Daidzin 10μM R06 exp280 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Daidzin 10μM R06 exp280 ======
==== Mechanism of Action ====
Isoflavone from soy bean, putative ALDH inhibitor
  * **<color #00a2e8>Class / Subclass 1:</color>** Uncharacterized Mechanism / Natural Product
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Metabolic Enzyme Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Daidzin%%
    * **<color #00a2e8>Synonyms:</color>** Daidzoside; NPI-031D; Daidzein 7-O-glucoside
    * **<color #00a2e8>CAS #:</color>** 552-66-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/107971|107971]]
    * **<color #00a2e8>IUPAC:</color>** %%3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** KYQZWONCHDNPDP-QNDFHXLGSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 416.4
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O
    * **<color #00a2e8>Molecular Formula:</color>** C21H20O9
{{:chemogenomics:structures:chem-0170.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** D103530
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C21H20O9 417.11801; found 417.11768
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Daidzin
    * **<color #00a2e8>Min:</color>** -31.6006; **<color #00a2e8>Max:</color>** -7.0783
{{:chemogenomics:dose_response:dr_325.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.1
    * **<color #00a2e8>Numbers of reads</color>**: 7702892


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Daidzin_10uM_Round-6_exp280.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Daidzin 10μM R06 exp280'>
{{:chemogenomics:cranks_plots:exp280.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:V:VPS25|VPS25]]|-3.01|0.57|
|[[:human_genes:Z:ZNHIT6|ZNHIT6]]|-2.44|0.57|
|[[:human_genes:S:STXBP1|STXBP1]]|-2.43|0.41|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.35|0.87|
|[[:human_genes:C:CALML5|CALML5]]|-2.34|0.41|
|[[:human_genes:P:PCYT2|PCYT2]]|-2.30|0.41|
|[[:human_genes:E:EXT1|EXT1]]|-2.25|0.41|
|[[:human_genes:F:FBXW7|FBXW7]]|-2.18|0.57|
|[[:human_genes:U:UBA3|UBA3]]|-2.17|0.64|
|[[:human_genes:T:TRMT61A|TRMT61A]]|-2.13|0.64|
|[[:human_genes:G:GUCA1A|GUCA1A]]|-2.11|0.57|
|[[:human_genes:C:C1orf109|C1orf109]]|-2.10|0.64|
|[[:human_genes:P:PRAMEF21|PRAMEF21]]|-2.09|0.64|
|[[:human_genes:T:TCF4|TCF4]]|-2.08|0.57|
|[[:human_genes:A:ATXN2|ATXN2]]|-2.07|0.64|
|[[:human_genes:M:MCM9|MCM9]]|-2.07|0.64|
|[[:human_genes:P:PDSS1|PDSS1]]|-2.06|0.64|
|[[:human_genes:M:MMP19|MMP19]]|-2.05|0.64|
|[[:human_genes:C:CCT3|CCT3]]|-2.02|0.77|
|[[:human_genes:K:KIDINS220|KIDINS220]]|-1.99|0.64|
|[[:human_genes:A:ADIPOR2|ADIPOR2]]|-1.99|0.64|
|[[:human_genes:P:PSMA2|PSMA2]]|-1.95|0.86|
|[[:human_genes:M:MMP13|MMP13]]|-1.93|0.64|
|[[:human_genes:F:FAM111A|FAM111A]]|-1.93|0.64|
|[[:human_genes:G:GET4|GET4]]|-1.93|0.67|
|[[:human_genes:Z:ZNF585A|ZNF585A]]|-1.92|0.64|
|[[:human_genes:M:MEF2C|MEF2C]]|-1.90|0.64|
|[[:human_genes:E:EXOC8|EXOC8]]|-1.88|0.64|
|[[:human_genes:D:DNAJC13|DNAJC13]]|-1.88|0.64|
|[[:human_genes:K:KDSR|KDSR]]|-1.88|0.64|
|[[:human_genes:D:DONSON|DONSON]]|1.89|0.87|
|[[:human_genes:O:OR10G3|OR10G3]]|1.90|0.75|
|[[:human_genes:R:RPF1|RPF1]]|1.91|0.65|
|[[:human_genes:D:DNM2|DNM2]]|1.92|0.88|
|[[:human_genes:K:KIR3DL2|KIR3DL2]]|1.93|0.65|
|[[:human_genes:L:LRRC7|LRRC7]]|1.93|0.65|
|[[:human_genes:Q:QDPR|QDPR]]|1.95|0.65|
|[[:human_genes:C:CLOCK|CLOCK]]|1.95|0.65|
|[[:human_genes:N:NIP7|NIP7]]|1.95|0.65|
|[[:human_genes:A:ABLIM1|ABLIM1]]|1.97|0.65|
|[[:human_genes:M:MUS81|MUS81]]|1.98|0.75|
|[[:human_genes:P:POLE|POLE]]|1.98|0.85|
|[[:human_genes:S:SUV420H1|SUV420H1]]|1.99|0.73|
|[[:human_genes:A:ARF6|ARF6]]|2.00|0.65|
|[[:human_genes:G:GOLGA6L6|GOLGA6L6]]|2.04|0.75|
|[[:human_genes:K:KANSL1|KANSL1]]|2.07|0.65|
|[[:human_genes:C:CCT2|CCT2]]|2.14|0.82|
|[[:human_genes:S:SPIDR|SPIDR]]|2.17|0.40|
|[[:human_genes:C:C11orf70|C11orf70]]|2.23|0.40|
|[[:human_genes:M:MFSD12|MFSD12]]|2.24|0.48|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|2.26|0.87|
|[[:human_genes:T:TEX10|TEX10]]|2.30|0.40|
|[[:human_genes:R:RFC5|RFC5]]|2.33|0.65|
|[[:human_genes:Z:ZCCHC10|ZCCHC10]]|2.35|0.40|
|[[:human_genes:C:CPEB2|CPEB2]]|2.37|0.75|
|[[:human_genes:C:C18orf32|C18orf32]]|2.41|0.81|
|[[:human_genes:T:TNFRSF25|TNFRSF25]]|2.68|0.12|
|[[:human_genes:X:XPO4|XPO4]]|2.68|0.12|
|[[:human_genes:R:RPL8|RPL8]]|2.69|0.82|
|[[:human_genes:E:E2F8|E2F8]]|2.71|0.12|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.051|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Daidzin 10μM R06 exp280  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp149_vs_exp280.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>