CHIR-124 0.04μM R06 exp272 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== CHIR-124 0.04μM R06 exp272 ======
==== Mechanism of Action ====
Inhibits CHK1, blocks checkpoint arrest, potentiates DNA damaging agents
  * **<color #00a2e8>Class / Subclass 1:</color>** DNA Damage, Repair and Replication / Checkpoint Signaling Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%4-[(3s)-1-Azabicyclo[2.2.2]oct-3-Ylamino]-3-(1h-Benzimidazol-2-Yl)-6-Chloroquinolin-2(1h)-One%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 405168-58-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/135399748|135399748]]
    * **<color #00a2e8>IUPAC:</color>** %%4-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]amino]-3-(1H-benzimidazol-2-yl)-6-chloro-1H-quinolin-2-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C23H22ClN5O/c24-14-5-6-16-15(11-14)21(25-19-12-29-9-7-13(19)8-10-29)20(23(30)28-16)22-26-17-3-1-2-4-18(17)27-22/h1-6,11,13,19H,7-10,12H2,(H,26,27)(H2,25,28,30)/t19-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** MOVBBVMDHIRCTG-LJQANCHMSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 419.9
    * **<color #00a2e8>Canonical SMILES:</color>** C1CN2CCC1C(C2)NC3=C(C(=O)NC4=C3C=C(C=C4)Cl)C5=NC6=CC=CC=C6N5
    * **<color #00a2e8>Isomeric SMILES:</color>** C1CN2CCC1[C@@H](C2)NC3=C(C(=O)NC4=C3C=C(C=C4)Cl)C5=NC6=CC=CC=C6N5
    * **<color #00a2e8>Molecular Formula:</color>** C23H22ClN5O
{{:chemogenomics:structures:chem-0164.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-13263
    * **<color #00a2e8>Lot #:</color>** 10573
</panel>


<panel title='Compound Characterization' collapsed='true'>
Characterization data not available.
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** CHIR-124
    * **<color #00a2e8>Min:</color>** 10.7944; **<color #00a2e8>Max:</color>** 99.8850
{{:chemogenomics:dose_response:dr_316.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |0.0221    |
| IC40  |N/A    |
| IC50  |0.0515    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 40nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.3
    * **<color #00a2e8>Numbers of reads</color>**: 9391802


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/CHIR-124_0.04uM_Round-6_exp272.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='CHIR-124 0.04μM R06 exp272'>
{{:chemogenomics:cranks_plots:exp272.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:P:PRPS1|PRPS1]]|-3.21|0.06|
|[[:human_genes:T:TMEM135|TMEM135]]|-2.53|0.12|
|[[:human_genes:M:MRI1|MRI1]]|-2.51|0.12|
|[[:human_genes:A:ABCC12|ABCC12]]|-2.34|0.31|
|[[:human_genes:N:NPAP1|NPAP1]]|-2.26|0.45|
|[[:human_genes:M:MLKL|MLKL]]|-2.25|0.31|
|[[:human_genes:G:GOT2|GOT2]]|-2.20|0.31|
|[[:human_genes:G:GTF3C1|GTF3C1]]|-2.20|0.47|
|[[:human_genes:Z:ZSCAN26|ZSCAN26]]|-2.19|0.31|
|[[:human_genes:E:EMC2|EMC2]]|-2.18|0.31|
|[[:human_genes:O:OGT|OGT]]|-2.17|0.83|
|[[:human_genes:C:CCP110|CCP110]]|-2.16|0.31|
|[[:human_genes:C:CD72|CD72]]|-2.14|0.45|
|[[:human_genes:S:SLC19A2|SLC19A2]]|-2.12|0.35|
|[[:human_genes:A:ATIC|ATIC]]|-2.09|0.66|
|[[:human_genes:U:UPF2|UPF2]]|-2.07|0.83|
|[[:human_genes:A:APH1A|APH1A]]|-2.05|0.47|
|[[:human_genes:O:ONECUT2|ONECUT2]]|-2.05|0.44|
|[[:human_genes:S:SIN3B|SIN3B]]|-2.05|0.44|
|[[:human_genes:U:USP35|USP35]]|-2.04|0.83|
|[[:human_genes:C:CDC37|CDC37]]|-2.03|0.70|
|[[:human_genes:A:ATP6V0A1|ATP6V0A1]]|-2.03|0.47|
|[[:human_genes:C:C11orf57|C11orf57]]|-2.03|0.45|
|[[:human_genes:G:GTF2F2|GTF2F2]]|-2.02|0.47|
|[[:human_genes:G:GYS2|GYS2]]|-2.00|0.45|
|[[:human_genes:F:FH|FH]]|-1.98|0.66|
|[[:human_genes:R:RNMT|RNMT]]|-1.97|0.46|
|[[:human_genes:U:UBE2J1|UBE2J1]]|-1.97|0.46|
|[[:human_genes:C:COG2|COG2]]|-1.95|0.66|
|[[:human_genes:C:CBX3|CBX3]]|-1.93|0.47|
|[[:human_genes:C:CACNA2D3|CACNA2D3]]|1.90|0.58|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|1.91|0.83|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|1.91|0.83|
|[[:human_genes:P:POLA1|POLA1]]|1.91|0.78|
|[[:human_genes:C:CYP2A13|CYP2A13]]|1.92|0.58|
|[[:human_genes:C:CDK5RAP2|CDK5RAP2]]|1.92|0.58|
|[[:human_genes:S:SNX8|SNX8]]|1.93|0.58|
|[[:human_genes:R:RSRC2|RSRC2]]|1.97|0.82|
|[[:human_genes:A:ATP6V0D1|ATP6V0D1]]|1.98|0.58|
|[[:human_genes:C:CKAP5|CKAP5]]|2.00|0.74|
|[[:human_genes:C:CLEC4G|CLEC4G]]|2.01|0.57|
|[[:human_genes:E:ELFN2|ELFN2]]|2.02|0.57|
|[[:human_genes:A:ATP6AP1|ATP6AP1]]|2.02|0.71|
|[[:human_genes:A:ADAM19|ADAM19]]|2.02|0.58|
|[[:human_genes:Z:ZNF101|ZNF101]]|2.03|0.57|
|[[:human_genes:P:PLRG1|PLRG1]]|2.07|0.58|
|[[:human_genes:T:THOC2|THOC2]]|2.08|0.71|
|[[:human_genes:R:RGS19|RGS19]]|2.14|0.46|
|[[:human_genes:A:ANP32A|ANP32A]]|2.18|0.42|
|[[:human_genes:B:BYSL|BYSL]]|2.19|0.58|
|[[:human_genes:R:RHCG|RHCG]]|2.21|0.50|
|[[:human_genes:I:IGBP1|IGBP1]]|2.23|0.71|
|[[:human_genes:G:GFRA4|GFRA4]]|2.23|0.39|
|[[:human_genes:P:PLA1A|PLA1A]]|2.29|0.34|
|[[:human_genes:P:POLR2A|POLR2A]]|2.29|0.58|
|[[:human_genes:R:REN|REN]]|2.36|0.31|
|[[:human_genes:K:KRTAP10-12|KRTAP10-12]]|2.54|0.31|
|[[:human_genes:P:PSMD11|PSMD11]]|2.56|0.50|
|[[:human_genes:C:CDC45|CDC45]]|2.58|0.58|
|[[:human_genes:R:RBM28|RBM28]]|2.65|0.16|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|fumarate metabolic process|613.78|GOT2,FH|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>