BI-6727 0.001μM R01 exp42 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== BI-6727 0.001μM R01 exp42 ======
==== Mechanism of Action ====
Inhibits PLK1 kinase, causes G2/M arrest, improved version of BI-2536
  * **<color #00a2e8>Class / Subclass 1:</color>** Cell Cycle / Mitotic Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Volasertib%%
    * **<color #00a2e8>Synonyms:</color>** BI 6727
    * **<color #00a2e8>CAS #:</color>** 755038-65-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/10461508|10461508]]
    * **<color #00a2e8>IUPAC:</color>** %%N-[4-[4-(cyclopropylmethyl)piperazin-1-yl]cyclohexyl]-4-[[(7R)-7-ethyl-5-methyl-6-oxo-8-propan-2-yl-7H-pteridin-2-yl]amino]-3-methoxybenzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C34H50N8O3/c1-6-28-33(44)39(4)29-20-35-34(38-31(29)42(28)22(2)3)37-27-14-9-24(19-30(27)45-5)32(43)36-25-10-12-26(13-11-25)41-17-15-40(16-18-41)21-23-7-8-23/h9,14,19-20,22-23,25-26,28H,6-8,10-13,15-18,21H2,1-5H3,(H,36,43)(H,35,37,38)/t25?,26?,28-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** SXNJFOWDRLKDSF-XKHVUIRMSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 618.8
    * **<color #00a2e8>Canonical SMILES:</color>** CCC1C(=O)N(C2=CN=C(N=C2N1C(C)C)NC3=C(C=C(C=C3)C(=O)NC4CCC(CC4)N5CCN(CC5)CC6CC6)OC)C
    * **<color #00a2e8>Isomeric SMILES:</color>** CC[C@@H]1C(=O)N(C2=CN=C(N=C2N1C(C)C)NC3=C(C=C(C=C3)C(=O)NC4CCC(CC4)N5CCN(CC5)CC6CC6)OC)C
    * **<color #00a2e8>Molecular Formula:</color>** C34H50N8O3
{{:chemogenomics:structures:chem-0023.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-12137
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C34H50N8O3 619.40786; found 619.4097
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** BI6727
    * **<color #00a2e8>Min:</color>** -7.8407; **<color #00a2e8>Max:</color>** 99.1028
{{:chemogenomics:dose_response:dr_75.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.0061    |
| IC30  |0.0129    |
| IC40  |0.0238    |
| IC50  |0.0420    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 01
    * **<color #00a2e8>Dose</color>**: 1nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 12280512


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/BI-6727_0.001uM_Round-1_exp42.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='BI-6727 0.001μM R01 exp42'>
{{:chemogenomics:cranks_plots:exp42.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:UBA3|UBA3]]|-2.55|0.81|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.54|0.81|
|[[:human_genes:D:DLG5|DLG5]]|-2.34|0.81|
|[[:human_genes:P:PSMG4|PSMG4]]|-2.32|0.81|
|[[:human_genes:U:USP17L17|USP17L17]]|-2.30|0.87|
|[[:human_genes:S:SRPK1|SRPK1]]|-2.29|0.81|
|[[:human_genes:F:FSD2|FSD2]]|-2.26|0.81|
|[[:human_genes:W:WDR27|WDR27]]|-2.22|0.81|
|[[:human_genes:W:WDR82|WDR82]]|-2.20|0.81|
|[[:human_genes:H:HIST1H4C|HIST1H4C]]|-2.18|0.81|
