Curcumin 6.5μM R06 exp277 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Curcumin 6.5μM R06 exp277 ======
==== Mechanism of Action ====
Component of tumeric spice, many claimed activities but viewed as pan-assay interference compound
  * **<color #00a2e8>Class / Subclass 1:</color>** Uncharacterized Mechanism / Natural Product
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Nutraceutical



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Curcumin%%
    * **<color #00a2e8>Synonyms:</color>** Turmeric yellow; Natural Yellow 3; Diferuloylmethane
    * **<color #00a2e8>CAS #:</color>** 458-37-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/969516|969516]]
    * **<color #00a2e8>IUPAC:</color>** %%(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+
    * **<color #00a2e8>INCHI Key:</color>** VFLDPWHFBUODDF-FCXRPNKRSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 368.4
    * **<color #00a2e8>Canonical SMILES:</color>** COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O
    * **<color #00a2e8>Isomeric SMILES:</color>** COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O
    * **<color #00a2e8>Molecular Formula:</color>** IC21H20O6
{{:chemogenomics:structures:chem-0167.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** 238384
    * **<color #00a2e8>Lot #:</color>** CW2318MW
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C21H20O6 369.13326; found 369.13368
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Curcumin
    * **<color #00a2e8>Min:</color>** -8.9938; **<color #00a2e8>Max:</color>** 98.5043
{{:chemogenomics:dose_response:dr_324.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |9.9199    |
| IC30  |10.6220    |
| IC40  |11.2344    |
| IC50  |11.8275    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 6.5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.4
    * **<color #00a2e8>Numbers of reads</color>**: 8501108


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Curcumin_6.5uM_Round-6_exp277.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Curcumin 6.5μM R06 exp277'>
{{:chemogenomics:cranks_plots:exp277.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NGLY1|NGLY1]]|-2.72|0.10|
|[[:human_genes:P:PCBP2|PCBP2]]|-2.58|0.10|
|[[:human_genes:Z:ZRANB2|ZRANB2]]|-2.54|0.10|
|[[:human_genes:S:SHOC2|SHOC2]]|-2.39|0.27|
|[[:human_genes:A:ADIPOR2|ADIPOR2]]|-2.35|0.23|
|[[:human_genes:M:MRPS11|MRPS11]]|-2.29|0.26|
|[[:human_genes:E:EYA1|EYA1]]|-2.21|0.45|
|[[:human_genes:M:MSI2|MSI2]]|-2.19|0.34|
|[[:human_genes:T:TSPAN10|TSPAN10]]|-2.17|0.50|
|[[:human_genes:R:RNF39|RNF39]]|-2.16|0.34|
|[[:human_genes:S:SIN3A|SIN3A]]|-2.12|0.48|
|[[:human_genes:C:C12orf74|C12orf74]]|-2.07|0.45|
|[[:human_genes:W:WDR20|WDR20]]|-2.06|0.45|
|[[:human_genes:A:ANKRD13C|ANKRD13C]]|-2.04|0.55|
|[[:human_genes:D:DNAJC6|DNAJC6]]|-2.03|0.48|
|[[:human_genes:C:CCDC41|CCDC41]]|-2.03|0.50|
|[[:human_genes:F:FMR1|FMR1]]|-2.02|0.50|
|[[:human_genes:N:NCOR1|NCOR1]]|-2.01|0.48|
|[[:human_genes:L:LOC100505679|LOC100505679]]|-2.01|0.89|
|[[:human_genes:W:WDR66|WDR66]]|-2.00|0.67|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-1.98|0.48|
|[[:human_genes:K:KDSR|KDSR]]|-1.97|0.48|
|[[:human_genes:P:PDCL|PDCL]]|-1.97|0.48|
|[[:human_genes:S:SGPL1|SGPL1]]|-1.96|0.48|
|[[:human_genes:P:PKD2L2|PKD2L2]]|-1.92|0.50|
|[[:human_genes:A:ANAPC11|ANAPC11]]|-1.91|0.74|
|[[:human_genes:M:MKX|MKX]]|-1.90|0.50|
|[[:human_genes:S:SSU72|SSU72]]|-1.90|0.55|
|[[:human_genes:C:CCDC15|CCDC15]]|-1.89|0.50|
|[[:human_genes:A:ARHGEF4|ARHGEF4]]|-1.89|0.50|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|1.89|0.86|
|[[:human_genes:T:TEX10|TEX10]]|1.89|0.66|
|[[:human_genes:A:APMAP|APMAP]]|1.91|0.65|
|[[:human_genes:M:MS4A8|MS4A8]]|1.93|0.62|
|[[:human_genes:P:PSMC3|PSMC3]]|1.93|0.84|
|[[:human_genes:N:NUDT11|NUDT11]]|1.94|0.66|
|[[:human_genes:A:AURKB|AURKB]]|1.95|0.86|
|[[:human_genes:Z:ZNF221|ZNF221]]|1.96|0.56|
|[[:human_genes:K:KRT10|KRT10]]|2.00|0.52|
|[[:human_genes:M:MAU2|MAU2]]|2.00|0.86|
|[[:human_genes:C:COL28A1|COL28A1]]|2.02|0.66|
|[[:human_genes:S:SH2D1B|SH2D1B]]|2.02|0.50|
|[[:human_genes:U:UBL4A|UBL4A]]|2.02|0.50|
|[[:human_genes:R:RPS10|RPS10]]|2.06|0.47|
|[[:human_genes:P:PSMB3|PSMB3]]|2.09|0.84|
|[[:human_genes:K:KRTAP5-4|KRTAP5-4]]|2.10|0.66|
|[[:human_genes:M:MRPL50|MRPL50]]|2.12|0.45|
|[[:human_genes:Z:ZNF574|ZNF574]]|2.15|0.66|
|[[:human_genes:I:ID4|ID4]]|2.20|0.38|
|[[:human_genes:R:RASAL1|RASAL1]]|2.20|0.47|
|[[:human_genes:P:PRKCZ|PRKCZ]]|2.22|0.38|
|[[:human_genes:S:SLBP|SLBP]]|2.22|0.47|
|[[:human_genes:C:C8orf37|C8orf37]]|2.25|0.38|
|[[:human_genes:N:NDUFB7|NDUFB7]]|2.25|0.52|
|[[:human_genes:P:PSMD3|PSMD3]]|2.28|0.73|
|[[:human_genes:D:DGAT1|DGAT1]]|2.29|0.42|
|[[:human_genes:B:BUD31|BUD31]]|2.39|0.66|
|[[:human_genes:M:MXRA7|MXRA7]]|2.45|0.38|
|[[:human_genes:E:ENOX1|ENOX1]]|2.47|0.38|
|[[:human_genes:H:HMHA1|HMHA1]]|2.64|0.38|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>