GW501516 25μM R06 exp285 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== GW501516 25μM R06 exp285 ======
==== Mechanism of Action ====
PPARδ receptor agonist, increases metabolism, banned performance enhancer
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Nuclear Receptor Ligand
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Hormone Agonist



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Endurobol%%
    * **<color #00a2e8>Synonyms:</color>** GW 1516; GSK-516
    * **<color #00a2e8>CAS #:</color>** 317318-70-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/9803963|9803963]]
    * **<color #00a2e8>IUPAC:</color>** %%2-[2-methyl-4-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methylsulfanyl]phenoxy]acetic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C21H18F3NO3S2/c1-12-9-16(7-8-17(12)28-10-19(26)27)29-11-18-13(2)25-20(30-18)14-3-5-15(6-4-14)21(22,23)24/h3-9H,10-11H2,1-2H3,(H,26,27)
    * **<color #00a2e8>INCHI Key:</color>** YDBLKRPLXZNVNB-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 453.5
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=C(C=CC(=C1)SCC2=C(N=C(S2)C3=CC=C(C=C3)C(F)(F)F)C)OCC(=O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C21H18F3NO3S2
{{:chemogenomics:structures:chem-0175.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** SML1491
    * **<color #00a2e8>Lot #:</color>** 1798
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C21H18F3NO3S2 454.0753; found 454.0758
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** GW501516
    * **<color #00a2e8>Min:</color>** -11.0338; **<color #00a2e8>Max:</color>** 33.5004
{{:chemogenomics:dose_response:dr_431.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 25µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 8109612


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/GW501516_25uM_Round-6_exp285.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='GW501516 25μM R06 exp285'>
{{:chemogenomics:cranks_plots:exp285.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KDSR|KDSR]]|-3.47|<0.01|
|[[:human_genes:A:AURKB|AURKB]]|-2.70|0.69|
|[[:human_genes:F:FARS2|FARS2]]|-2.52|0.47|
|[[:human_genes:K:KRTAP10-3|KRTAP10-3]]|-2.39|0.69|
|[[:human_genes:N:NME6|NME6]]|-2.26|0.47|
|[[:human_genes:C:C5orf15|C5orf15]]|-2.24|0.47|
|[[:human_genes:V:VPS25|VPS25]]|-2.12|0.79|
|[[:human_genes:Z:ZIC1|ZIC1]]|-2.12|0.69|
|[[:human_genes:H:HDAC4|HDAC4]]|-2.08|0.69|
|[[:human_genes:C:CIC|CIC]]|-2.06|0.69|
|[[:human_genes:G:GCLC|GCLC]]|-2.02|0.69|
|[[:human_genes:T:TTC27|TTC27]]|-2.00|0.69|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.00|0.69|
|[[:human_genes:C:CBFB|CBFB]]|-1.99|0.69|
|[[:human_genes:T:TCF12|TCF12]]|-1.98|0.69|
|[[:human_genes:A:ALG5|ALG5]]|-1.96|0.69|
|[[:human_genes:E:ERCC2|ERCC2]]|-1.96|0.77|
|[[:human_genes:S:SLC29A2|SLC29A2]]|-1.94|0.69|
|[[:human_genes:C:C6orf136|C6orf136]]|-1.94|0.69|
|[[:human_genes:E:EPHA4|EPHA4]]|-1.92|0.69|
|[[:human_genes:M:MRPS18A|MRPS18A]]|-1.92|0.69|
|[[:human_genes:T:TMEM106B|TMEM106B]]|-1.91|0.69|
|[[:human_genes:S:STARD10|STARD10]]|-1.91|0.69|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|-1.90|0.87|
|[[:human_genes:C:CCR9|CCR9]]|-1.88|0.69|
|[[:human_genes:S:SART3|SART3]]|-1.87|0.79|
|[[:human_genes:T:TMC2|TMC2]]|-1.87|0.77|
|[[:human_genes:C:CCNH|CCNH]]|-1.87|0.69|
|[[:human_genes:I:IFNL2|IFNL2]]|-1.87|0.69|
|[[:human_genes:P:PCOLCE2|PCOLCE2]]|-1.86|0.69|
|[[:human_genes:S:SLC16A12|SLC16A12]]|1.93|0.46|
|[[:human_genes:M:MRPS30|MRPS30]]|1.95|0.46|
|[[:human_genes:C:CCND3|CCND3]]|1.96|0.89|
|[[:human_genes:P:PAFAH1B1|PAFAH1B1]]|2.01|0.91|
|[[:human_genes:A:ARG2|ARG2]]|2.01|0.42|
|[[:human_genes:B:BUB1|BUB1]]|2.01|0.42|
|[[:human_genes:C:CDH5|CDH5]]|2.01|0.46|
|[[:human_genes:F:FSIP2|FSIP2]]|2.03|0.46|
|[[:human_genes:P:POTED|POTED]]|2.04|0.42|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|2.09|0.51|
|[[:human_genes:R:RBBP8NL|RBBP8NL]]|2.11|0.42|
|[[:human_genes:D:DDX47|DDX47]]|2.13|0.86|
|[[:human_genes:P:PPP6R1|PPP6R1]]|2.15|0.42|
|[[:human_genes:D:DUSP6|DUSP6]]|2.15|0.41|
|[[:human_genes:S:SKIV2L2|SKIV2L2]]|2.17|0.75|
|[[:human_genes:O:OR4C6|OR4C6]]|2.17|0.41|
|[[:human_genes:D:DHX38|DHX38]]|2.18|0.56|
|[[:human_genes:Z:ZCCHC10|ZCCHC10]]|2.18|0.42|
|[[:human_genes:P:PCBP4|PCBP4]]|2.20|0.42|
|[[:human_genes:C:CDC6|CDC6]]|2.21|0.42|
|[[:human_genes:P:PSMB8|PSMB8]]|2.21|0.41|
|[[:human_genes:P:POLD2|POLD2]]|2.27|0.63|
|[[:human_genes:E:EIF3G|EIF3G]]|2.27|0.41|
|[[:human_genes:K:KMT2D|KMT2D]]|2.34|0.41|
|[[:human_genes:C:CLEC4M|CLEC4M]]|2.36|0.41|
|[[:human_genes:K:KANSL1|KANSL1]]|2.36|0.41|
|[[:human_genes:P:PPP5C|PPP5C]]|2.51|0.35|
|[[:human_genes:C:CDT1|CDT1]]|2.53|0.46|
|[[:human_genes:R:RPL37|RPL37]]|2.55|0.62|
|[[:human_genes:K:KAT8|KAT8]]|2.61|0.46|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>