Losmapimod 1μM R07 exp376 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Losmapimod 1μM R07 exp376 ======
==== Mechanism of Action ====
Inhibits p38‘±/‘_ MAP kinases
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Kinase Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Losmapimod%%
    * **<color #00a2e8>Synonyms:</color>** GSK-AHAB; GW856553X; SB856553
    * **<color #00a2e8>CAS #:</color>** 585543-15-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/11552706|11552706]]
    * **<color #00a2e8>IUPAC:</color>** %%6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C22H26FN3O2/c1-13-17(9-15(10-18(13)23)21(28)26-16-6-7-16)19-8-5-14(11-24-19)20(27)25-12-22(2,3)4/h5,8-11,16H,6-7,12H2,1-4H3,(H,25,27)(H,26,28)
    * **<color #00a2e8>INCHI Key:</color>** KKYABQBFGDZVNQ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 383.5
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=C(C=C(C=C1F)C(=O)NC2CC2)C3=NC=C(C=C3)C(=O)NCC(C)(C)C
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C22H26FN3O2
{{:chemogenomics:structures:chem-0223.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S7215
    * **<color #00a2e8>Lot #:</color>** S721 501
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C22H26FN3O2 384.20818; found 384.20948
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Losmapimod
    * **<color #00a2e8>Min:</color>** -20.8875; **<color #00a2e8>Max:</color>** -2.4013
{{:chemogenomics:dose_response:dr_491.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 1µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.1
    * **<color #00a2e8>Numbers of reads</color>**: 22591304


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Losmapimod_1uM_Round-7_exp376.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Losmapimod 1μM R07 exp376'>
{{:chemogenomics:cranks_plots:exp376.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:V:VPS25|VPS25]]|-3.16|0.20|
|[[:human_genes:V:VEZT|VEZT]]|-2.67|0.10|
|[[:human_genes:A:ACTC1|ACTC1]]|-2.53|0.10|
|[[:human_genes:C:CRYBA2|CRYBA2]]|-2.53|0.10|
|[[:human_genes:O:ORC3|ORC3]]|-2.29|0.68|
|[[:human_genes:S:ST6GALNAC6|ST6GALNAC6]]|-2.21|0.41|
|[[:human_genes:V:VPS53|VPS53]]|-2.20|0.68|
|[[:human_genes:Z:ZNF681|ZNF681]]|-2.18|0.68|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.15|0.78|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.09|0.68|
|[[:human_genes:A:ADNP|ADNP]]|-2.05|0.68|
|[[:human_genes:C:CLMN|CLMN]]|-2.04|0.68|
|[[:human_genes:A:ASB3|ASB3]]|-2.04|0.68|
|[[:human_genes:B:BRIP1|BRIP1]]|-2.02|0.68|
|[[:human_genes:U:UBE2I|UBE2I]]|-2.00|0.68|
|[[:human_genes:E:EXOC3L1|EXOC3L1]]|-1.95|0.68|
|[[:human_genes:U:UST|UST]]|-1.94|0.68|
|[[:human_genes:A:APBB1IP|APBB1IP]]|-1.94|0.68|
|[[:human_genes:C:CCDC27|CCDC27]]|-1.93|0.68|
|[[:human_genes:P:PNRC2|PNRC2]]|-1.91|0.68|
|[[:human_genes:E:EFHC2|EFHC2]]|-1.90|0.68|
|[[:human_genes:P:PDE2A|PDE2A]]|-1.90|0.68|
|[[:human_genes:R:RSRC1|RSRC1]]|-1.88|0.68|
|[[:human_genes:F:FOXD4L1|FOXD4L1]]|-1.87|0.68|
|[[:human_genes:L:LDHA|LDHA]]|-1.86|0.68|
|[[:human_genes:C:CLEC4F|CLEC4F]]|-1.84|0.68|
|[[:human_genes:H:HDAC8|HDAC8]]|-1.83|0.68|
|[[:human_genes:I:IZUMO3|IZUMO3]]|-1.83|0.68|
|[[:human_genes:N:NSD1|NSD1]]|-1.83|0.68|
|[[:human_genes:K:KIF13A|KIF13A]]|-1.82|0.68|
|[[:human_genes:D:DENND3|DENND3]]|1.95|0.65|
|[[:human_genes:E:ERN1|ERN1]]|1.95|0.69|
|[[:human_genes:R:RPS14|RPS14]]|1.96|0.69|
|[[:human_genes:P:PSMD1|PSMD1]]|1.96|0.72|
|[[:human_genes:F:FAM71E1|FAM71E1]]|1.97|0.69|
|[[:human_genes:A:ARID3B|ARID3B]]|1.98|0.69|
|[[:human_genes:L:LOC100505679|LOC100505679]]|2.00|0.81|
|[[:human_genes:K:KPNB1|KPNB1]]|2.01|0.81|
|[[:human_genes:R:RPS3A|RPS3A]]|2.03|0.69|
|[[:human_genes:C:CDK8|CDK8]]|2.05|0.65|
|[[:human_genes:C:COPB1|COPB1]]|2.08|0.72|
|[[:human_genes:S:SKIV2L|SKIV2L]]|2.09|0.69|
|[[:human_genes:S:SEC13|SEC13]]|2.10|0.69|
|[[:human_genes:M:MGST1|MGST1]]|2.12|0.61|
|[[:human_genes:I:IQCG|IQCG]]|2.13|0.52|
|[[:human_genes:A:ABCB10|ABCB10]]|2.13|0.52|
|[[:human_genes:G:GATSL1|GATSL1]]|2.15|0.57|
|[[:human_genes:N:NUP155|NUP155]]|2.18|0.65|
|[[:human_genes:C:CCND3|CCND3]]|2.22|0.69|
|[[:human_genes:F:FSCN3|FSCN3]]|2.23|0.52|
|[[:human_genes:A:AAAS|AAAS]]|2.24|0.52|
|[[:human_genes:S:SCFD2|SCFD2]]|2.27|0.39|
|[[:human_genes:B:BCL11A|BCL11A]]|2.28|0.39|
|[[:human_genes:Z:ZNF331|ZNF331]]|2.28|0.39|
|[[:human_genes:R:RANGAP1|RANGAP1]]|2.30|0.57|
|[[:human_genes:L:LEPREL4|LEPREL4]]|2.32|0.39|
|[[:human_genes:F:FAM9B|FAM9B]]|2.32|0.57|
|[[:human_genes:E:ECD|ECD]]|2.37|0.72|
|[[:human_genes:R:RAD51|RAD51]]|2.39|0.65|
|[[:human_genes:P:PCNA|PCNA]]|2.47|0.72|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp421|VHL-ligand-1 20μM R07 exp421]]|0.051|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Losmapimod 1μM R07 exp376  vs  VHL-ligand-1 20μM R07 exp421">
{{:chemogenomics:comparison_plots:exp376_vs_exp421.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|nuclear pore|30.03|RANGAP1,AAAS,NUP155,SEC13,KPNB1|
</modal>