YM155 0.001μM R08 exp432 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== YM155 0.001μM R08 exp432 ======
==== Mechanism of Action ====
Inhibits expression of survivin, amongst other ascribed mechanisms
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Transcription Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Apoptosis Activator



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Sepantronium bromide%%
    * **<color #00a2e8>Synonyms:</color>** Sepantronium bromide
    * **<color #00a2e8>CAS #:</color>** 781661-94-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/11178236|11178236]]
    * **<color #00a2e8>IUPAC:</color>** %%1-(2-methoxyethyl)-2-methyl-3-(pyrazin-2-ylmethyl)benzo[f]benzimidazol-3-ium-4,9-dione;bromide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H19N4O3.BrH/c1-13-23(9-10-27-2)17-18(24(13)12-14-11-21-7-8-22-14)20(26)16-6-4-3-5-15(16)19(17)25;/h3-8,11H,9-10,12H2,1-2H3;1H/q+1;/p-1
    * **<color #00a2e8>INCHI Key:</color>** QBIYUDDJPRGKNJ-UHFFFAOYSA-M
    * **<color #00a2e8>Molecular Weight:</color>** 443.3
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=[N+](C2=C(N1CCOC)C(=O)C3=CC=CC=C3C2=O)CC4=NC=CN=C4.[Br-]
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H19BrN4O3
{{:chemogenomics:structures:chem-0041.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S1130
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M)+ Calcd for C20 H19 N4 O3 363.14572; found 363.14685
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** YM155
    * **<color #00a2e8>Min:</color>** -11.6044; **<color #00a2e8>Max:</color>** 94.1406
{{:chemogenomics:dose_response:dr_633.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |0.0008    |
| IC20  |0.0010    |
| IC30  |0.0012    |
| IC40  |0.0015    |
| IC50  |0.0017    |
| IC60  |0.0019    |
| IC70  |0.0023    |
| IC80  |0.0027    |
| IC90  |0.0036    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 1nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.2
    * **<color #00a2e8>Numbers of reads</color>**: 15030053


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|6/2|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/YM155_0.001uM_Round-8_exp432.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='YM155 0.001μM R08 exp432'>
{{:chemogenomics:cranks_plots:exp432.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:A:ABCC1|ABCC1]]|-4.55|<0.01|
|[[:human_genes:P:PRDX1|PRDX1]]|-3.34|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-3.27|<0.01|
|[[:human_genes:N:NUMB|NUMB]]|-3.13|<0.01|
|[[:human_genes:K:KCTD5|KCTD5]]|-3.01|<0.01|
|[[:human_genes:P:PYROXD1|PYROXD1]]|-2.83|0.28|
|[[:human_genes:S:SH3GL1|SH3GL1]]|-2.78|0.06|
|[[:human_genes:L:LCMT1|LCMT1]]|-2.65|0.03|
|[[:human_genes:C:CYB5R4|CYB5R4]]|-2.48|0.10|
|[[:human_genes:T:TMEM30A|TMEM30A]]|-2.46|0.06|
|[[:human_genes:R:RALGAPB|RALGAPB]]|-2.34|0.10|
|[[:human_genes:P:PPP6C|PPP6C]]|-2.34|0.15|
|[[:human_genes:F:FDXR|FDXR]]|-2.32|0.16|
|[[:human_genes:A:AP2A2|AP2A2]]|-2.31|0.10|
|[[:human_genes:U:UBE3D|UBE3D]]|-2.28|0.12|
|[[:human_genes:S:SUCLG1|SUCLG1]]|-2.25|0.13|
|[[:human_genes:S:SLC16A2|SLC16A2]]|-2.18|0.24|
|[[:human_genes:F:FAM117A|FAM117A]]|-2.17|0.16|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.14|0.18|
|[[:human_genes:R:RABGEF1|RABGEF1]]|-2.12|0.25|
|[[:human_genes:E:ENO2|ENO2]]|-2.11|0.25|
|[[:human_genes:M:MARK2|MARK2]]|-2.10|0.22|
|[[:human_genes:C:COMMD3|COMMD3]]|-2.08|0.23|
|[[:human_genes:P:POLR3GL|POLR3GL]]|-2.06|0.28|
|[[:human_genes:A:AASDHPPT|AASDHPPT]]|-2.06|0.24|
|[[:human_genes:N:NFU1|NFU1]]|-2.06|0.44|
|[[:human_genes:A:ARHGAP11B|ARHGAP11B]]|-2.05|0.24|
|[[:human_genes:C:CCS|CCS]]|-2.04|0.24|
|[[:human_genes:N:NOSIP|NOSIP]]|-2.03|0.29|
|[[:human_genes:C:COMMD3-BMI1|COMMD3-BMI1]]|-2.02|0.25|
|[[:human_genes:O:OR1N1|OR1N1]]|1.94|0.50|
|[[:human_genes:W:WTAP|WTAP]]|1.95|0.54|
|[[:human_genes:T:TIMM23B|TIMM23B]]|1.95|0.68|
|[[:human_genes:Z:ZNF687|ZNF687]]|1.96|0.50|
|[[:human_genes:P:PSMD7|PSMD7]]|1.97|0.66|
|[[:human_genes:O:OR2AK2|OR2AK2]]|1.98|0.50|
|[[:human_genes:P:PLAC8|PLAC8]]|1.98|0.50|
|[[:human_genes:P:PDP2|PDP2]]|1.98|0.50|
|[[:human_genes:N:NUMA1|NUMA1]]|1.98|0.52|
|[[:human_genes:C:CHD4|CHD4]]|2.00|0.50|
|[[:human_genes:R:RPAP3|RPAP3]]|2.02|0.50|
|[[:human_genes:C:C3orf55|C3orf55]]|2.03|0.50|
|[[:human_genes:P:PDE9A|PDE9A]]|2.03|0.50|
|[[:human_genes:D:DPM1|DPM1]]|2.04|0.50|
|[[:human_genes:A:ANKHD1-EIF4EBP3|ANKHD1-EIF4EBP3]]|2.04|0.50|
|[[:human_genes:G:GGT7|GGT7]]|2.07|0.50|
|[[:human_genes:G:GPS1|GPS1]]|2.08|0.50|
|[[:human_genes:U:UPF2|UPF2]]|2.10|0.70|
|[[:human_genes:P:PSMD4|PSMD4]]|2.10|0.50|
|[[:human_genes:C:CYB5B|CYB5B]]|2.11|0.50|
|[[:human_genes:P:POLE2|POLE2]]|2.15|0.60|
|[[:human_genes:C:CERK|CERK]]|2.19|0.50|
|[[:human_genes:A:ABHD5|ABHD5]]|2.25|0.50|
|[[:human_genes:Z:ZC3H14|ZC3H14]]|2.27|0.50|
|[[:human_genes:P:PRR14L|PRR14L]]|2.37|0.29|
|[[:human_genes:R:RPL9|RPL9]]|2.49|0.50|
|[[:human_genes:Z:ZNF681|ZNF681]]|2.61|0.50|
|[[:human_genes:E:ECHS1|ECHS1]]|3.09|<0.01|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|3.42|0.50|
|[[:human_genes:S:SLC35F2|SLC35F2]]|4.32|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp292|Menadione 5μM R06 exp292]]|0.052|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Menadione 5μM R06 exp292  vs  YM155 0.001μM R08 exp432">
{{:chemogenomics:comparison_plots:exp292_vs_exp432.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>