MSC2530818 10μM R07 exp379 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== MSC2530818 10μM R07 exp379 ======
==== Mechanism of Action ====
Inhibits CDK8
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Transcription Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%[(2s)-2-(4-Chlorophenyl)pyrrolidin-1-Yl](3-Methyl-1h-Pyrazolo[3,4-B]pyridin-5-Yl)methanone%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1883423-59-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/118879529|118879529]]
    * **<color #00a2e8>IUPAC:</color>** %%[(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl]-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)methanone%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C18H17ClN4O/c1-11-15-9-13(10-20-17(15)22-21-11)18(24)23-8-2-3-16(23)12-4-6-14(19)7-5-12/h4-7,9-10,16H,2-3,8H2,1H3,(H,20,21,22)/t16-/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** ODRITQGYYWHQGM-INIZCTEOSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 340.8
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=C2C=C(C=NC2=NN1)C(=O)N3CCCC3C4=CC=C(C=C4)Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** CC1=C2C=C(C=NC2=NN1)C(=O)N3CCC[C@H]3C4=CC=C(C=C4)Cl
    * **<color #00a2e8>Molecular Formula:</color>** C18H17ClN4O
{{:chemogenomics:structures:chem-0226.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S8387
    * **<color #00a2e8>Lot #:</color>** S838701
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C18H17ClN4O 341.11637; found 341.11722
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** MSC2530818
    * **<color #00a2e8>Min:</color>** -12.4323; **<color #00a2e8>Max:</color>** 17.9953
{{:chemogenomics:dose_response:dr_393.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.2
    * **<color #00a2e8>Numbers of reads</color>**: 20433427


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/MSC2530818_10uM_Round-7_exp379.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='MSC2530818 10μM R07 exp379'>
{{:chemogenomics:cranks_plots:exp379.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DKC1|DKC1]]|-3.36|0.23|
|[[:human_genes:G:GSK3B|GSK3B]]|-3.13|<0.01|
|[[:human_genes:P:PRRC2C|PRRC2C]]|-2.39|0.23|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.38|0.35|
|[[:human_genes:P:PSENEN|PSENEN]]|-2.37|0.23|
|[[:human_genes:A:ACSL4|ACSL4]]|-2.33|0.23|
|[[:human_genes:B:BRIP1|BRIP1]]|-2.32|0.23|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.31|0.23|
|[[:human_genes:C:CCNB1|CCNB1]]|-2.26|0.23|
|[[:human_genes:R:RNF165|RNF165]]|-2.25|0.23|
|[[:human_genes:S:SLC22A14|SLC22A14]]|-2.21|0.27|
|[[:human_genes:C:COG5|COG5]]|-2.19|0.23|
|[[:human_genes:V:VEZT|VEZT]]|-2.18|0.23|
|[[:human_genes:I:IRF2|IRF2]]|-2.17|0.23|
|[[:human_genes:F:FH|FH]]|-2.17|0.36|
|[[:human_genes:S:SCD|SCD]]|-2.15|0.31|
|[[:human_genes:M:MNS1|MNS1]]|-2.14|0.38|
|[[:human_genes:P:PSME3|PSME3]]|-2.14|0.23|
|[[:human_genes:C:CHD1|CHD1]]|-2.14|0.23|
|[[:human_genes:Q:QRICH1|QRICH1]]|-2.12|0.38|
|[[:human_genes:D:DDX6|DDX6]]|-2.12|0.38|
|[[:human_genes:P:PPCS|PPCS]]|-2.12|0.23|
|[[:human_genes:W:WHSC1|WHSC1]]|-2.10|0.35|
|[[:human_genes:G:GPR101|GPR101]]|-2.09|0.35|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.08|0.39|
|[[:human_genes:L:LIG4|LIG4]]|-2.07|0.35|
|[[:human_genes:I:ITGA3|ITGA3]]|-2.06|0.29|
|[[:human_genes:S:SERINC4|SERINC4]]|-2.03|0.31|
|[[:human_genes:C:CYSLTR1|CYSLTR1]]|-2.00|0.46|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-1.97|0.35|
|[[:human_genes:R:RASIP1|RASIP1]]|1.85|0.78|
|[[:human_genes:C:C2orf27B|C2orf27B]]|1.85|0.78|
|[[:human_genes:E:ESAM|ESAM]]|1.86|0.78|
|[[:human_genes:P:PLEKHG2|PLEKHG2]]|1.86|0.78|
|[[:human_genes:E:ENPP2|ENPP2]]|1.87|0.78|
|[[:human_genes:Z:ZDHHC12|ZDHHC12]]|1.93|0.78|
|[[:human_genes:N:NUCKS1|NUCKS1]]|1.93|0.78|
|[[:human_genes:C:CCNF|CCNF]]|1.93|0.78|
|[[:human_genes:M:MSH5|MSH5]]|1.93|0.78|
|[[:human_genes:C:C3orf22|C3orf22]]|1.94|0.78|
|[[:human_genes:P:PAFAH1B3|PAFAH1B3]]|1.96|0.78|
|[[:human_genes:I:IFT74|IFT74]]|1.98|0.78|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|1.99|0.78|
|[[:human_genes:P:PAN3|PAN3]]|2.01|0.77|
|[[:human_genes:S:SETDB1|SETDB1]]|2.04|0.78|
|[[:human_genes:S:SNRPD2|SNRPD2]]|2.06|0.78|
|[[:human_genes:M:MMS19|MMS19]]|2.09|0.78|
|[[:human_genes:T:TMEM134|TMEM134]]|2.14|0.55|
|[[:human_genes:F:FARSA|FARSA]]|2.17|0.78|
|[[:human_genes:U:UBE2J1|UBE2J1]]|2.18|0.52|
|[[:human_genes:C:CCDC105|CCDC105]]|2.19|0.52|
|[[:human_genes:Z:ZNF335|ZNF335]]|2.19|0.78|
|[[:human_genes:L:LRR1|LRR1]]|2.20|0.78|
|[[:human_genes:R:RPL7A|RPL7A]]|2.23|0.78|
|[[:human_genes:N:NPIPB8|NPIPB8]]|2.23|0.78|
|[[:human_genes:R:RPL10|RPL10]]|2.32|0.70|
|[[:human_genes:A:ASIC5|ASIC5]]|2.54|0.16|
|[[:human_genes:E:EP300|EP300]]|2.68|0.52|
|[[:human_genes:W:WDR45|WDR45]]|2.70|0.13|
|[[:human_genes:P:PNO1|PNO1]]|2.80|0.55|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp457|Bisphenol F 50μM R08 exp457]]|0.066|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp326|CCT251545 20μM R07 exp326]]|0.061|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="Bisphenol F 50μM R08 exp457  vs  MSC2530818 10μM R07 exp379">
{{:chemogenomics:comparison_plots:exp379_vs_exp457.png?nolink |}}
</modal>

<modal id="2" size="lg" title="CCT251545 20μM R07 exp326  vs  MSC2530818 10μM R07 exp379">
{{:chemogenomics:comparison_plots:exp326_vs_exp379.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>