Resminostat 0.5μM R07 exp393 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Resminostat 0.5μM R07 exp393 ======
==== Mechanism of Action ====
Inhibits HDAC 1, HDAC3, HDAC6
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Resminostat (hydrochloride)%%
    * **<color #00a2e8>Synonyms:</color>** RAS2410 hydrochloride; 4SC-201 hydrochloride
    * **<color #00a2e8>CAS #:</color>** 1187075-34-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/16662815|16662815]]
    * **<color #00a2e8>IUPAC:</color>** %%(E)-3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-N-hydroxyprop-2-enamide;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C16H19N3O4S.ClH/c1-18(2)11-13-3-6-15(7-4-13)24(22,23)19-10-9-14(12-19)5-8-16(20)17-21;/h3-10,12,21H,11H2,1-2H3,(H,17,20);1H/b8-5+;
    * **<color #00a2e8>INCHI Key:</color>** BVXPKDRKHXARHY-HAAWTFQLSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 385.9
    * **<color #00a2e8>Canonical SMILES:</color>** CN(C)CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C=CC(=O)NO.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** CN(C)CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)/C=C/C(=O)NO.Cl
    * **<color #00a2e8>Molecular Formula:</color>** C16H20ClN3O4S
{{:chemogenomics:structures:chem-0235.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Cayman Chemical
    * **<color #00a2e8>Catalog #:</color>** 17553
    * **<color #00a2e8>Lot #:</color>** 0469993-6
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C16H19N3O4S 350.1169; found 350.11655
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Resminostat
    * **<color #00a2e8>Min:</color>** -12.7317; **<color #00a2e8>Max:</color>** 99.4049
{{:chemogenomics:dose_response:dr_399.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.3190    |
| IC30  |0.4071    |
| IC40  |0.5085    |
| IC50  |0.6321    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 500nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.4
    * **<color #00a2e8>Numbers of reads</color>**: 20925235


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Resminostat_0.5uM_Round-7_exp393.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Resminostat 0.5μM R07 exp393'>
{{:chemogenomics:cranks_plots:exp393.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.50|0.34|
|[[:human_genes:N:NDEL1|NDEL1]]|-2.37|0.34|
|[[:human_genes:C:CCDC150|CCDC150]]|-2.26|0.34|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.23|0.34|
|[[:human_genes:C:CCDC101|CCDC101]]|-2.19|0.34|
|[[:human_genes:V:VEZT|VEZT]]|-2.18|0.34|
|[[:human_genes:B:BEND5|BEND5]]|-2.18|0.45|
|[[:human_genes:M:MRGPRX4|MRGPRX4]]|-2.17|0.67|
|[[:human_genes:C:CENPW|CENPW]]|-2.16|0.34|
|[[:human_genes:T:TCF4|TCF4]]|-2.16|0.34|
|[[:human_genes:G:GNAS|GNAS]]|-2.14|0.34|
|[[:human_genes:S:SPIC|SPIC]]|-2.08|0.43|
|[[:human_genes:M:MPHOSPH8|MPHOSPH8]]|-2.02|0.51|
|[[:human_genes:G:GPATCH1|GPATCH1]]|-1.99|0.67|
|[[:human_genes:C:C2CD5|C2CD5]]|-1.98|0.59|
|[[:human_genes:P:PPHLN1|PPHLN1]]|-1.96|0.60|
|[[:human_genes:T:TCOF1|TCOF1]]|-1.96|0.67|
|[[:human_genes:R:RAD21L1|RAD21L1]]|-1.95|0.60|
|[[:human_genes:O:OSGEP|OSGEP]]|-1.90|0.77|
|[[:human_genes:F:FCGR3B|FCGR3B]]|-1.88|0.67|
|[[:human_genes:Z:ZNF679|ZNF679]]|-1.88|0.67|
|[[:human_genes:U:UHRF1|UHRF1]]|-1.88|0.77|
|[[:human_genes:T:TP53RK|TP53RK]]|-1.87|0.77|
|[[:human_genes:P:PDCL2|PDCL2]]|-1.85|0.77|
|[[:human_genes:F:FAM172A|FAM172A]]|-1.85|0.67|
|[[:human_genes:T:TRAPPC3|TRAPPC3]]|-1.85|0.67|
|[[:human_genes:H:HELZ|HELZ]]|-1.85|0.67|
|[[:human_genes:G:GPATCH8|GPATCH8]]|-1.84|0.67|
|[[:human_genes:T:TMEM200B|TMEM200B]]|-1.84|0.77|
|[[:human_genes:O:OR5AR1|OR5AR1]]|-1.83|0.69|
|[[:human_genes:P:PDZD4|PDZD4]]|1.90|0.57|
|[[:human_genes:T:TNFSF15|TNFSF15]]|1.91|0.57|
|[[:human_genes:S:SLCO1B7|SLCO1B7]]|1.92|0.57|
|[[:human_genes:Z:ZDHHC4|ZDHHC4]]|1.92|0.59|
|[[:human_genes:A:AKAP3|AKAP3]]|1.93|0.57|
|[[:human_genes:F:FUBP3|FUBP3]]|1.93|0.57|
|[[:human_genes:I:ING5|ING5]]|1.93|0.57|
|[[:human_genes:O:OR52B4|OR52B4]]|1.94|0.57|
|[[:human_genes:M:MRPS35|MRPS35]]|2.00|0.64|
|[[:human_genes:B:BRD1|BRD1]]|2.02|0.54|
|[[:human_genes:N:NXNL1|NXNL1]]|2.02|0.57|
|[[:human_genes:P:PSMB4|PSMB4]]|2.03|0.54|
|[[:human_genes:R:RPL22|RPL22]]|2.04|0.59|
|[[:human_genes:T:TP53INP1|TP53INP1]]|2.05|0.54|
|[[:human_genes:R:RGS11|RGS11]]|2.07|0.57|
|[[:human_genes:C:C19orf53|C19orf53]]|2.16|0.54|
|[[:human_genes:C:CCDC94|CCDC94]]|2.18|0.59|
|[[:human_genes:R:RPL12|RPL12]]|2.19|0.59|
|[[:human_genes:P:POLE|POLE]]|2.21|0.59|
|[[:human_genes:K:KRTAP22-2|KRTAP22-2]]|2.24|0.31|
|[[:human_genes:C:COPE|COPE]]|2.26|0.77|
|[[:human_genes:D:DEF8|DEF8]]|2.31|0.31|
|[[:human_genes:B:BSX|BSX]]|2.32|0.36|
|[[:human_genes:P:PCYT1B|PCYT1B]]|2.38|0.31|
|[[:human_genes:R:RPS3A|RPS3A]]|2.55|0.31|
|[[:human_genes:L:LARP4|LARP4]]|2.56|0.15|
|[[:human_genes:I:ILF3|ILF3]]|2.58|0.57|
|[[:human_genes:C:CKAP5|CKAP5]]|2.70|0.54|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.77|0.68|
|[[:human_genes:M:MTF1|MTF1]]|2.99|0.05|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp415|Trichostatin-A 0.06μM R07 exp415]]|0.055|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp336|Asunaprenir 3μM R07 exp336]]|0.059|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="Resminostat 0.5μM R07 exp393  vs  Trichostatin-A 0.06μM R07 exp415">
{{:chemogenomics:comparison_plots:exp393_vs_exp415.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Asunaprenir 3μM R07 exp336  vs  Resminostat 0.5μM R07 exp393">
{{:chemogenomics:comparison_plots:exp336_vs_exp393.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>