Cidofovir 10μM R07 exp345 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Cidofovir 10μM R07 exp345 ======
==== Mechanism of Action ====
Acyclic nucleoside phosphonate, inhibits DNA polymerase
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antiviral
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Antimetabolite
  * **<color #00a2e8>Class / Subclass 3:</color>** DNA Damage, Repair and Replication / Replication Inhibitor


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Cidofovir%%
    * **<color #00a2e8>Synonyms:</color>** GS 0504; HPMPC; (S)-HPMPC
    * **<color #00a2e8>CAS #:</color>** 113852-37-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/60613|60613]]
    * **<color #00a2e8>IUPAC:</color>** %%[(2S)-1-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C8H14N3O6P/c9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16/h1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16)/t6-/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** VWFCHDSQECPREK-LURJTMIESA-N
    * **<color #00a2e8>Molecular Weight:</color>** 279.19
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CN(C(=O)N=C1N)CC(CO)OCP(=O)(O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C1=CN(C(=O)N=C1N)C[C@@H](CO)OCP(=O)(O)O
    * **<color #00a2e8>Molecular Formula:</color>** C8H14N3O6P
{{:chemogenomics:structures:chem-0203.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-17438
    * **<color #00a2e8>Lot #:</color>** 10174
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C8H14N3O6P 280.0693; found 280.0678
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Cidofovir
    * **<color #00a2e8>Min:</color>** -9.0750; **<color #00a2e8>Max:</color>** 18.2460
{{:chemogenomics:dose_response:dr_423.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 17802170


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Cidofovir_10uM_Round-7_exp345.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Cidofovir 10μM R07 exp345'>
{{:chemogenomics:cranks_plots:exp345.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NAE1|NAE1]]|-2.47|0.83|
|[[:human_genes:P:PCNA|PCNA]]|-2.11|0.85|
|[[:human_genes:Z:ZNF486|ZNF486]]|-2.03|0.83|
|[[:human_genes:R:RAD50|RAD50]]|-2.01|0.83|
|[[:human_genes:G:GTF2F2|GTF2F2]]|-1.99|0.83|
|[[:human_genes:R:RMI1|RMI1]]|-1.99|0.83|
|[[:human_genes:B:BARHL2|BARHL2]]|-1.98|0.83|
|[[:human_genes:S:SAP130|SAP130]]|-1.95|0.83|
|[[:human_genes:S:STAMBPL1|STAMBPL1]]|-1.94|0.83|
|[[:human_genes:H:HSPE1|HSPE1]]|-1.93|0.85|
|[[:human_genes:C:CDC25B|CDC25B]]|-1.92|0.83|
|[[:human_genes:Z:ZNF793|ZNF793]]|-1.92|0.83|
|[[:human_genes:K:KCTD5|KCTD5]]|-1.88|0.83|
|[[:human_genes:Z:ZC3H14|ZC3H14]]|-1.88|0.83|
|[[:human_genes:V:VPS26A|VPS26A]]|-1.87|0.83|
|[[:human_genes:M:MED4|MED4]]|-1.87|0.83|
