UM0130462 0.025 to 0.035μM day4 R05 exp247 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== UM0130462 0.025 to 0.035μM day4 R05 exp247 ======
==== Mechanism of Action ====
Unknown
  * **<color #00a2e8>Class / Subclass 1:</color>** Uncharacterized Mechanism / Chemical Screen Hit




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%1-Chloro-2-(2-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 166671-24-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/373493|373493]]
    * **<color #00a2e8>IUPAC:</color>** %%1-chloro-2-(2-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C15H11Cl2N3/c1-9-10(6-7-16)14(17)20-13-5-3-2-4-12(13)19-15(20)11(9)8-18/h2-5H,6-7H2,1H3
    * **<color #00a2e8>INCHI Key:</color>** FUFPNFLKYVGOQV-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 304.17
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=C(C2=NC3=CC=CC=C3N2C(=C1CCCl)Cl)C#N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C15H11N3Cl2
{{:chemogenomics:structures:chem-0151.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** In house - University of Montreal - Chemistry Platform
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** IRIC-009 / JFL-2177-020 / Batch #01
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C15H11Cl2N3 304.04028; found 304.0396
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** UM0130462
    * **<color #00a2e8>Min:</color>** 28.7491; **<color #00a2e8>Max:</color>** 99.0794
{{:chemogenomics:dose_response:dr_135.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |0.0107    |
| IC40  |0.0169    |
| IC50  |0.0256    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 05
    * **<color #00a2e8>Dose</color>**: 0.025-0.035µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.4
    * **<color #00a2e8>Numbers of reads</color>**: 20933112


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/UM0130462_0.025-0.035day4uM_Round-5_exp247.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='UM0130462 0.025 to 0.035μM day4 R05 exp247'>
{{:chemogenomics:cranks_plots:exp247.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:R:RSRC2|RSRC2]]|-3.49|0.08|
|[[:human_genes:A:ASB3|ASB3]]|-2.71|0.08|
|[[:human_genes:V:VPS25|VPS25]]|-2.71|0.52|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.63|0.29|
|[[:human_genes:P:PEX7|PEX7]]|-2.59|0.08|
|[[:human_genes:O:OR52N5|OR52N5]]|-2.49|0.09|
|[[:human_genes:P:PDAP1|PDAP1]]|-2.34|0.19|
|[[:human_genes:T:TCF4|TCF4]]|-2.31|0.19|
|[[:human_genes:N:NPRL2|NPRL2]]|-2.25|0.23|
|[[:human_genes:A:AGPAT2|AGPAT2]]|-2.25|0.51|
|[[:human_genes:Z:ZNHIT1|ZNHIT1]]|-2.19|0.29|
|[[:human_genes:A:ACSL4|ACSL4]]|-2.15|0.29|
|[[:human_genes:M:METTL14|METTL14]]|-2.14|0.51|
|[[:human_genes:S:S100A5|S100A5]]|-2.12|0.30|
|[[:human_genes:F:FGFR1|FGFR1]]|-2.11|0.30|
|[[:human_genes:I:ILF3|ILF3]]|-2.05|0.66|
|[[:human_genes:R:RTCB|RTCB]]|-2.04|0.66|
|[[:human_genes:Z:ZNF488|ZNF488]]|-2.01|0.63|
|[[:human_genes:A:ACYP2|ACYP2]]|-1.99|0.51|
|[[:human_genes:D:DHPS|DHPS]]|-1.99|0.51|
|[[:human_genes:A:ALDH18A1|ALDH18A1]]|-1.98|0.51|
|[[:human_genes:T:TMEM185B|TMEM185B]]|-1.97|0.51|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-1.97|0.51|
|[[:human_genes:G:GEMIN8|GEMIN8]]|-1.96|0.63|
|[[:human_genes:N:NCCRP1|NCCRP1]]|-1.96|0.51|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-1.95|0.51|
|[[:human_genes:N:NLK|NLK]]|-1.94|0.67|
|[[:human_genes:P:PPIL4|PPIL4]]|-1.94|0.57|
|[[:human_genes:B:BASP1|BASP1]]|-1.93|0.64|
|[[:human_genes:S:SECISBP2|SECISBP2]]|-1.93|0.64|
|[[:human_genes:L:LRRC10B|LRRC10B]]|1.92|0.60|
|[[:human_genes:R:RPL35|RPL35]]|1.93|0.60|
|[[:human_genes:C:CRYBB3|CRYBB3]]|1.93|0.60|
|[[:human_genes:E:EIF2B5|EIF2B5]]|1.95|0.60|
|[[:human_genes:R:RPL30|RPL30]]|1.96|0.74|
|[[:human_genes:C:CCDC93|CCDC93]]|1.97|0.60|
|[[:human_genes:T:TRAPPC2L|TRAPPC2L]]|1.97|0.60|
|[[:human_genes:C:CKAP5|CKAP5]]|1.98|0.63|
|[[:human_genes:N:NUP93|NUP93]]|1.99|0.63|
|[[:human_genes:Z:ZC3HAV1L|ZC3HAV1L]]|1.99|0.60|
|[[:human_genes:C:CDCA8|CDCA8]]|1.99|0.69|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|2.00|0.63|
|[[:human_genes:P:POLE|POLE]]|2.04|0.63|
|[[:human_genes:H:HOXD11|HOXD11]]|2.05|0.55|
|[[:human_genes:C:CDH24|CDH24]]|2.06|0.60|
|[[:human_genes:S:SNX17|SNX17]]|2.07|0.55|
|[[:human_genes:S:SART1|SART1]]|2.08|0.63|
|[[:human_genes:F:FAM111A|FAM111A]]|2.08|0.55|
|[[:human_genes:N:NABP2|NABP2]]|2.09|0.55|
|[[:human_genes:T:TMEM207|TMEM207]]|2.11|0.55|
|[[:human_genes:M:MED28|MED28]]|2.11|0.60|
|[[:human_genes:P:PRPF31|PRPF31]]|2.11|0.60|
|[[:human_genes:C:C1orf204|C1orf204]]|2.11|0.55|
|[[:human_genes:C:C16orf89|C16orf89]]|2.24|0.48|
|[[:human_genes:U:USP17L19|USP17L19]]|2.26|0.63|
|[[:human_genes:F:FAM47E|FAM47E]]|2.32|0.48|
|[[:human_genes:C:CACNA1S|CACNA1S]]|2.37|0.48|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.58|0.48|
|[[:human_genes:X:XAB2|XAB2]]|2.69|0.63|
|[[:human_genes:M:MARVELD1|MARVELD1]]|2.84|0.60|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp187|proTAME 5μM R04 exp187]]|0.052|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp239|PFI-2 4μM R05 exp239]]|0.062|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp177|Apcin 25μM plus proTAME 2μM R04 exp177]]|0.057|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="UM0130462 0.025 to 0.035μM day4 R05 exp247  vs  proTAME 5μM R04 exp187">
{{:chemogenomics:comparison_plots:exp187_vs_exp247.png?nolink |}}
</modal>

<modal id="2" size="lg" title="PFI-2 4μM R05 exp239  vs  UM0130462 0.025 to 0.035μM day4 R05 exp247">
{{:chemogenomics:comparison_plots:exp239_vs_exp247.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Apcin 25μM plus proTAME 2μM R04 exp177  vs  UM0130462 0.025 to 0.035μM day4 R05 exp247">
{{:chemogenomics:comparison_plots:exp177_vs_exp247.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>