|[[:human_genes:P:PRSS38|PRSS38]]|-2.18|0.81|
|[[:human_genes:R:RFWD3|RFWD3]]|-2.12|0.81|
|[[:human_genes:G:GPN2|GPN2]]|-2.09|0.81|
|[[:human_genes:N:NBPF12|NBPF12]]|-2.09|0.88|
|[[:human_genes:S:SENP5|SENP5]]|-2.07|0.81|
|[[:human_genes:R:RINL|RINL]]|-2.06|0.83|
|[[:human_genes:T:TIPARP|TIPARP]]|-2.05|0.81|
|[[:human_genes:N:NSMCE1|NSMCE1]]|-2.04|0.81|
|[[:human_genes:P:PFN1|PFN1]]|-2.03|0.81|
|[[:human_genes:C:C11orf74|C11orf74]]|-2.01|0.81|
|[[:human_genes:A:ALPL|ALPL]]|-2.01|0.81|
|[[:human_genes:D:DICER1|DICER1]]|-2.00|0.81|
|[[:human_genes:T:THEGL|THEGL]]|-2.00|0.81|
|[[:human_genes:T:TGM2|TGM2]]|-2.00|0.81|
|[[:human_genes:P:PELI3|PELI3]]|-1.99|0.81|
|[[:human_genes:S:SMPD3|SMPD3]]|-1.98|0.85|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-1.97|0.81|
|[[:human_genes:G:G2E3|G2E3]]|-1.97|0.81|
|[[:human_genes:E:ETV7|ETV7]]|-1.97|0.81|
|[[:human_genes:P:PSKH2|PSKH2]]|-1.97|0.81|
|[[:human_genes:O:OXR1|OXR1]]|2.11|0.39|
|[[:human_genes:N:NRIP1|NRIP1]]|2.11|0.41|
|[[:human_genes:T:TNFRSF6B|TNFRSF6B]]|2.11|0.47|
|[[:human_genes:U:U2AF2|U2AF2]]|2.17|0.51|
|[[:human_genes:C:CCND3|CCND3]]|2.18|0.51|
|[[:human_genes:H:HDGFRP2|HDGFRP2]]|2.20|0.50|
|[[:human_genes:P:PPP2R2A|PPP2R2A]]|2.23|0.49|
|[[:human_genes:E:ELTD1|ELTD1]]|2.24|0.39|
|[[:human_genes:R:RFC4|RFC4]]|2.25|0.47|
|[[:human_genes:K:KCNJ2|KCNJ2]]|2.26|0.59|
|[[:human_genes:C:CCDC153|CCDC153]]|2.28|0.41|
|[[:human_genes:O:OR52A5|OR52A5]]|2.28|0.39|
|[[:human_genes:P:PSMG1|PSMG1]]|2.29|0.39|
|[[:human_genes:P:PSMA3|PSMA3]]|2.31|0.41|
|[[:human_genes:S:SMARCE1|SMARCE1]]|2.32|0.53|
|[[:human_genes:S:SPATA12|SPATA12]]|2.33|0.36|
|[[:human_genes:P:PSMA6|PSMA6]]|2.33|0.41|
|[[:human_genes:S:SMAD2|SMAD2]]|2.35|0.41|
|[[:human_genes:C:CACNG6|CACNG6]]|2.36|0.36|
|[[:human_genes:Z:ZNF497|ZNF497]]|2.36|0.39|
|[[:human_genes:A:AHCTF1|AHCTF1]]|2.37|0.66|
|[[:human_genes:B:BRD8|BRD8]]|2.38|0.41|
|[[:human_genes:F:FAM178A|FAM178A]]|2.48|0.72|
|[[:human_genes:E:ERC1|ERC1]]|2.54|0.39|
|[[:human_genes:C:C6orf120|C6orf120]]|2.54|0.39|
|[[:human_genes:S:SLC4A1|SLC4A1]]|2.60|0.41|
|[[:human_genes:A:AAAS|AAAS]]|2.63|0.39|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|2.82|0.41|
|[[:human_genes:S:SERGEF|SERGEF]]|2.82|0.36|
|[[:human_genes:P:PRPF31|PRPF31]]|2.83|0.41|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp58|UM131593 0.1μM R01 exp58]]|0.068|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp54|Taxol 0.002μM R01 exp54]]|0.058|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="BI-6727 0.001μM R01 exp42  vs  UM131593 0.1μM R01 exp58">
{{:chemogenomics:comparison_plots:exp42_vs_exp58.png?nolink |}}
</modal>

<modal id="2" size="lg" title="BI-6727 0.001μM R01 exp42  vs  Taxol 0.002μM R01 exp54">
{{:chemogenomics:comparison_plots:exp42_vs_exp54.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>