1|HK1]]|2.07|0.36|
|[[:human_genes:C:CCR2|CCR2]]|2.07|0.36|
|[[:human_genes:N:NPIPA5|NPIPA5]]|2.07|0.62|
|[[:human_genes:P:PPP2R1B|PPP2R1B]]|2.08|0.36|
|[[:human_genes:U:UBE2Q2L|UBE2Q2L]]|2.09|0.66|
|[[:human_genes:I:IKZF2|IKZF2]]|2.11|0.36|
|[[:human_genes:C:CACNA1S|CACNA1S]]|2.11|0.36|
|[[:human_genes:M:MICU1|MICU1]]|2.12|0.36|
|[[:human_genes:C:C15orf32|C15orf32]]|2.13|0.36|
|[[:human_genes:A:ARRDC3|ARRDC3]]|2.16|0.36|
|[[:human_genes:P:PEX11G|PEX11G]]|2.17|0.36|
|[[:human_genes:D:DTL|DTL]]|2.18|0.49|
|[[:human_genes:O:OR7A17|OR7A17]]|2.18|0.36|
|[[:human_genes:A:AHCTF1|AHCTF1]]|2.21|0.36|
|[[:human_genes:S:SCG2|SCG2]]|2.21|0.36|
|[[:human_genes:M:MBIP|MBIP]]|2.21|0.36|
|[[:human_genes:R:RPL30|RPL30]]|2.23|0.71|
|[[:human_genes:B:BRD4|BRD4]]|2.23|0.45|
|[[:human_genes:P:POLE3|POLE3]]|2.26|0.36|
|[[:human_genes:P:PSMD1|PSMD1]]|2.27|0.36|
|[[:human_genes:I:ISCU|ISCU]]|2.29|0.62|
|[[:human_genes:S:SF3B3|SF3B3]]|2.38|0.49|
|[[:human_genes:S:SNRNP200|SNRNP200]]|2.39|0.36|
|[[:human_genes:C:CDC73|CDC73]]|2.45|0.36|
|[[:human_genes:C:C1QTNF9B|C1QTNF9B]]|2.46|0.24|
|[[:human_genes:C:CDCA8|CDCA8]]|2.56|0.50|
|[[:human_genes:M:MDH1|MDH1]]|2.73|0.10|
|[[:human_genes:C:CSNK1A1|CSNK1A1]]|2.85|0.35|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|3.00|0.49|
|[[:human_genes:P:POLR2L|POLR2L]]|3.42|0.36|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>