A-769662 20μM R07 exp331 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== A-769662 20μM R07 exp331 ======
==== Mechanism of Action ====
Activates AMP-activated protein kinase (AMPK), allosteric
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Kinase Activator




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%4-Hydroxy-3-(2'-hydroxy-1,1'-biphenyl-4-yl)-6-oxo-6,7-dihydrothieno[2,3-b]pyridine-5-carbonitrile%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 844499-71-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/54708532|54708532]]
    * **<color #00a2e8>IUPAC:</color>** %%4-hydroxy-3-[4-(2-hydroxyphenyl)phenyl]-6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H12N2O3S/c21-9-14-18(24)17-15(10-26-20(17)22-19(14)25)12-7-5-11(6-8-12)13-3-1-2-4-16(13)23/h1-8,10,23H,(H2,22,24,25)
    * **<color #00a2e8>INCHI Key:</color>** CTESJDQKVOEUOY-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 360.4
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC=C(C(=C1)C2=CC=C(C=C2)C3=CSC4=C3C(=C(C(=O)N4)C#N)O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H12N2O3S
{{:chemogenomics:structures:chem-0190.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Ark Pharm Inc.
    * **<color #00a2e8>Catalog #:</color>** AK117003
    * **<color #00a2e8>Lot #:</color>** YF0167194-170704001
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C20H12N2O3S 361.06414; found 361.06413
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** A-769662
    * **<color #00a2e8>Min:</color>** -18.4953; **<color #00a2e8>Max:</color>** 18.9840
{{:chemogenomics:dose_response:dr_369.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 20919857


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/A_769662_20uM_Round-7_exp331.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='A-769662 20μM R07 exp331'>
{{:chemogenomics:cranks_plots:exp331.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DKC1|DKC1]]|-3.08|0.56|
|[[:human_genes:W:WBSCR16|WBSCR16]]|-2.51|0.56|
|[[:human_genes:P:PROSER1|PROSER1]]|-2.28|0.56|
|[[:human_genes:C:CEP76|CEP76]]|-2.21|0.56|
|[[:human_genes:I:IWS1|IWS1]]|-2.21|0.56|
|[[:human_genes:C:CTC1|CTC1]]|-2.19|0.56|
|[[:human_genes:S:SSB|SSB]]|-2.13|0.56|
|[[:human_genes:S:SLC35E4|SLC35E4]]|-2.08|0.56|
|[[:human_genes:X:XPO5|XPO5]]|-2.08|0.56|
|[[:human_genes:G:GTF3C2|GTF3C2]]|-2.06|0.56|
|[[:human_genes:V:VRK1|VRK1]]|-2.05|0.56|
|[[:human_genes:R:RPL22|RPL22]]|-2.04|0.63|
|[[:human_genes:S:SLC7A11|SLC7A11]]|-2.03|0.56|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-2.00|0.57|
|[[:human_genes:H:HCCS|HCCS]]|-1.98|0.56|
|[[:human_genes:Z:ZNF75A|ZNF75A]]|-1.97|0.56|
|[[:human_genes:R:RCCD1|RCCD1]]|-1.97|0.56|
|[[:human_genes:S:SERPINA10|SERPINA10]]|-1.96|0.57|
|[[:human_genes:C:CCDC153|CCDC153]]|-1.95|0.58|
|[[:human_genes:T:THG1L|THG1L]]|-1.94|0.56|
|[[:human_genes:P:PHACTR4|PHACTR4]]|-1.93|0.56|
|[[:human_genes:O:OR51B6|OR51B6]]|-1.93|0.56|
|[[:human_genes:A:ASB3|ASB3]]|-1.92|0.62|
|[[:human_genes:Y:YRDC|YRDC]]|-1.92|0.66|
|[[:human_genes:V:VEZT|VEZT]]|-1.91|0.57|
|[[:human_genes:T:TRIAP1|TRIAP1]]|-1.90|0.63|
|[[:human_genes:C:C11orf30|C11orf30]]|-1.89|0.57|
|[[:human_genes:G:GDF9|GDF9]]|-1.89|0.57|
|[[:human_genes:I:ITM2A|ITM2A]]|-1.88|0.65|
|[[:human_genes:G:GPR75-ASB3|GPR75-ASB3]]|-1.87|0.65|
|[[:human_genes:C:CCT5|CCT5]]|1.92|0.73|
|[[:human_genes:G:GNGT2|GNGT2]]|1.92|0.65|
|[[:human_genes:T:TIMELESS|TIMELESS]]|1.92|0.65|
|[[:human_genes:N:NUP205|NUP205]]|1.94|0.65|
|[[:human_genes:D:DDX11|DDX11]]|1.94|0.65|
|[[:human_genes:C:C11orf85|C11orf85]]|1.95|0.65|
|[[:human_genes:L:LMF1|LMF1]]|1.97|0.65|
|[[:human_genes:G:GOLGA6L6|GOLGA6L6]]|1.97|0.65|
|[[:human_genes:G:GPR55|GPR55]]|1.97|0.65|
|[[:human_genes:S:STIL|STIL]]|1.98|0.65|
|[[:human_genes:N:NPIPB8|NPIPB8]]|1.99|0.72|
|[[:human_genes:E:EIF4B|EIF4B]]|1.99|0.65|
|[[:human_genes:D:DRD3|DRD3]]|2.02|0.65|
|[[:human_genes:L:LOC100505679|LOC100505679]]|2.06|0.78|
|[[:human_genes:A:ATP6AP1|ATP6AP1]]|2.09|0.65|
|[[:human_genes:I:ISY1|ISY1]]|2.10|0.70|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|2.16|0.68|
|[[:human_genes:P:PSMD14|PSMD14]]|2.17|0.73|
|[[:human_genes:D:DTX3|DTX3]]|2.24|0.65|
|[[:human_genes:M:MORN2|MORN2]]|2.26|0.65|
|[[:human_genes:P:PSMD11|PSMD11]]|2.34|0.65|
|[[:human_genes:C:COPE|COPE]]|2.41|0.73|
|[[:human_genes:W:WDR46|WDR46]]|2.42|0.56|
|[[:human_genes:R:RPS16|RPS16]]|2.44|0.56|
|[[:human_genes:U:UPF1|UPF1]]|2.44|0.56|
|[[:human_genes:K:KIF3B|KIF3B]]|2.48|0.56|
|[[:human_genes:R:RBM33|RBM33]]|2.66|0.39|
|[[:human_genes:L:LRRC63|LRRC63]]|2.82|0.65|
|[[:human_genes:T:TSR2|TSR2]]|2.89|0.65|
|[[:human_genes:S:SART1|SART1]]|3.25|0.56|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>