ETC-159 50μM R08 exp480 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== ETC-159 50μM R08 exp480 ======
==== Mechanism of Action ====
Inhibits PORCN palmitoyl transferase that modifies WNT ligands
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Other Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Etc-159%%
    * **<color #00a2e8>Synonyms:</color>** ETC-1922159
    * **<color #00a2e8>CAS #:</color>** 1638250-96-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/86280523|86280523]]
    * **<color #00a2e8>IUPAC:</color>** %%2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(6-phenylpyridazin-3-yl)acetamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C19H17N7O3/c1-24-17-16(18(28)25(2)19(24)29)26(11-20-17)10-15(27)21-14-9-8-13(22-23-14)12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,21,23,27)
    * **<color #00a2e8>INCHI Key:</color>** QTRXIFVSTWXRJJ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 391.4
    * **<color #00a2e8>Canonical SMILES:</color>** CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)NC3=NN=C(C=C3)C4=CC=CC=C4
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C19H17N7O3
{{:chemogenomics:structures:chem-0289.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-18988
    * **<color #00a2e8>Lot #:</color>** 18685
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C19H17N7O3 392.14656; found 392.14729
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** ETC159
    * **<color #00a2e8>Min:</color>** -27.6061; **<color #00a2e8>Max:</color>** 13.1023
{{:chemogenomics:dose_response:dr_533.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 50µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.3
    * **<color #00a2e8>Numbers of reads</color>**: 16937241


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|12/3|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/ETC-159_50uM_Round-8_exp480.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='ETC-159 50μM R08 exp480'>
{{:chemogenomics:cranks_plots:exp480.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:L:LCMT1|LCMT1]]|-3.93|<0.01|
|[[:human_genes:G:GPR107|GPR107]]|-3.92|<0.01|
|[[:human_genes:A:ARL1|ARL1]]|-3.56|<0.01|
|[[:human_genes:P:PPME1|PPME1]]|-3.55|<0.01|
|[[:human_genes:P:PPP6C|PPP6C]]|-3.52|<0.01|
|[[:human_genes:S:SLC39A9|SLC39A9]]|-3.29|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-3.24|<0.01|
|[[:human_genes:B:BACH2|BACH2]]|-2.90|0.01|
|[[:human_genes:K:KCTD5|KCTD5]]|-2.88|<0.01|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.77|<0.01|
|[[:human_genes:M:MSL1|MSL1]]|-2.59|0.05|
|[[:human_genes:C:CSK|CSK]]|-2.51|0.03|
|[[:human_genes:C:CNOT8|CNOT8]]|-2.41|0.05|
|[[:human_genes:P:PPP2CA|PPP2CA]]|-2.33|0.14|
|[[:human_genes:P:PDCD6IP|PDCD6IP]]|-2.28|0.10|
|[[:human_genes:D:DARS2|DARS2]]|-2.22|0.46|
|[[:human_genes:A:ATP2B1|ATP2B1]]|-2.20|0.24|
|[[:human_genes:R:RAPGEF3|RAPGEF3]]|-2.19|0.14|
|[[:human_genes:R:RFWD2|RFWD2]]|-2.16|0.16|
|[[:human_genes:A:ACTB|ACTB]]|-2.13|0.18|
|[[:human_genes:D:DLD|DLD]]|-2.12|0.30|
|[[:human_genes:C:CTDSPL2|CTDSPL2]]|-2.10|0.30|
|[[:human_genes:Z:ZNF445|ZNF445]]|-2.09|0.31|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.06|0.32|
|[[:human_genes:S:SMG9|SMG9]]|-2.05|0.35|
|[[:human_genes:F:FAM134A|FAM134A]]|-2.02|0.30|
|[[:human_genes:S:SS18|SS18]]|-1.99|0.30|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-1.99|0.30|
|[[:human_genes:X:XPR1|XPR1]]|-1.99|0.30|
|[[:human_genes:S:SRRD|SRRD]]|-1.96|0.32|
|[[:human_genes:S:SLCO1B3|SLCO1B3]]|1.97|0.39|
|[[:human_genes:L:LSR|LSR]]|1.98|0.62|
|[[:human_genes:Z:ZSCAN22|ZSCAN22]]|1.98|0.39|
|[[:human_genes:U:U2AF2|U2AF2]]|1.99|0.62|
|[[:human_genes:O:OR8U8|OR8U8]]|1.99|0.72|
|[[:human_genes:T:TRIM37|TRIM37]]|2.00|0.36|
|[[:human_genes:N:NAT10|NAT10]]|2.01|0.62|
|[[:human_genes:M:MTRNR2L4|MTRNR2L4]]|2.03|0.79|
|[[:human_genes:R:RTP2|RTP2]]|2.04|0.32|
|[[:human_genes:N:NSMAF|NSMAF]]|2.06|0.30|
|[[:human_genes:C:C21orf2|C21orf2]]|2.08|0.29|
|[[:human_genes:G:GLE1|GLE1]]|2.11|0.64|
|[[:human_genes:R:RRM2|RRM2]]|2.15|0.74|
|[[:human_genes:M:MS4A13|MS4A13]]|2.17|0.73|
|[[:human_genes:H:HNRNPAB|HNRNPAB]]|2.18|0.20|
|[[:human_genes:S:SCEL|SCEL]]|2.21|0.18|
|[[:human_genes:C:CUL1|CUL1]]|2.24|0.18|
|[[:human_genes:B:BAZ2A|BAZ2A]]|2.25|0.26|
|[[:human_genes:K:KMT2D|KMT2D]]|2.35|0.11|
|[[:human_genes:U:USP37|USP37]]|2.35|0.18|
|[[:human_genes:S:SLC1A6|SLC1A6]]|2.35|0.11|
|[[:human_genes:A:ATP8B2|ATP8B2]]|2.39|0.26|
|[[:human_genes:S:SLC7A1|SLC7A1]]|2.44|0.36|
|[[:human_genes:E:ETFB|ETFB]]|2.47|0.07|
|[[:human_genes:F:FDPS|FDPS]]|2.68|0.07|
|[[:human_genes:N:NOP58|NOP58]]|2.71|0.10|
|[[:human_genes:P:PSMB8|PSMB8]]|2.72|0.04|
|[[:human_genes:S:SRM|SRM]]|2.83|0.03|
|[[:human_genes:N:NUMA1|NUMA1]]|2.94|0.06|
|[[:human_genes:P:PCGF1|PCGF1]]|3.10|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp190|Vincristine 0.0005μM R04 exp190]]|0.057|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp269|Bisphenol A 100μM R06 exp269]]|0.061|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp233|EPZ-5676 30μM R05 exp233]]|0.055|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp455|Benzoate 10000μM R08 exp455]]|0.051|<button type="primary" size="small" modal="4">View</button>|
</modal>


<modal id="1" size="lg" title="ETC-159 50μM R08 exp480  vs  Vincristine 0.0005μM R04 exp190">
{{:chemogenomics:comparison_plots:exp190_vs_exp480.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Bisphenol A 100μM R06 exp269  vs  ETC-159 50μM R08 exp480">
{{:chemogenomics:comparison_plots:exp269_vs_exp480.png?nolink |}}
</modal>

<modal id="3" size="lg" title="EPZ-5676 30μM R05 exp233  vs  ETC-159 50μM R08 exp480">
{{:chemogenomics:comparison_plots:exp233_vs_exp480.png?nolink |}}
</modal>

<modal id="4" size="lg" title="Benzoate 10000μM R08 exp455  vs  ETC-159 50μM R08 exp480">
{{:chemogenomics:comparison_plots:exp455_vs_exp480.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>