ABT-702 0.1μM R06 exp260 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== ABT-702 0.1μM R06 exp260 ======
==== Mechanism of Action ====
Inhibits adenosine kinase (ADK)
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Adenosine Kinase Inhibitor%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1188890-28-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/16760265|16760265]]
    * **<color #00a2e8>IUPAC:</color>** %%5-(3-bromophenyl)-7-(6-morpholin-4-ylpyridin-3-yl)pyrido[2,3-d]pyrimidin-4-amine;dihydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C22H19BrN6O.2ClH/c23-16-3-1-2-14(10-16)17-11-18(28-22-20(17)21(24)26-13-27-22)15-4-5-19(25-12-15)29-6-8-30-9-7-29;;/h1-5,10-13H,6-9H2,(H2,24,26,27,28);2*1H
    * **<color #00a2e8>INCHI Key:</color>** OOXNYFKPOPJIOT-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 536.2
    * **<color #00a2e8>Canonical SMILES:</color>** C1COCCN1C2=NC=C(C=C2)C3=NC4=NC=NC(=C4C(=C3)C5=CC(=CC=C5)Br)N.Cl.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C22H21BrCl2N6O
{{:chemogenomics:structures:chem-0155.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Tocris Bioscience
    * **<color #00a2e8>Catalog #:</color>** 2372
    * **<color #00a2e8>Lot #:</color>** 1B/195137
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C22H19BrN6O 463.08765; found 463.08744
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** ABT-702
    * **<color #00a2e8>Min:</color>** -17.1478; **<color #00a2e8>Max:</color>** 50.6783
{{:chemogenomics:dose_response:dr_281.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |27.2987    |
| IC30  |35.4200    |
| IC40  |43.8496    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 100nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 7476948


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/ABT-702_0.1uM_Round-6_exp260.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='ABT-702 0.1μM R06 exp260'>
{{:chemogenomics:cranks_plots:exp260.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DARS2|DARS2]]|-2.53|0.89|
|[[:human_genes:H:HOXD8|HOXD8]]|-2.34|0.89|
|[[:human_genes:C:CDC26|CDC26]]|-2.17|0.89|
|[[:human_genes:R:RNMT|RNMT]]|-1.99|0.89|
|[[:human_genes:A:ACBD3|ACBD3]]|-1.99|0.89|
|[[:human_genes:C:CEP164|CEP164]]|-1.99|0.89|
|[[:human_genes:S:SDHA|SDHA]]|-1.98|0.89|
|[[:human_genes:M:MRPS25|MRPS25]]|-1.96|0.89|
|[[:human_genes:M:MAT1A|MAT1A]]|-1.95|0.89|
|[[:human_genes:P:PHPT1|PHPT1]]|-1.95|0.89|
|[[:human_genes:T:TRMT2A|TRMT2A]]|-1.92|0.89|
|[[:human_genes:B:BRSK1|BRSK1]]|-1.92|0.89|
|[[:human_genes:S:SPATA2L|SPATA2L]]|-1.89|0.89|
|[[:human_genes:C:CCDC43|CCDC43]]|-1.88|0.89|
|[[:human_genes:G:GATSL1|GATSL1]]|-1.87|0.89|
|[[:human_genes:S:SP100|SP100]]|-1.86|0.89|
|[[:human_genes:R:ROCK2|ROCK2]]|-1.86|0.89|
|[[:human_genes:R:RTFDC1|RTFDC1]]|-1.85|0.89|
|[[:human_genes:T:TAS2R9|TAS2R9]]|-1.84|0.89|
|[[:human_genes:P:PAX1|PAX1]]|-1.84|0.89|
|[[:human_genes:I:IL18RAP|IL18RAP]]|-1.84|0.89|
|[[:human_genes:C:C6orf136|C6orf136]]|-1.83|0.89|
|[[:human_genes:O:OSTC|OSTC]]|-1.82|0.89|
|[[:human_genes:T:THG1L|THG1L]]|-1.82|0.89|
|[[:human_genes:P:PCDHB15|PCDHB15]]|-1.82|0.89|
|[[:human_genes:T:TADA1|TADA1]]|-1.81|0.89|
|[[:human_genes:S:SAMD9|SAMD9]]|-1.81|0.89|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.80|0.89|
|[[:human_genes:D:DNAJC13|DNAJC13]]|-1.79|0.89|
|[[:human_genes:P:POLM|POLM]]|-1.79|0.89|
|[[:human_genes:C:CCDC150|CCDC150]]|1.92|0.62|
|[[:human_genes:E:EXOSC8|EXOSC8]]|1.93|0.68|
|[[:human_genes:M:METTL18|METTL18]]|1.93|0.62|
|[[:human_genes:C:CDT1|CDT1]]|1.93|0.71|
|[[:human_genes:M:MICU2|MICU2]]|1.94|0.67|
|[[:human_genes:T:TRIM54|TRIM54]]|1.95|0.62|
|[[:human_genes:A:AGO3|AGO3]]|1.95|0.62|
|[[:human_genes:T:TOR1AIP1|TOR1AIP1]]|1.96|0.66|
|[[:human_genes:S:STX10|STX10]]|1.96|0.62|
|[[:human_genes:U:UGT2B7|UGT2B7]]|1.97|0.62|
|[[:human_genes:A:AP3M1|AP3M1]]|1.97|0.62|
|[[:human_genes:U:UBTD2|UBTD2]]|1.98|0.62|
|[[:human_genes:U:UQCRH|UQCRH]]|1.99|0.63|
|[[:human_genes:D:DHX38|DHX38]]|2.03|0.67|
|[[:human_genes:A:ANP32B|ANP32B]]|2.04|0.62|
|[[:human_genes:A:ADPRHL2|ADPRHL2]]|2.04|0.62|
|[[:human_genes:A:ATG9A|ATG9A]]|2.05|0.62|
|[[:human_genes:R:RACGAP1|RACGAP1]]|2.07|0.66|
|[[:human_genes:Z:ZNF91|ZNF91]]|2.08|0.62|
|[[:human_genes:D:DBH|DBH]]|2.08|0.62|
|[[:human_genes:A:ANO5|ANO5]]|2.10|0.66|
|[[:human_genes:D:DONSON|DONSON]]|2.22|0.67|
|[[:human_genes:T:TRAIP|TRAIP]]|2.25|0.67|
|[[:human_genes:H:HCST|HCST]]|2.27|0.58|
|[[:human_genes:Z:ZNF225|ZNF225]]|2.30|0.58|
|[[:human_genes:C:CABLES1|CABLES1]]|2.31|0.63|
|[[:human_genes:C:C5AR1|C5AR1]]|2.31|0.58|
|[[:human_genes:V:VGF|VGF]]|2.38|0.58|
|[[:human_genes:C:C18orf32|C18orf32]]|2.41|0.67|
|[[:human_genes:P:PSMB4|PSMB4]]|2.45|0.58|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>