|[[:human_genes:C:CRISP2|CRISP2]]|-1.86|0.83|
|[[:human_genes:H:HUS1|HUS1]]|-1.86|0.83|
|[[:human_genes:A:ACBD3|ACBD3]]|-1.85|0.83|
|[[:human_genes:C:CDC37L1|CDC37L1]]|-1.85|0.84|
|[[:human_genes:A:ACTR3B|ACTR3B]]|-1.84|0.83|
|[[:human_genes:M:MRPL11|MRPL11]]|-1.84|0.85|
|[[:human_genes:Z:ZIC1|ZIC1]]|-1.83|0.85|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-1.83|0.83|
|[[:human_genes:N:NPC1|NPC1]]|-1.83|0.83|
|[[:human_genes:U:UBE2N|UBE2N]]|-1.83|0.83|
|[[:human_genes:T:TAF5|TAF5]]|-1.82|0.85|
|[[:human_genes:Z:ZNF606|ZNF606]]|-1.82|0.83|
|[[:human_genes:M:MGARP|MGARP]]|-1.82|0.83|
|[[:human_genes:M:MAPK14|MAPK14]]|-1.81|0.83|
|[[:human_genes:A:ARHGAP11B|ARHGAP11B]]|1.95|0.56|
|[[:human_genes:S:SF3B1|SF3B1]]|1.99|0.51|
|[[:human_genes:T:TP53TG3D|TP53TG3D]]|2.00|0.62|
|[[:human_genes:F:FXYD4|FXYD4]]|2.01|0.51|
|[[:human_genes:R:RBM39|RBM39]]|2.02|0.77|
|[[:human_genes:D:DCX|DCX]]|2.03|0.51|
|[[:human_genes:R:RNF175|RNF175]]|2.08|0.46|
|[[:human_genes:A:ATP8B3|ATP8B3]]|2.08|0.46|
|[[:human_genes:S:SMG7|SMG7]]|2.09|0.65|
|[[:human_genes:T:TBC1D3I|TBC1D3I]]|2.10|0.75|
|[[:human_genes:T:TBC1D3E|TBC1D3E]]|2.10|0.75|
|[[:human_genes:T:TBC1D3K|TBC1D3K]]|2.10|0.75|
|[[:human_genes:T:TBC1D3L|TBC1D3L]]|2.10|0.75|
|[[:human_genes:X:XPO1|XPO1]]|2.14|0.69|
|[[:human_genes:M:MT1X|MT1X]]|2.14|0.46|
|[[:human_genes:Z:ZNF622|ZNF622]]|2.15|0.60|
|[[:human_genes:W:WAPAL|WAPAL]]|2.16|0.60|
|[[:human_genes:G:GADL1|GADL1]]|2.18|0.43|
|[[:human_genes:N:NUP160|NUP160]]|2.18|0.62|
|[[:human_genes:P:POLR2F|POLR2F]]|2.20|0.61|
|[[:human_genes:A:ALYREF|ALYREF]]|2.22|0.42|
|[[:human_genes:C:CCL2|CCL2]]|2.22|0.46|
|[[:human_genes:P:POLE|POLE]]|2.26|0.61|
|[[:human_genes:Z:ZNF852|ZNF852]]|2.26|0.51|
|[[:human_genes:W:WDR46|WDR46]]|2.27|0.51|
|[[:human_genes:P:PSMB4|PSMB4]]|2.32|0.38|
|[[:human_genes:N:NDC1|NDC1]]|2.37|0.38|
|[[:human_genes:T:TMEM174|TMEM174]]|2.50|0.38|
|[[:human_genes:P:PSMB2|PSMB2]]|2.54|0.42|
|[[:human_genes:P:POLA1|POLA1]]|3.27|0.55|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|leading strand elongation|368.42|POLA1,POLE|
|mRNA 3-splice site recognition|221.05|SF3A1,ISY1|
|mRNA export from nucleus|36.84|ALYREF,NUP160,XPO1,SMG7|
|RNA export from nucleus|28.71|ALYREF,NUP160,XPO1,SMG7|
|catalytic step 2 spliceosome|25.41|ALYREF,SF3B1,SF3A1,ISY1|
|mRNA transport|24.03|NDC1,ALYREF,NUP160,XPO1,SMG7|
|RNA transport|19.46|NDC1,ALYREF,NUP160,XPO1,SMG7|
|nucleic acid transport|19.46|NDC1,ALYREF,NUP160,XPO1,SMG7|
|establishment of RNA localization|19.19|NDC1,ALYREF,NUP160,XPO1,SMG7|
|RNA localization|16.75|NDC1,ALYREF,NUP160,XPO1,SMG7|
|nucleobase-containing compound transport|13.35|NDC1,ALYREF,NUP160,XPO1,SMG7|
|ribonucleoprotein complex|6.39|WDR46,ALYREF,ZNF622,XPO1,SMG7,SF3B1,SF3A1,ISY1|
</modal>