Nifuroxazide 1μM R01 exp51 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Nifuroxazide 1μM R01 exp51 ======
==== Mechanism of Action ====
Nitrofuran antibiotic
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antibiotic




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nifuroxazide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 965-52-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5337997|5337997]]
    * **<color #00a2e8>IUPAC:</color>** %%4-hydroxy-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C12H9N3O5/c16-9-3-1-8(2-4-9)12(17)14-13-7-10-5-6-11(20-10)15(18)19/h1-7,16H,(H,14,17)/b13-7+
    * **<color #00a2e8>INCHI Key:</color>** YCWSUKQGVSGXJO-NTUHNPAUSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 275.22
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CC=C1C(=O)NN=CC2=CC=C(O2)[N+](=O)[O-])O
    * **<color #00a2e8>Isomeric SMILES:</color>** C1=CC(=CC=C1C(=O)N/N=C/C2=CC=C(O2)[N+](=O)[O-])O
    * **<color #00a2e8>Molecular Formula:</color>** C12H9N3O5
{{:chemogenomics:structures:chem-0031.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** 481984
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C12H9N3O5 276.0615; found 276.0611
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** NAZ
    * **<color #00a2e8>Min:</color>** -7.3989; **<color #00a2e8>Max:</color>** 98.6617
{{:chemogenomics:dose_response:dr_99.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |3.0271    |
| IC30  |5.0046    |
| IC40  |7.5570    |
| IC50  |11.0306    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 01
    * **<color #00a2e8>Dose</color>**: 1µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 10600757


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nifuroxazide_1uM_Round-1_exp51.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nifuroxazide 1μM R01 exp51'>
{{:chemogenomics:cranks_plots:exp51.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GMPPB|GMPPB]]|-3.01|0.23|
|[[:human_genes:C:CTPS1|CTPS1]]|-2.78|0.24|
|[[:human_genes:P:PRDX1|PRDX1]]|-2.77|0.07|
|[[:human_genes:N:NARS|NARS]]|-2.67|0.51|
|[[:human_genes:U:UBE3D|UBE3D]]|-2.51|0.26|
|[[:human_genes:S:SUCLA2|SUCLA2]]|-2.45|0.24|
|[[:human_genes:V:VEZT|VEZT]]|-2.43|0.24|
|[[:human_genes:S:SLC39A10|SLC39A10]]|-2.41|0.24|
|[[:human_genes:I:ISCA1|ISCA1]]|-2.38|0.51|
|[[:human_genes:D:DLG3|DLG3]]|-2.36|0.51|
|[[:human_genes:T:TBCD|TBCD]]|-2.32|0.51|
|[[:human_genes:F:FREM3|FREM3]]|-2.32|0.26|
|[[:human_genes:S:SUCLG1|SUCLG1]]|-2.32|0.26|
|[[:human_genes:N:NSMCE1|NSMCE1]]|-2.27|0.51|
|[[:human_genes:B:BANF1|BANF1]]|-2.26|0.63|
|[[:human_genes:G:GABPB2|GABPB2]]|-2.19|0.51|
|[[:human_genes:R:RAP1A|RAP1A]]|-2.18|0.51|
|[[:human_genes:C:CEP57|CEP57]]|-2.16|0.51|
|[[:human_genes:Z:ZNF708|ZNF708]]|-2.12|0.69|
|[[:human_genes:C:C19orf70|C19orf70]]|-2.11|0.51|
|[[:human_genes:P:PRDM10|PRDM10]]|-2.11|0.51|
|[[:human_genes:P:PZP|PZP]]|-2.09|0.69|
|[[:human_genes:A:AGA|AGA]]|-2.09|0.51|
|[[:human_genes:U:UBASH3B|UBASH3B]]|-2.09|0.51|
|[[:human_genes:A:AP3S2|AP3S2]]|-2.09|0.51|
|[[:human_genes:P:PF4V1|PF4V1]]|-2.08|0.51|
|[[:human_genes:M:MSANTD4|MSANTD4]]|-2.07|0.51|
|[[:human_genes:M:MRPS5|MRPS5]]|-2.05|0.51|
|[[:human_genes:Z:ZNF835|ZNF835]]|-2.03|0.51|
|[[:human_genes:C:CARD8|CARD8]]|-2.02|0.69|
|[[:human_genes:D:DNAJC24|DNAJC24]]|2.17|0.55|
|[[:human_genes:N:NOL12|NOL12]]|2.17|0.63|
|[[:human_genes:Z:ZNF219|ZNF219]]|2.18|0.55|
|[[:human_genes:P:PDS5B|PDS5B]]|2.18|0.55|
|[[:human_genes:U:U2AF2|U2AF2]]|2.19|0.57|
|[[:human_genes:F:FCN2|FCN2]]|2.20|0.55|
|[[:human_genes:R:RPL23A|RPL23A]]|2.20|0.63|
|[[:human_genes:E:ERCC6|ERCC6]]|2.23|0.63|
|[[:human_genes:S:SLC30A3|SLC30A3]]|2.23|0.56|
|[[:human_genes:S:SUPT6H|SUPT6H]]|2.24|0.63|
|[[:human_genes:Z:ZNF598|ZNF598]]|2.25|0.56|
|[[:human_genes:A:ATP6AP2|ATP6AP2]]|2.27|0.56|
|[[:human_genes:Y:YTHDF1|YTHDF1]]|2.27|0.55|
|[[:human_genes:G:GOT1|GOT1]]|2.28|0.36|
|[[:human_genes:M:MYLK3|MYLK3]]|2.32|0.63|
|[[:human_genes:M:MEF2A|MEF2A]]|2.35|0.63|
|[[:human_genes:S:SPATA12|SPATA12]]|2.38|0.14|
|[[:human_genes:T:TNPO3|TNPO3]]|2.38|0.57|
|[[:human_genes:R:RAPSN|RAPSN]]|2.38|0.63|
|[[:human_genes:I:INHA|INHA]]|2.38|0.55|
|[[:human_genes:I:IQGAP3|IQGAP3]]|2.39|0.63|
|[[:human_genes:M:MAPK8IP1|MAPK8IP1]]|2.42|0.14|
|[[:human_genes:A:ARID4B|ARID4B]]|2.43|0.36|
|[[:human_genes:G:GNS|GNS]]|2.44|0.55|
|[[:human_genes:S:STIP1|STIP1]]|2.50|0.63|
|[[:human_genes:P:PSMA6|PSMA6]]|2.62|0.36|
|[[:human_genes:P:PSMB4|PSMB4]]|2.68|0.14|
|[[:human_genes:U:UHRF1BP1L|UHRF1BP1L]]|2.79|0.14|
|[[:human_genes:V:VPS37B|VPS37B]]|2.91|0.14|
|[[:human_genes:M:MYO9A|MYO9A]]|3.46|0.14|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp49|NFN1 0.1μM R01 exp49]]|0.063|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="NFN1 0.1μM R01 exp49  vs  Nifuroxazide 1μM R01 exp51">
{{:chemogenomics:comparison_plots:exp49_vs_exp51.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|succinate-CoA ligase activity|689.83|SUCLA2,SUCLG1|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>